Homework Answers
Add Answer to:
please answer all of the 4 questions
What cyclic product is formed in the intramolecular Aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol...
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
1. What is the major organic product obtained from the following intramolecular aldol condensation reaction? NaOH,...
1. What is the major organic product obtained from the following intramolecular aldol condensation reaction? NaOH, HẠO . 1 b. 2 . 3 d. 4 2. What is the major organic product obtained from the following intramolecular Claisen Condensation (Diepkova ) reaction? مع عمه Baraeenie Product onlained from ( 1. NaOCH2CH3 CH3CH2OH CH3CH30 OCH2CH3 2. H30+ OCH CHE OCH2CH3 مسلسلا سلال OCH2CH3 OCH2CH3
Answer clicked by accident, not necessarily correct Which of the following molecules cannot undergo an intramolecular...
Answer clicked by accident, not necessarily correct
Which of the following molecules cannot undergo an intramolecular aldol condensation when treated with Na0H? IV O IV
What is the cyclic hemiacetal product formed from intramolecular cyclization of the following hydroxy aldehyde?
What is the cyclic hemiacetal product formed from intramolecular cyclization of the following hydroxy aldehyde?
3. Draw all the aldol addition products that are formed when a mixture of acetaldehyde and...
3. Draw all the aldol addition products that are formed when a
mixture of acetaldehyde and pentanal is treated with aqueous sodium
hydroxide.
4. A reaction, such as described in question 3, which produces a
mixture of products is generally not useful for organic synthesis.
Suggest a change in the reaction starting materials for question 3
that would produce a single, similar product.
5. Draw a generic mechanism for aldol condensation.
6. The last step for an aldol condensation involves...
6. Give all possible structures of the product (C20H1203) formed by intramolecular Claisen condensation of the...
6. Give all possible structures of the product (C20H1203) formed by intramolecular Claisen condensation of the keto-ester shown below. 1. NaOH 2. H,0
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
2. There are several possible cyclization products that might be formed when 5-methyl-6-oxoheptanal undergoes intramolecular aldol condensation in presence of ethoxide. Draw the structures of all these possible products. Comment on which of these is likely to be the major product, clearly explaining your rationale. Answer:
1. What is the major organic product obtained from the following intramolecular aldol condensation reaction? NaOH, HẠO . 1 b. 2 . 3 d. 4 2. What is the major organic product obtained from the following intramolecular Claisen Condensation (Diepkova ) reaction? مع عمه Baraeenie Product onlained from ( 1. NaOCH2CH3 CH3CH2OH CH3CH30 OCH2CH3 2. H30+ OCH CHE OCH2CH3 مسلسلا سلال OCH2CH3 OCH2CH3
Answer clicked by accident, not necessarily correct
Which of the following molecules cannot undergo an intramolecular aldol condensation when treated with Na0H? IV O IV
3. Draw all the aldol addition products that are formed when a
mixture of acetaldehyde and pentanal is treated with aqueous sodium
hydroxide.
4. A reaction, such as described in question 3, which produces a
mixture of products is generally not useful for organic synthesis.
Suggest a change in the reaction starting materials for question 3
that would produce a single, similar product.
5. Draw a generic mechanism for aldol condensation.
6. The last step for an aldol condensation involves...
6. Give all possible structures of the product (C20H1203) formed by intramolecular Claisen condensation of the keto-ester shown below. 1. NaOH 2. H,0
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 26 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago