The cell potential of this cell is observed to be
0.445v Calculate the pH for the H+/H2 half cell
please explain the use of the half reaction in terms of the signs,
positive and negative in the equations.
Homework Answers
Add Answer to:
The cell potential of this cell is observed to be
0.445v Calculate the pH for the...
A. Calculate the cell potential that would result in the following electrochemical cell at 25oC: ...
A. Calculate the cell potential that would result in the following electrochemical cell at 25oC: Pt | UO22+(0.10M),U4+(0.22M),H+(0.60M) || Ag+(0.034M) | Ag Line notation is anode || cathode Write Nernst equations for the anode and cathode separately. Then Ecell = Ecathode - E anode B. If the electrochemical cell Ag/AgCl || Zn2+(x M) | Zn(s) develops a potential of -1.039 volts at 25oC, what is the Zn2+ concentration in the solution? (Answer in decimal format) Ag/AgCl reference electrode has E=0.199...
If the potential of a Zn-H+ cell (see below) is 0.45 V at 25 C when...
If the potential of a Zn-H+ cell (see below) is 0.45 V at 25 C when the [Zn2+] = 1.0M and PH2 = 1 atm, what is the pH of the cathode solution? Zn(s)|Zn2+(aq)|| H+(aq)|H2 (g)|Pt
Be sure to answer all parts. Calculate the standard potential of the cell consisting of the...
Be sure to answer all parts. Calculate the standard potential of the cell consisting of the Zn/Zn2+ half-cell and the SHE. What will the emf of the cell be if: [Zn2+] = 0.38 M PH = 1.0 atm [H"]=1.8 M E° cell V E = V
The voltage of the following cell at 25 ̊C is + 0.65V. The standard reduction potential...
The voltage of the following cell at 25 ̊C is + 0.65V. The standard reduction potential for Zn is -0.76 V. Zn | Zn2+ (0.60M) || H+ (aq.), H2 (g,1.0 atm) | Pt What is the pH of the solution at the cathode?
The cell potential of the following electrochemical cell depends on the pH of the solution in...
The cell potential of the following electrochemical cell depends on the pH of the solution in the anode half-cell: Pt(s)|H2(g,1atm)|H+(aq,?M)||Cu2+(aq,1.0M)|Cu(s). What is the pH of the solution if Ecell is 360 mV ?
The cell potential of the following electrochemical cell depends on the gold concentration in the cathode...
The cell potential of the following electrochemical cell depends on the gold concentration in the cathode half-cell: Pt(s)|H2(g,1atm)|H+(aq,1.0M)||Au3+(aq,?M)|Au(s). What is the concentration of Au3+ in the solution if Ecell is 1.26 V ? To what pH should you adjust a standard hydrogen electrode to get an electrode potential of -0.117 V ? (Assume that the partial pressure of hydrogen gas remains at 1 atm.) Express your answer using two decimal places.
What is the calculated value of the cell potential at 298K for an electrochemical cell with...
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Agt concentration is 8.96x10-4 M and the Zn2+ concentration is 1.05 M ? 2Ag+(aq) + Zn(s)—>2Ag(s) + Zn2+(aq) Answer: V The cell reaction as written above is spontaneous for the concentrations given: __ What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cl2 pressure is 1.94x10-4 atm,...
3. Consider the following electrochemical cell. Standard reduction potentials are given on the next page. Tl(s)...
3. Consider the following electrochemical cell. Standard reduction potentials are given on the next page. Tl(s) | Tl+(aq, 0.50 mol L−1) || H+(aq, x mol L−1) | H2(g, 1 atm) | Pt(s) The concentration of H+ is unknown and the pressure of H2 is kept constant at 1 atm. The cell voltage is initially measured as 0.139 V, with the Pt | H2 | H+ half-cell acting as the cathode. (a) (6 marks) Write out the oxidation and reduction half...
Consider a voltaic cell al 25 degree Celsius in which the reaction is: Zn (s) +...
Consider a voltaic cell al 25 degree Celsius in which the reaction is: Zn (s) + 2H+ (aq) → Zn2+ (aq) + H2(g) It is found that the voltage (think Ecell) is +0.560 V when [Zn2+1 -0.85 M and PH2 = = 0.988 atm. What is the pH in the H2-H half-cell?
(2 pts.) For the following electrochemical cell at 25°C: Zn(s) | Zn2+ (aq) || H+ (aq)...
(2 pts.) For the following electrochemical cell at 25°C: Zn(s) | Zn2+ (aq) || H+ (aq) | Pt,H2 (g) (P=1.00 atm) calculate DG° in kJ calculate Ecell for [H+] = 0.8 M and [Zn2+] = 0.5 M calculate K at 25°C
Be sure to answer all parts. Calculate the standard potential of the cell consisting of the Zn/Zn2+ half-cell and the SHE. What will the emf of the cell be if: [Zn2+] = 0.38 M PH = 1.0 atm [H"]=1.8 M E° cell V E = V
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Agt concentration is 8.96x10-4 M and the Zn2+ concentration is 1.05 M ? 2Ag+(aq) + Zn(s)—>2Ag(s) + Zn2+(aq) Answer: V The cell reaction as written above is spontaneous for the concentrations given: __ What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cl2 pressure is 1.94x10-4 atm,...
Consider a voltaic cell al 25 degree Celsius in which the reaction is: Zn (s) + 2H+ (aq) → Zn2+ (aq) + H2(g) It is found that the voltage (think Ecell) is +0.560 V when [Zn2+1 -0.85 M and PH2 = = 0.988 atm. What is the pH in the H2-H half-cell?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 46 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago