If 50.9 g of aspirin (CgHgO4) is prod ced from 9.8 g of CHgO3, what is...
Submit If 50.9 g of aspirin (C3H&Os) is produced from 79.8 g of C7HeO3, what is the percent yield from the reaction below? (s) + HC2H3O2 (aq). 0 1 23 4 5 6 9 0 7 8 x 100
Question 31 of 31 Submit If 50.9 g of aspirin (C9H8O4) is produced from 79.8 g of CzH6O3, what is the percent yield from the reaction below? CzH603 (s) + C4H603 (s) → C9H8O4 (s) + HC2H3O2 (aq).
If 62.8 g of aspirin (C,H,Oa) is produced from 79.8 g of CyH6O3, what is the percent yield from the reaction below? CyH603 (s) + C4H2O3 (s) → C9H2O2 (s) + HC2H302 (aq).
If 50.4 g of aspirin (C,H,O,) is produced from 79.8 g of C H2O3, what is the percent yield from the reaction below? CyH603 (s) + C4H603 (s) → C,H204 (s) + HC2H2O2 (aq).
10. Aspirin (CoH&O4) is produced by the reaction of salicylic acid (C7H6O3) and acetic anhydride (C4H6O3) according to the following reaction CHO3(s)CaHoO3(1)C9H8O4(s)+ CHSCO2H(aq) If 100.0 g of each of the reactants are combined, what is the maximum mass of aspirin that can be obtained? 11. Bismuth selenide, Bi2Se3, is used in semiconductor research. It can be produced directly from its elements. If 15.2 g bismuth and 12.8 g selenium are used to produce 19.5 g of bismuth selenide, what is...
4.3 Percent Yield 5. Aspirin is produced by the reaction of salicylic acid (AM=138.1 g/mol) and acetic anhydride (M-102.1 g/mol). CH O(E) CoHO(s) +C2HO2(e) C H&O3(s) If 5.00 g of CsHO (M 180.2 g/mol) is produced from the reaction of 5.00 g CaHeO, and 6.00 g CaH&O, what is the percent yield? a) 11.6% 68.8% c) 59.9% b) 29.0% e) 76.68% 4.6 Chemical Equations and Chemical Analysis 6. A mixture of MnSOs and MnSO4 4H2O has a mass of 2.005...
Naphthalene, a hydrocarbon, has an approximate molar mass of 128 g/mole. If the combustion of 64 produces 0.3599 g H20 and 2.1977 g CO2, what is the molecular formula of this compound? 3. A mass of 0.4113 g of an unknown acid, HA, is titrated with NaOH. If the acid reacts with 28.10 mL of 0.1055 M NaOH(aq), what is the molar mass of the acid? 4. The amount of calcium in a 15.0-g sample was determined by converting the...
Chemistry 172 pre-lab questions 1. ch aspirin was made from a lab experiment. Preparation of Aspirin A student would like to determine how much aspirin was made from The following is the lab data: Mass of flask 73.86 g Mass of flask & salicylic acid 77.88 g Mass of salicylic acid 4.02 g Mass of watch glass + filter paper 34.63 Mass of watch glass, filter paper & aspirin 38.29 g a. How much aspirin was made? b. The mass...
11 If 50.0 g of H2 and 130.0 g of O2 react, how many moles of H2O can be produced in the reaction below? 2 H2(g) + O2(g) → 2 H2O(g) Attempts remaining: 2 12 If 41.1 g of NO and 26.9 g of Oz react together, how many grams of NO2 can be formed via the reaction below? 2 NO (g) + O2(g) → 2 NO2 (g) Attempts remaining: 2 13 - You have 2.2 mol Xe and 1.9...
QUESTION 1 Consider the following reaction: 4FeCr2O4(s) + 8K2CO3(aq) + 7020) 2Fe2O3(s) + 8K2CrO4(aq) + CO2(g) . 4.0 g of FeCr204 and 6.0 g of K2CO3 were reacted in excess O2. What was the limiting reagent? CO2 o K2CO4 0 02 K2CO3 FeCr204 Fe2O3 QUESTION 2 Consider the following reaction: 4FeCr2O4(s) + 8K2CO3(aq) + 702(g) — 2Fe2O3(s) + 8K2Cro4(aq) + CO2(g) 3.8 g of FeCr204 and 2.8 g of K2CO3 were reacted in excess O2 What was the theoretical yield...