Solution:
Percentage yield of aspirin has found to be 48.42%
Hope, it helps. :)
If 50.4 g of aspirin (C,H,O,) is produced from 79.8 g of C H2O3, what is...
If 62.8 g of aspirin (C,H,Oa) is produced from 79.8 g of CyH6O3, what is the percent yield from the reaction below? CyH603 (s) + C4H2O3 (s) → C9H2O2 (s) + HC2H302 (aq).
Question 31 of 31 Submit If 50.9 g of aspirin (C9H8O4) is produced from 79.8 g of CzH6O3, what is the percent yield from the reaction below? CzH603 (s) + C4H603 (s) → C9H8O4 (s) + HC2H3O2 (aq).
Submit If 50.9 g of aspirin (C3H&Os) is produced from 79.8 g of C7HeO3, what is the percent yield from the reaction below? (s) + HC2H3O2 (aq). 0 1 23 4 5 6 9 0 7 8 x 100
4. Aspirin (C,H,O,) is produced via reaction of salicylic acid (CyH603) with acetic anhydride (C H603), according to the following chemical equation: CyH603() + C4H603(1)→ CH904() + HC2H302(aq) If you wanted to prepare 500.6 g of aspirin, how many grams of salicylic acid would you need to react?
11 If 50.0 g of H2 and 130.0 g of O2 react, how many moles of H2O can be produced in the reaction below? 2 H2(g) + O2(g) → 2 H2O(g) Attempts remaining: 2 12 If 41.1 g of NO and 26.9 g of Oz react together, how many grams of NO2 can be formed via the reaction below? 2 NO (g) + O2(g) → 2 NO2 (g) Attempts remaining: 2 13 - You have 2.2 mol Xe and 1.9...
If 50.9 g of aspirin (CgHgO4) is prod ced from 9.8 g of CHgO3, what is the percent yield from the reaction below? C7H&O3 (s) + CaH6O3 (s) CoH,0& (s) + HC2H,02 (aq)
4.3 Percent Yield 5. Aspirin is produced by the reaction of salicylic acid (AM=138.1 g/mol) and acetic anhydride (M-102.1 g/mol). CH O(E) CoHO(s) +C2HO2(e) C H&O3(s) If 5.00 g of CsHO (M 180.2 g/mol) is produced from the reaction of 5.00 g CaHeO, and 6.00 g CaH&O, what is the percent yield? a) 11.6% 68.8% c) 59.9% b) 29.0% e) 76.68% 4.6 Chemical Equations and Chemical Analysis 6. A mixture of MnSOs and MnSO4 4H2O has a mass of 2.005...
10) A student prepares aspirin (acetylsalicylic acid, C,H,0.) by reacting salicylic acid (C,H,O,) with acetic anhydride (C.H.O.). The balanced equation for the reaction is: 2 C,H,O, + C,H,O, + 2 C,H,O, + H,O The lab calls for 3.00 g of salicylic acid to be mixed with 6.40 g of acetic anhydride. What is the limiting reagent and what is the maximum amount of aspirin which can be prepared if the yield for the reaction is 91%?
10. Aspirin (CoH&O4) is produced by the reaction of salicylic acid (C7H6O3) and acetic anhydride (C4H6O3) according to the following reaction CHO3(s)CaHoO3(1)C9H8O4(s)+ CHSCO2H(aq) If 100.0 g of each of the reactants are combined, what is the maximum mass of aspirin that can be obtained? 11. Bismuth selenide, Bi2Se3, is used in semiconductor research. It can be produced directly from its elements. If 15.2 g bismuth and 12.8 g selenium are used to produce 19.5 g of bismuth selenide, what is...
11. Sulfur hexafluoride is produced by reacting elemental sulfur with fluorine gas. Sg(s) + 24 F2(g) - 8 SF6(E) What is the percent vield im 18.3 SF is isolated from the reaction of 10.0 Ss and 300 12 a. 40.2% b. 45.89 c. 47.6% d. 54.656 e. 61.0% 12. The reaction of 5.07 g N with 0.722 g H produces 1.27NH. The percent vield of this reaction is indicate the answer choice that best completes the statement or answers the...