ddiscuss the protocols for disposal of the following biological chemical materials iodine,bleach blood agar and expired...
ddiscuss the protocols for disposal of the following biological
chemical materials iodine,bleach blood agar and expired
reagent?
Homework Answers
1) Protocol for disposal of iodine
* Use a HEPA filter vaccum for clean up and
place into sealed containers for didposal.
*Do not wash into sewer, Iodine may hazardous to environment especially for fish.
2) Protocol for disposal of bleach blood agar.
* disposal of unused plain agar in plastic plates directly in to a trach can.
*Blood agar with any chemicals like bleach should be disposed after sterilization.
*Scrape unused agar out of glass petri dishes and throw it away.
3)Disposal of expired reagent
*Empty chemical bottles and expired chemicals in their original containers are accepted.
* Do not combain one chemical bottiles to other
*Liquid and solid chemicals should dispose in running water and is in a water sink.
*Hazardous types to be packed in a bag and it is to be handled over to ETP for further action.
Add Answer to:
ddiscuss the protocols for disposal of the following biological
chemical materials iodine,bleach blood agar and expired...
entity the following safety signs, symbols, labels, and a common location within the medical laborate these...
entity the following safety signs, symbols, labels, and a common location within the medical laborate these signs. (XII.C.1a, XII.C.1b; XII.C.1c) (XII.C.1b) (XIL.C.1b) (XII.C. 1b) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) 11-29-2015 2. Describe the purpose of a Safety Data Sheet in the healthcare setting including an e be found in a medical laboratory (ex. Peroxide, Alcohol, etc.). Note: a copy of a SD printed from the manufactures site. (XII.C.5) 3. Discuss the protocols for disposal of the following biological chemical...
MOA110 Medical Office Procedures Emergency Practices Worksheet 4. Discuss protocols for disposal of biological materials. 5....
MOA110 Medical Office Procedures Emergency Practices Worksheet 4. Discuss protocols for disposal of biological materials. 5. Identify critical elements of an emergency plan for response to a natural disaster or other emergency
MAS110 Clinical Procedures and Techniques Infection Control Worksheet (LRC Project) Identify safety techniques that can be...
MAS110 Clinical Procedures and Techniques Infection Control Worksheet (LRC Project) Identify safety techniques that can be used in responding to accidental exposure to each of the following: blood, other body fluids, needle sticks, and chemicals. 9. 10. Discuss the protocols for disposal of biological chemical materials.
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood,...
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood, b. other body fluids, c. needle sticks, d. chemicals. (XII,C.2) A. blood: B. other body fluids C. needle sticks: D. chemicals: 7. Discuss fire safety issues in an ambulatory healthcare environment. (XII.C.3) Describe fundamental principles for evacuation of a healthcare setting. (XII.C.4) 8. Describe the purpose of Safety Data Sheets (SDS) in a healthcare setting. (XII.C.5) 9. 10. Discuss protocols for disposal of biological...
All biomedical instruments must interface with biological materials (by definition). The interface can by direct contact...
All biomedical instruments must interface with biological materials (by definition). The interface can by direct contact or by indirect contact. Systems: complete system response using specific examples (electromyogram, pressure sensors and blood pressure measurements, flow sensors and blood flow measurements, and chemical biosensors) can you tell me biomedical instruments of examples of computation and systems? and reasons why
pver the questions first. Go over exercises 5-21. Answer the following questions 1. Is Blood agar...
pver the questions first. Go over exercises 5-21. Answer the following questions 1. Is Blood agar a selective media, differential media, and/or an enriched media? Hint: it is more than one of these, but it is not all three. Please explain your answer. 2. Define hemolysins. 3. List the three major types of hemolysis and briefly describe each.
Consider the following chemical equation for the reaction of iodine and chlorine. I2(g)+Cl2(g)⇌2ICl(g) How will the...
Consider the following chemical equation for the reaction of iodine and chlorine. I2(g)+Cl2(g)⇌2ICl(g) How will the position of the equilibrium change if the volume of the vessel in which the reaction is contained increases?
The correct definition for the following twenty (20) health and safety terms: Accident Biological Agent Chemical...
The correct definition for the following twenty (20) health and safety terms: Accident Biological Agent Chemical Agent Controls Environment Frequency Rate Hazardous Material Hygiene Practices Ingestion Inhalation Localized Mutagen Occupational Health Occupational Safety Personal Protective Equipment Physical Agent Reducing Agent Risk Systemic Volatility
In which of the following applications are microorganisms frequently used? Production of proteins Production of biological chemicals Production of inorganic materials Production of genetically engi...
In which of the following applications are microorganisms frequently used? Production of proteins Production of biological chemicals Production of inorganic materials Production of genetically engineered plants Production of genetically engineered animals
Consider the following aqueous chemical reaction involving iodine (12), iodide (") and tri-iodidell3'); 12(aq) + l'(aq)...
Consider the following aqueous chemical reaction involving iodine (12), iodide (") and tri-iodidell3'); 12(aq) + l'(aq) → l'(aq) Kc = 0.1 To aboL beaker of pure water you add exactly 0.2 moles of both 12 and I (i.e. initial concentrations of 12 and I are both 0.2 M, and the initial concentration of \g* = 0.0 M). Utilize the ICE table method to calculate the concentration of lz once the system has established equilibrium 2.8x102 M 0.1M 2.0 M O...
entity the following safety signs, symbols, labels, and a common location within the medical laborate these signs. (XII.C.1a, XII.C.1b; XII.C.1c) (XII.C.1b) (XIL.C.1b) (XII.C. 1b) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) (XII.C.1a) 11-29-2015 2. Describe the purpose of a Safety Data Sheet in the healthcare setting including an e be found in a medical laboratory (ex. Peroxide, Alcohol, etc.). Note: a copy of a SD printed from the manufactures site. (XII.C.5) 3. Discuss the protocols for disposal of the following biological chemical...
MOA110 Medical Office Procedures Emergency Practices Worksheet 4. Discuss protocols for disposal of biological materials. 5. Identify critical elements of an emergency plan for response to a natural disaster or other emergency
MAS110 Clinical Procedures and Techniques Infection Control Worksheet (LRC Project) Identify safety techniques that can be used in responding to accidental exposure to each of the following: blood, other body fluids, needle sticks, and chemicals. 9. 10. Discuss the protocols for disposal of biological chemical materials.
6. Identify safety techniques that can be used in responding to accidental exposure to: a. blood, b. other body fluids, c. needle sticks, d. chemicals. (XII,C.2) A. blood: B. other body fluids C. needle sticks: D. chemicals: 7. Discuss fire safety issues in an ambulatory healthcare environment. (XII.C.3) Describe fundamental principles for evacuation of a healthcare setting. (XII.C.4) 8. Describe the purpose of Safety Data Sheets (SDS) in a healthcare setting. (XII.C.5) 9. 10. Discuss protocols for disposal of biological...
pver the questions first. Go over exercises 5-21. Answer the following questions 1. Is Blood agar a selective media, differential media, and/or an enriched media? Hint: it is more than one of these, but it is not all three. Please explain your answer. 2. Define hemolysins. 3. List the three major types of hemolysis and briefly describe each.
Consider the following aqueous chemical reaction involving iodine (12), iodide (") and tri-iodidell3'); 12(aq) + l'(aq) → l'(aq) Kc = 0.1 To aboL beaker of pure water you add exactly 0.2 moles of both 12 and I (i.e. initial concentrations of 12 and I are both 0.2 M, and the initial concentration of \g* = 0.0 M). Utilize the ICE table method to calculate the concentration of lz once the system has established equilibrium 2.8x102 M 0.1M 2.0 M O...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 48 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago