Explain how IE gene transcription is initiated in epithelial cells
Explain how IE gene transcription is initiated in epithelial cells
Homework Answers
IE gene activated transiently and rapid in response of cellular stimuli
That is activated at the transcription level in first round of response stimuli before new proteins are synthesized
IE gene are distinct from late response gene which can be activated later following response gene production thus IE gene called gateway to genomic response
Its a viral regulatory protine that synthesized viral infection or cellular protine made immediately...
In eukaryotic cells, there are specific transcription factors (activators) that regulate gene expression. Describe the organization...
In eukaryotic cells, there are specific transcription factors (activators) that regulate gene expression. Describe the organization of eukaryotic genes (i.e. promoters/enhancers) and how transcription factors are able to control gene expression and enzyme activity. a) Throughout the course we discussed the enzyme lactase and how it is differently regulated (and therefore expressed) in different human populations. Describe how this gene is differently expressed in different populations and when this/these change(s) are predicted to have taken place. b) Differential gene expression...
1) You have transfected siRNA against transcription factor A into cells that normally express the transcription...
1) You have transfected siRNA against transcription factor A into cells that normally express the transcription factor. These cells also contain a luciferase reporter gene that is controlled an enhancer that has multiple binding sites for transcription factor A. a. What would be the effect on reporter gene activity b. How could you determine whether RNAi acts at the level of mRNA or translation in this case?
3) Gene Control in Bacteria - Transcription Activators and Repressors You are interested in examining the...
3) Gene Control in Bacteria - Transcription Activators and Repressors You are interested in examining the regulation of the gene that encodes an enzyme, Tre- ase, important in metabolizing trehalose into glucose in bacteria. Trehalose is a disaccharide formed of two glucose units. It is known that two DNA-binding proteins, TreA and TreB, are important for binding to the promoter of the Tre-ase gene and are involved in regulating the transcription of the Tre-ase gene: TreA binds to the "A"...
. Label each tissue in the photos. a. cuboidal epithelial cells b. pseudostratified columnar epithelial cells...
. Label each tissue in the photos. a. cuboidal epithelial cells b. pseudostratified columnar epithelial cells c. goblet cells d. adipose tissue e. simple squamous epithelial cells f. cartilage g. dense irregular connective tissue LAB5 Histology 57
During the course of development many cells can undergo epithelial to mesenchymal transitions and vice versa....
During the course of development many cells can undergo epithelial to mesenchymal transitions and vice versa. When this happens the adhesion of cells to each other and their connections to the extracellular matrix changes. This leads to changes in the transcription of many genes. Give one example of how a change in cell adhesion or connection to the extracellular matrix might cause transcriptional changes through signaling pathways.
How do transcription factors affect gene expression? a.) They are molecules that can turn genes on...
How do transcription factors affect gene expression? a.) They are molecules that can turn genes on or off. b.) They are mRNAs that contain extra information that is not part of the DNA genome. c.)They modify the chromosome structure to create mutations. d.) They are signals that tell cells whether to divide or not.
Explain the histology of the thyroid gland, how thyroid hormone is synthesized in the epithelial cells...
Explain the histology of the thyroid gland, how thyroid hormone is synthesized in the epithelial cells of the follicle, such as the iodine trap, the hypothalamus-adenohypohysis-thyroid gland axis and negative feedback regulation, the regulation using iodine, the intracellular signaling pathways within the adenohypophysis and the thyroid gland, autoregulation of thyroid hormone production, factors regulating thyroid hormone levels, actions of thyroid hormones, mechanism of action of thyroid hormone (TRE-receptor interaction, coactivators, corepressors), major genes whose expression is changed (e.g., Na+/K+-ATPase), the...
Describe the process of how your cells make a protein from a gene. Just a hint,...
Describe the process of how your cells make a protein from a gene. Just a hint, you should only describe two of the following three processes: replication, transcription, translation.
Describe how the Trp operon functions in prokaryotic gene transcription.
Describe how the Trp operon functions in prokaryotic gene transcription.
6. How is transcription initiated and terminated? What is the importance of the promoter consensus sequence?...
6. How is transcription initiated and terminated? What is the importance of the promoter consensus sequence? 7. How are mRNAs modified in eukaryotes? What types of elements are sometimes present in RNA's but 8. What is the genetic code? What are the properties of the triplet codons? What does it mean that the code is How and why do consensus sequences differ from one another? usually not in DNA's? redundant and what useful purpose does such redundancy serve?
3) Gene Control in Bacteria - Transcription Activators and Repressors You are interested in examining the regulation of the gene that encodes an enzyme, Tre- ase, important in metabolizing trehalose into glucose in bacteria. Trehalose is a disaccharide formed of two glucose units. It is known that two DNA-binding proteins, TreA and TreB, are important for binding to the promoter of the Tre-ase gene and are involved in regulating the transcription of the Tre-ase gene: TreA binds to the "A"...
. Label each tissue in the photos. a. cuboidal epithelial cells b. pseudostratified columnar epithelial cells c. goblet cells d. adipose tissue e. simple squamous epithelial cells f. cartilage g. dense irregular connective tissue LAB5 Histology 57
6. How is transcription initiated and terminated? What is the importance of the promoter consensus sequence? 7. How are mRNAs modified in eukaryotes? What types of elements are sometimes present in RNA's but 8. What is the genetic code? What are the properties of the triplet codons? What does it mean that the code is How and why do consensus sequences differ from one another? usually not in DNA's? redundant and what useful purpose does such redundancy serve?
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 58 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago