Homework Answers
Add Answer to:
complete the following reactions, if no reaction occurs, write
NR
2. Complete the following reactions. If...
2. Complete and balance the following net ionic equations. If no reaction occurs, write NR. Tables...
2. Complete and balance the following net ionic equations. If no reaction occurs, write NR. Tables 4 and 5 of Experiment 7 list amphoteric metal hydroxides that form complex ions in the presence of excess hydroxide ions and aqueous ammonia. a. Mg(OH)2 + OH excess b. Cu(OH)2 + OH"excess c. Co(OH)2 + OH → d. Fe(OH)3 + NH3(aq) excess → e. Pb(OH)2 + NH3(aq) excess →
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistr...
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
Predict the product(s) for the following reactions. If no significant reaction occurs, then write "NR." If...
Predict the product(s) for the following reactions. If no significant reaction occurs, then write "NR." If you write "NR" make sure to provide an explanation. 1) (CH2=CH) CALI 2) H20 pyridine CH,C1, H.07
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR...
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR after the reaction arrow. 3KOH(aq)+AlCl3(aq)--> Al(OH)3+3KCl
Predict the product(s) and reagent(s) or if there is no reaction write NR. OH K2Cr207 (excess)...
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR...
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR after the reaction arrow. Zn(CIO )2(aq)+ Na2S(aq)-
11. For the following reactions, use the Activity Series of Metals to determine if a reaction will occur and if so, what the products will be. If no reaction will occur, write NR for the product....
11. For the following reactions, use the Activity Series of Metals to determine if a reaction will occur and if so, what the products will be. If no reaction will occur, write NR for the product. Ca (s) + Cd(NO:)2 (aq) - Mg (s) + HNOs (aq) Complete, balance, and identify the reaction type for each of the following equations Type 13. Zn (s)+ Cu(NO,)2 (aq) 14 Ba(NO) (aq)MgSO: (aq) 15. H2SO (aq)+NaOH (aq) > 16. Cu(OH): (s)+HCIO (aq) 17....
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR...
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR after the reaction arrow. LiCl(aq) + K3PO4(aq) → 30,2- Reset 1 2 3 4 5 6 7 8 9 0 (s) (1) (g) (aq) NR OKLICP • x H₂O
Part A Complete the following reaction by filling in the necessary reagents. OH он о 1....
Part A Complete the following reaction by filling in the necessary reagents. OH он о 1. CO2, NaOH 2. HCI 1. CH2OH 2. HCI 1. KMnO4, HO 2. HCI 1. CH3COCI, AICI, 2. Zn(Hg), HCI
1. Give a sequence of reactions to accomplish the following transformation? Show mechanism 2. What reagent(s)...
1. Give a sequence of reactions to accomplish the following transformation? Show mechanism 2. What reagent(s) would accomplish the following? Show mechanism. R-CH2-NH2 R-C-NH2 3. What would result from the reactions shown below? Hsco-s-OCH3 large excess) NaOH нон H,0 но ОН "ОН (a and B) 4. Predict the major product of the following reaction. CHNNH 3 equivalents) но CHCH2OH Heat он CH2OH Draw the Haworth projection for chair conformation of a-D-Glucopyranose (shown below) CH2OH HO H OH OH
2. Complete and balance the following net ionic equations. If no reaction occurs, write NR. Tables 4 and 5 of Experiment 7 list amphoteric metal hydroxides that form complex ions in the presence of excess hydroxide ions and aqueous ammonia. a. Mg(OH)2 + OH excess b. Cu(OH)2 + OH"excess c. Co(OH)2 + OH → d. Fe(OH)3 + NH3(aq) excess → e. Pb(OH)2 + NH3(aq) excess →
1. Give the major product of the following reactions, write NR. if no reaction happens. Indicate the stereochemistry if necessary CHCI KOC(CH3). (CH),COH 1. conc. HBr, heat 2. KOBU, HOBU 1. NaOM, MOH CI 2. BICN 1. 1 eq. BH3. THE 2. H2O2, NaOH, H2O 3. Hg(OAC), MeOH 4. NaBH4, NaOH, H2O 1. conc. HCI 2. LDA, THF 3. O. CH,OH 4.(CH), 1. Hg(OAC), THE 2. NaBH, NaOH, H2O > OH (Hint: product has a bicyclic ring)
Predict the product(s) for the following reactions. If no significant reaction occurs, then write "NR." If you write "NR" make sure to provide an explanation. 1) (CH2=CH) CALI 2) H20 pyridine CH,C1, H.07
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR after the reaction arrow. Zn(CIO )2(aq)+ Na2S(aq)-
11. For the following reactions, use the Activity Series of Metals to determine if a reaction will occur and if so, what the products will be. If no reaction will occur, write NR for the product. Ca (s) + Cd(NO:)2 (aq) - Mg (s) + HNOs (aq) Complete, balance, and identify the reaction type for each of the following equations Type 13. Zn (s)+ Cu(NO,)2 (aq) 14 Ba(NO) (aq)MgSO: (aq) 15. H2SO (aq)+NaOH (aq) > 16. Cu(OH): (s)+HCIO (aq) 17....
Complete the balanced molecular chemical equation for the reaction below. If no reaction occurs, write NR after the reaction arrow. LiCl(aq) + K3PO4(aq) → 30,2- Reset 1 2 3 4 5 6 7 8 9 0 (s) (1) (g) (aq) NR OKLICP • x H₂O
Part A Complete the following reaction by filling in the necessary reagents. OH он о 1. CO2, NaOH 2. HCI 1. CH2OH 2. HCI 1. KMnO4, HO 2. HCI 1. CH3COCI, AICI, 2. Zn(Hg), HCI
1. Give a sequence of reactions to accomplish the following transformation? Show mechanism 2. What reagent(s) would accomplish the following? Show mechanism. R-CH2-NH2 R-C-NH2 3. What would result from the reactions shown below? Hsco-s-OCH3 large excess) NaOH нон H,0 но ОН "ОН (a and B) 4. Predict the major product of the following reaction. CHNNH 3 equivalents) но CHCH2OH Heat он CH2OH Draw the Haworth projection for chair conformation of a-D-Glucopyranose (shown below) CH2OH HO H OH OH
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 56 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago