Homework Answers
Please see the image.
Add Answer to:
Predict the product(s) for the following reactions. If no significant reaction occurs, then write "NR." If...
POST-LAB QUESTIONS: 1. Predict the product of the following reactions. If no reaction occurs write "NR"...
POST-LAB QUESTIONS: 1. Predict the product of the following reactions. If no reaction occurs write "NR" CHs CHy CH CHs CH ning 2. Which test(s) would you use to distinguish between acetophenone and 3-pentanone? Explain why to receive credit. 3. Which test(s) would you use to distinguish between benzaldehyde and propanal? Explain why to receive credit. V_02 7
1. (6 pts.) Predict the products for the following reactions. If no reaction occurs, write “NR”....
1. (6 pts.) Predict the products for the following reactions. If no reaction occurs, write “NR”. Indicate proper stereochemistry where appropriate. If more than one product can form, indicate the major product(s). If more than one stereoisomer forms, draw each stereoisomer separately. 1) PPhz 2) n-BuLi / THE Br i 2) 420 1) LIAIHA 2) H20 HONG HO
VI. Reactions (21 pts) Provide the major product in the following reaction. If no reaction occurs,...
VI. Reactions (21 pts) Provide the major product in the following reaction. If no reaction occurs, write "NR as the product. Show your work for each step!! Pay attention to Regiochemistry and Stereochemistry! TSCI EtyN 1. CHg-Br (xs) 2. Ag20, H20, A H-CI Et20 Sold lo no? NaBH CN a. NaNg, EtOH b. H20,4 OH 1. SOCI, pyridine 2. NaN, DMF 3. LIAIH, Et20
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions...
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
Predict the product(s) and reagent(s) or if there is no reaction write NR. OH K2Cr207 (excess)...
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
Predict the product(s) and reagent(s) or if there is no reaction write NR. 1. TsCl, pyridine...
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
1. TsCl, pyridine 2. SNa NaH HBO 2 eq, 0 °C H2SO4 heat HBT heat OH 1. PBr3, ED 0 2. NaCN NaH 'OTS
VI. Reactions (21 pts) Provide the major product in the following reaction. It as the product...
VI. Reactions (21 pts) Provide the major product in the following reaction. It as the product Show your work for each stepll Pay attentio Stereochemistry! Product in the following reaction. If no reaction occurs, write" NR stepll pay attention to Regiochemistry and TSCI ElyN 1. CHy-Br (xs) 2 A0,0,H,O, A H-CI E-G NaBH,CN a. NaNs, EtOH b. H20, он 1. SOCI, pyridine 2. NaN, DMF 3. LIAIH, EL 0
14-15) Predict the product. Show each step. 16-17) Predict the product. If no reaction, write NR....
14-15) Predict the product. Show each step.
16-17) Predict the product. If no reaction, write NR.
14.) Predict the product. Show each step. of CH₂Br 2) con 7.) Mg 3.) H₂or 15.) Predict the product, Show each step 1.) Soch 2.) Li Al(O+-BuzH 16.) Predict the products. If no reaction, write NR. of ccl + CH₃OH Ht 1.) @ My Br Excess 2.) H₃O+ 7
Name DIRECTIONS: You must complete the entire 1. PREDICT THE PRODUCT Provide the structure of the...
Name DIRECTIONS: You must complete the entire 1. PREDICT THE PRODUCT Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you want for any region or stereochemistry (24 p.) 1. HOOAC) CH OH 1) BH-THF 2) H20, KOH HBF, ROOR 1. BH-THF 2.HONOM H20, H2SO4 1. NaNH, H-CEC-CH2-CH2-CHE 2. CH,CHBr Lindlar cat 1. Sia BH-THF 2. H2O2, H20
complete the following reactions, if no reaction occurs, write NR 2. Complete the following reactions. If...
complete the following reactions, if no reaction occurs, write
NR
2. Complete the following reactions. If no reaction occurs, write NR. OH a. CH2CH2CH2-C-CH3 + ZnCl, HCI CH2OH + chromic acid reagent C. CH3CH2CH2OH + Ha, ОН d. CH3CH2-C-CH3 + 12 - NaOH CH3
POST-LAB QUESTIONS: 1. Predict the product of the following reactions. If no reaction occurs write "NR" CHs CHy CH CHs CH ning 2. Which test(s) would you use to distinguish between acetophenone and 3-pentanone? Explain why to receive credit. 3. Which test(s) would you use to distinguish between benzaldehyde and propanal? Explain why to receive credit. V_02 7
1. (6 pts.) Predict the products for the following reactions. If no reaction occurs, write “NR”. Indicate proper stereochemistry where appropriate. If more than one product can form, indicate the major product(s). If more than one stereoisomer forms, draw each stereoisomer separately. 1) PPhz 2) n-BuLi / THE Br i 2) 420 1) LIAIHA 2) H20 HONG HO
VI. Reactions (21 pts) Provide the major product in the following reaction. If no reaction occurs, write "NR as the product. Show your work for each step!! Pay attention to Regiochemistry and Stereochemistry! TSCI EtyN 1. CHg-Br (xs) 2. Ag20, H20, A H-CI Et20 Sold lo no? NaBH CN a. NaNg, EtOH b. H20,4 OH 1. SOCI, pyridine 2. NaN, DMF 3. LIAIH, Et20
1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) H2O 1. Hg(OAC), CH, OH 2. NaBH H2SO4 H20 1) BH-THF 2) H202, KOH HBr Bry, H2O HBr ROOR 1. BH3-THF 2. H2O2, NaOH H20, H2SO4 1. NaNH2 H2 H-CEC-CH2 CH2 CH3 2. CH CH Br Lindlar cat 1. Sia BH-THF 2. H2O2, H2O
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
OH K2Cr207 (excess) H2SO4, H20 "ОН 1. PhLi, Et20 2. HCI, HO 3. SOCl2, Et3N 4. NaOAC 1. Mg (1 eq), Et20 < Br 2. (1 eq) CHO 3. HCI, H2O MsCI LDA ОН pyridine 1. Nah 2. Br
Predict the product(s) and reagent(s) or if there is no reaction
write NR.
1. TsCl, pyridine 2. SNa NaH HBO 2 eq, 0 °C H2SO4 heat HBT heat OH 1. PBr3, ED 0 2. NaCN NaH 'OTS
VI. Reactions (21 pts) Provide the major product in the following reaction. It as the product Show your work for each stepll Pay attentio Stereochemistry! Product in the following reaction. If no reaction occurs, write" NR stepll pay attention to Regiochemistry and TSCI ElyN 1. CHy-Br (xs) 2 A0,0,H,O, A H-CI E-G NaBH,CN a. NaNs, EtOH b. H20, он 1. SOCI, pyridine 2. NaN, DMF 3. LIAIH, EL 0
14-15) Predict the product. Show each step.
16-17) Predict the product. If no reaction, write NR.
14.) Predict the product. Show each step. of CH₂Br 2) con 7.) Mg 3.) H₂or 15.) Predict the product, Show each step 1.) Soch 2.) Li Al(O+-BuzH 16.) Predict the products. If no reaction, write NR. of ccl + CH₃OH Ht 1.) @ My Br Excess 2.) H₃O+ 7
Name DIRECTIONS: You must complete the entire 1. PREDICT THE PRODUCT Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you want for any region or stereochemistry (24 p.) 1. HOOAC) CH OH 1) BH-THF 2) H20, KOH HBF, ROOR 1. BH-THF 2.HONOM H20, H2SO4 1. NaNH, H-CEC-CH2-CH2-CHE 2. CH,CHBr Lindlar cat 1. Sia BH-THF 2. H2O2, H20
complete the following reactions, if no reaction occurs, write
NR
2. Complete the following reactions. If no reaction occurs, write NR. OH a. CH2CH2CH2-C-CH3 + ZnCl, HCI CH2OH + chromic acid reagent C. CH3CH2CH2OH + Ha, ОН d. CH3CH2-C-CH3 + 12 - NaOH CH3
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago