Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
1. Chlorine dioxide, CIO2, is commonly used to disinfect drinking water. It is a mild oxidant,...
8) Chlorine dioxide is a disinfectant used in municipal water-treatment plants. It dissolves in basic solution,...
8) Chlorine dioxide is a disinfectant used in municipal water-treatment plants. It dissolves in basic solution, producing chlorate and chlorite: 2 Clo, (e)+2 OH" (aq) → Clo, (aq) + Clo," (aq) + H20 (U) Experiment Cholo [OH-lo (M) 0.030 Initial Rate (Ms) 0.0248 0.060 0.020 0.030 0.00827 0.0247 0.020 0.090 a) The actual molecule being measured for these experiments (for initial rate) was OH(aq), since it's easy to measure pH. For experiment 1, at what rate would clo, (aq) be...
Question Completion Status: Consider this chemical reaction at 25 °C: ClO2(aq) + 2OH(aq) + C1O3(aq) +...
Question Completion Status: Consider this chemical reaction at 25 °C: ClO2(aq) + 2OH(aq) + C1O3(aq) + CO2(aq) The following experimental data were collected (M=mol/L): Experiment Initial [CIO2] (M) Initial [OH^](M) 0.060 0.030 2 0.020 0.030 3 0.020 0.090 Initial rate (M/s) 0.0248 0.00276 0.00828 Determine the rate law. Suggested time: 6 min rate = k[CIO2][OH-]2 none of these rate = k[CIO2](OH) 1 rate = K[C1021?[OH-]2 rate - k[CI0212[OH-] rate = k[Clo21°OH)
2 CIO2 (aq) + 2 OH- (aq) - CIO3- (aq) + CO2- (aq) + H20 (1)...
2 CIO2 (aq) + 2 OH- (aq) - CIO3- (aq) + CO2- (aq) + H20 (1) Experiment Number Initial Rate (CIO2(M) [OH-] (M) (M/s) 0.060 0.030 0.0248 0.020 0.030 0.00276 0.020 0 .090 0.00828 3 1) What is the magnitude of the rate constant for the reaction? A) 1.15 x 104 B) 115 C) 4.6 D) 713 E) 230 2) Which reaction produces a decrease in the entropy of the system? A) 2C(s) + O2 (g) - 200 (8) B)...
3. Experiments are done to study the reaction between aqueous chlorine dioxide and hydroxide ions: 2...
3. Experiments are done to study the reaction between aqueous chlorine dioxide and hydroxide ions: 2 CIO2 (aq) + 2 OH- (aq) → C103- (aq) + ClO2- (aq) + H20 (1) Exp. # Temp (°C) [CIO2), M [ОНН, М Initial rate, M/s 125 0.015 0.050 0.0026 25 0.045 0.050 0.0234 0.060 0.080 0.0665 4 35 0.060 0.040 0.1022 25 d) If this reaction is occurring in a 1.00-liter solution in a large beaker, predict how each of the following would...
28 its Data representing initial concentrations and initial rates for the following reaction are given below....
28 its Data representing initial concentrations and initial rates for the following reaction are given below. Choose the correct rate expression. 20102(aq) + 2OH"(aq) + CIO, (aq) + CO2 (aq) + H2O(1) Exp. No. 1 [CIO2lo (M) 0.060 0.020 0.020 [OH-]o (M) 0.030 0.030 0.090 2 3 Initial Rate (Ms) 0.0248 0.00276 0.00828 rate = k (CIO) (OH)2 ratek (CIO) (OH) rate = k (CIO) [OH-] rate = k [CIO] (OH) ratek (CIO) [OH- Previous ОО Near
Chlorine dioxide (ClO_2) is a disinfectant used in municipal water treatment plants. It dissolves in basic...
Chlorine dioxide (ClO_2) is a disinfectant used in municipal water treatment plants. It dissolves in basic solution, producing ClO_3^- and ClO_2: 2ClO_2 (g) + 2OH^-(aq) rightarrow ClO_3^-(aq) + ClO_2^- (aq) + H_2O(l) The following kinetic data were obtained at 350 K for the reaction: Choose the correct rate law for the reaction Choose one: Rate = k[ClO_2] Rate = k[ClO_2][OH^-]^2 Rate = k[ClO_2]^2[OH^-] Rate = k[ClO_2][OH^-] Determine the rate constant for the reaction at 350.0 K M^-1 s^-1
Please help me answer all questions. I will give a thumbs up if all questions are...
Please help me answer all questions. I will give a thumbs up if all
questions are answered.
This is a multiple-choice test consisting of 35 questions. Each correct answer is worth three points for a total of 105 points. Mark all answers on your 882-scantron form. the scantron will be graded 1. Given the initial rate data for the reaction A + B C, determine the rate equation for the reaction. 0.020 0.020 0.060 0.030 0.060 0.030 0.010 0.040 0.090...
Useful Information: Please show your work and write in complete sentences. R= 8.314 J/mol K 1/[A].=...
Useful Information: Please show your work and write in complete sentences. R= 8.314 J/mol K 1/[A].= kt +1/[A]. In k=-E/RT+ In A In [A] =-kt + In[A]. In kı/k2 = E/R (1/T2 - 1/11) 1. The following data were collected for the reaction: 2 C102(aq) + 2 OH (g) → C103 (aq) + ClO2 (aq) + H2O(1) Experiment [C102], M [OH-], M Initial Rate, M/s 1 0.060 0.030 0.0248 2 0 .020 0.030 0.00276 0.020 0 .090 0.00828 a. Determine...
9. Linked Question "Groot" [1]: What is the order of the reaction with respect to ClO2...
9. Linked Question "Groot" [1]: What is the order of the reaction with respect to ClO2 Experiment Number (CIO2) (M) 0.060 0.020 0.020 (OH-] (M) 0.030 0.030 0.090 Initial Rate (M5-) 0.0248 0.00276 0.00828 ②3 B. 2 c.1 D.4 E. O 10. Linked Question "Groot" (2] : What is the order of the reaction with respect to OH (described in Linked Question "Groot" [1])? A. 2 B. 1 C. 3 D. 4 E.O 11. Linked Question "Groot" (3): What is...
Chlorine dioxide reacts in basic water to form chlorite and chlorate acfording to the following chemical...
Chlorine dioxide reacts in basic water to form chlorite and chlorate acfording to the following chemical equation 2C102(aq) + 2OH(aq) + CO2(aq) + C103"(aq) H2O(1) A kinetic study of this reaction under a certain set of conditions yielded the data below Exp |CIO 2 (M) TOH) (M) Initial rate (W) 11 0.0500 0.100 5.75 X 10-2 2 0.100 0.100 2.30 x 10-1 3 0.100 0.0500 1.15 x 10-1 (a) While the rate law for this reaction (b) Calculate the rate...
8) Chlorine dioxide is a disinfectant used in municipal water-treatment plants. It dissolves in basic solution, producing chlorate and chlorite: 2 Clo, (e)+2 OH" (aq) → Clo, (aq) + Clo," (aq) + H20 (U) Experiment Cholo [OH-lo (M) 0.030 Initial Rate (Ms) 0.0248 0.060 0.020 0.030 0.00827 0.0247 0.020 0.090 a) The actual molecule being measured for these experiments (for initial rate) was OH(aq), since it's easy to measure pH. For experiment 1, at what rate would clo, (aq) be...
Question Completion Status: Consider this chemical reaction at 25 °C: ClO2(aq) + 2OH(aq) + C1O3(aq) + CO2(aq) The following experimental data were collected (M=mol/L): Experiment Initial [CIO2] (M) Initial [OH^](M) 0.060 0.030 2 0.020 0.030 3 0.020 0.090 Initial rate (M/s) 0.0248 0.00276 0.00828 Determine the rate law. Suggested time: 6 min rate = k[CIO2][OH-]2 none of these rate = k[CIO2](OH) 1 rate = K[C1021?[OH-]2 rate - k[CI0212[OH-] rate = k[Clo21°OH)
2 CIO2 (aq) + 2 OH- (aq) - CIO3- (aq) + CO2- (aq) + H20 (1) Experiment Number Initial Rate (CIO2(M) [OH-] (M) (M/s) 0.060 0.030 0.0248 0.020 0.030 0.00276 0.020 0 .090 0.00828 3 1) What is the magnitude of the rate constant for the reaction? A) 1.15 x 104 B) 115 C) 4.6 D) 713 E) 230 2) Which reaction produces a decrease in the entropy of the system? A) 2C(s) + O2 (g) - 200 (8) B)...
3. Experiments are done to study the reaction between aqueous chlorine dioxide and hydroxide ions: 2 CIO2 (aq) + 2 OH- (aq) → C103- (aq) + ClO2- (aq) + H20 (1) Exp. # Temp (°C) [CIO2), M [ОНН, М Initial rate, M/s 125 0.015 0.050 0.0026 25 0.045 0.050 0.0234 0.060 0.080 0.0665 4 35 0.060 0.040 0.1022 25 d) If this reaction is occurring in a 1.00-liter solution in a large beaker, predict how each of the following would...
28 its Data representing initial concentrations and initial rates for the following reaction are given below. Choose the correct rate expression. 20102(aq) + 2OH"(aq) + CIO, (aq) + CO2 (aq) + H2O(1) Exp. No. 1 [CIO2lo (M) 0.060 0.020 0.020 [OH-]o (M) 0.030 0.030 0.090 2 3 Initial Rate (Ms) 0.0248 0.00276 0.00828 rate = k (CIO) (OH)2 ratek (CIO) (OH) rate = k (CIO) [OH-] rate = k [CIO] (OH) ratek (CIO) [OH- Previous ОО Near
Chlorine dioxide (ClO_2) is a disinfectant used in municipal water treatment plants. It dissolves in basic solution, producing ClO_3^- and ClO_2: 2ClO_2 (g) + 2OH^-(aq) rightarrow ClO_3^-(aq) + ClO_2^- (aq) + H_2O(l) The following kinetic data were obtained at 350 K for the reaction: Choose the correct rate law for the reaction Choose one: Rate = k[ClO_2] Rate = k[ClO_2][OH^-]^2 Rate = k[ClO_2]^2[OH^-] Rate = k[ClO_2][OH^-] Determine the rate constant for the reaction at 350.0 K M^-1 s^-1
Please help me answer all questions. I will give a thumbs up if all
questions are answered.
This is a multiple-choice test consisting of 35 questions. Each correct answer is worth three points for a total of 105 points. Mark all answers on your 882-scantron form. the scantron will be graded 1. Given the initial rate data for the reaction A + B C, determine the rate equation for the reaction. 0.020 0.020 0.060 0.030 0.060 0.030 0.010 0.040 0.090...
Useful Information: Please show your work and write in complete sentences. R= 8.314 J/mol K 1/[A].= kt +1/[A]. In k=-E/RT+ In A In [A] =-kt + In[A]. In kı/k2 = E/R (1/T2 - 1/11) 1. The following data were collected for the reaction: 2 C102(aq) + 2 OH (g) → C103 (aq) + ClO2 (aq) + H2O(1) Experiment [C102], M [OH-], M Initial Rate, M/s 1 0.060 0.030 0.0248 2 0 .020 0.030 0.00276 0.020 0 .090 0.00828 a. Determine...
9. Linked Question "Groot" [1]: What is the order of the reaction with respect to ClO2 Experiment Number (CIO2) (M) 0.060 0.020 0.020 (OH-] (M) 0.030 0.030 0.090 Initial Rate (M5-) 0.0248 0.00276 0.00828 ②3 B. 2 c.1 D.4 E. O 10. Linked Question "Groot" (2] : What is the order of the reaction with respect to OH (described in Linked Question "Groot" [1])? A. 2 B. 1 C. 3 D. 4 E.O 11. Linked Question "Groot" (3): What is...
Chlorine dioxide reacts in basic water to form chlorite and chlorate acfording to the following chemical equation 2C102(aq) + 2OH(aq) + CO2(aq) + C103"(aq) H2O(1) A kinetic study of this reaction under a certain set of conditions yielded the data below Exp |CIO 2 (M) TOH) (M) Initial rate (W) 11 0.0500 0.100 5.75 X 10-2 2 0.100 0.100 2.30 x 10-1 3 0.100 0.0500 1.15 x 10-1 (a) While the rate law for this reaction (b) Calculate the rate...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago