What features of the DNA molecule were Watson and Crickable to figure out based on biochemical...
Homework Answers
the polynucleotide chain of
DNA has a regular helix
The diameter of the Helix was about 20 A°.
The DNA helix made a full turn at every 34A°. It had 10 nucleotides per turn at a distance of 3.4 A°.
They also concluded that DNA contained the hereditary material within the polypeptide chains.
Add Answer to:
What features of the DNA molecule were
Watson and Crickable
to figure out based
on biochemical...
Watson and Crick A. Determined the mode of DNA replication Rosalind Franklin B. Discovered the four...
Watson and Crick A. Determined the mode of DNA replication Rosalind Franklin B. Discovered the four DNA nucleotides: A, T, C, G Meselson and Stahl C. Determined the ratios of nucleotides in DNA Edwin Chargaff D.Used X-ray crystallography to determine the 3- Dimensional structure of DNA E. Proposed a double helix model of DNA F. Proposed a triple helical model of DNA
Which of the following statements is true regarding the discovery of the double helix? Choose 1...
Which of the following statements is true regarding the discovery of the double helix? Choose 1 answer: (A) It was discovered that double-stranded DNA is a parallel molecule. Rosalind Franklin's x-ray crystallography provided Watson and Crick with important data that helped determine the structure of DNA. The experiments that led to the discovery of the double helix ultimately disproved Chargaff's rules regarding nitrogenous bases. James Watson, Francis Crick, Maurice Wilkins, and Rosalind Franklin were awarded the Nobel Prize in Medicine...
. What are three features a circular DNA molecule can have in order for it to...
. What are three features a circular DNA molecule can have in order for it to be used as a cloning vector? What is the purpose of each feature?
Who were the guys who figured out the structure of DNA? What did Rosalind Franklin contribute...
Who were the guys who figured out the structure of DNA? What did Rosalind Franklin contribute to the discovery? How do the bases pair in DNA? How did Franklin’s X-ray image and Chargaff’s rule help? What function do the telomeres seem to serve? For what do we use genetic engineering?
Chargaff discovered that the A-T bond has the same width as the G-C bond. What implication...
Chargaff discovered that the A-T bond has the same width as the G-C bond. What implication does this have for the structure of the DNA molecule? It means that the molecule will vary in width as you move down its length, depending on the number of A-T and G-C nucleotides. It means that the molecule will be very hydrophilic, because nucleotides are hydrophilic. It means that DNA was the first life form on Earth. It means that the molecule will...
15. Which one represents the correct DNA molecule based on the double helix model?
15. Which one represents the correct DNA molecule based on the double helix model?A. 5'-GAATTC-3' 5'-GAATTC-3'B. 5'-GAATTC-3' 3'-GAATTC-5'C. 5'-GAATTC-3' 5'-CTTAAG-3'D. 5'-GAATTC-3' 3'-CTTAAG-5'E. 5'-GAAUUC-3' 3'-CUUAAG-5'16. In the flow of genetic information (often called the Central Dogma), which of the following best represents the expression of genes? A. Protein—>RNA—>DNA B. DNA—>RNA—>Protein C. RNA—>DNA—>Protein D. DNA—>Protein—>RNAE. RNA—>Protein—>DNA17. Which of the following double-stranded nucleic acid represents the double helix model that is based on the two main concepts, antiparallel orientation and base-pairing rule, suggested by...
What potential outcomes are possible after replication in a DNA molecule with a depurination modification that...
What potential outcomes are possible after replication in a DNA molecule with a depurination modification that is left unrepaired? Choose one or more: A.The DNA molecule contains the normal sequence. B.The DNA molecule contains an extra three nucleotide pairs. C.The DNA molecule is missing one nucleotide pair. D.The DNA molecule is converted into RNA.
CHEM 161 "The Double Helix” Worksheet Reading (file:///C:/Users/Kayla/Desktop/Watson_The_Double_Helix.pdf) With whom was Francis Crick talking when he...
CHEM 161 "The Double Helix” Worksheet Reading (file:///C:/Users/Kayla/Desktop/Watson_The_Double_Helix.pdf) With whom was Francis Crick talking when he revealed he did not remember the structure of the four bases of DNA? What was that person's own contribution to understanding DNA structure? Watson and Crick hypothesized an early DNA structure model that they showed to Wilkins and Franklin. What were they major structural features of that model, and what was the evidence that made that model less attractive? The structure of DNA was...
1. Read through the introduction. Answer the questions in between each historical section. 1. 2. 3....
1. Read through the introduction. Answer the questions in
between each historical section.
1.
2.
3.
-----------------
1.
2.
genetic molecule? The Evidence: 1949-1952 1949: Erwin Chargaff, a biochemist, reports that DNA composition is species-specific, that is, the amount of DNA and its nitrogenous bases varies from one species to another. In addition, Chargaff finds that the amount of adenine equals the amount of thymine, and the amount of quanine equals the amount of cytosine in DNA from every species....
give detailed evaluation, based on extensive DNA evidence, of out of Africa hypothesis and Multi-regional model...
give detailed evaluation, based on extensive DNA evidence, of out of Africa hypothesis and Multi-regional model for the origin of Modern humans.
Watson and Crick A. Determined the mode of DNA replication Rosalind Franklin B. Discovered the four DNA nucleotides: A, T, C, G Meselson and Stahl C. Determined the ratios of nucleotides in DNA Edwin Chargaff D.Used X-ray crystallography to determine the 3- Dimensional structure of DNA E. Proposed a double helix model of DNA F. Proposed a triple helical model of DNA
Which of the following statements is true regarding the discovery of the double helix? Choose 1 answer: (A) It was discovered that double-stranded DNA is a parallel molecule. Rosalind Franklin's x-ray crystallography provided Watson and Crick with important data that helped determine the structure of DNA. The experiments that led to the discovery of the double helix ultimately disproved Chargaff's rules regarding nitrogenous bases. James Watson, Francis Crick, Maurice Wilkins, and Rosalind Franklin were awarded the Nobel Prize in Medicine...
1. Read through the introduction. Answer the questions in
between each historical section.
1.
2.
3.
-----------------
1.
2.
genetic molecule? The Evidence: 1949-1952 1949: Erwin Chargaff, a biochemist, reports that DNA composition is species-specific, that is, the amount of DNA and its nitrogenous bases varies from one species to another. In addition, Chargaff finds that the amount of adenine equals the amount of thymine, and the amount of quanine equals the amount of cytosine in DNA from every species....
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 44 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago