Can someone give a thorough explanation of why? Thank you so much!!
Homework Answers
No , We can’t find Electric field unless we know the potential more than a point .
Explanation:
Mathematically , electric field is defined by negative gradient of potential . If we don’t know the variation of potential, we can’t find gradient and hence electric field can’t be determined.
Add Answer to:
Can someone give a thorough explanation of why? Thank you so
much!!
4. If V is...
Can someone help me answer these questions about the mind/body problem? thank you so much in adva...
can someone help me answer these questions about the mind/body problem? thank you so much in advance! Mind/Body Problem. i. What is the problem regarding the relations of mental events to physical events? (What is it that scientists and philosophers object to about a world that has both physical and mental events? ii. There have been two classes of "solution" to the problem, monism and dualism. Give two examples of each and explain what each proposes about M/B relations. iii. ...
Please give an explanation to this question in paragraph form. Thank you. ? A total charge,...
Please give an explanation to this question
in paragraph form. Thank you.
? A total charge, Q, is distributed uniformly throughout a cube of edge length, a. Is the resultant Q electric field at an external point, P, a distance r from the center. C, of the cube, given by E 4160 m2 If not, can E be found by constructing a "cocentric" cubical Gaussian surface? If not, explain why not. Can you say anything about E ifr » a?
Please give a thorough explanation, thank you! You are running a bank and a customer wants...
Please give a thorough explanation, thank you!
You are running a bank and a customer wants to deposit $10m into the bank starting in 244 days and ending in 366 days. You will pay interest on an ACT/360 basis and will set the rate at 0.40% below fair. Interest rates are: Days Cont. Comp. Rates 244 3.01 366 3.65 What rate do you charge? Give your rate to 2 decimal places and enter 3.05% as 3.05.
Why is the correct answer none of the above statements. Can you give a thorough explanation....
Why is the correct answer none of the above
statements. Can you give a thorough explanation.
Consider a hollow spherical conducting shell with inner and outer radiuses rį and r2 that carries no net charge but that has a charge +9 at its geometric center. A second charge of equal magnitude but opposite sign -q is brought to a point P outside the shell as shown in the figure. Which of the following statements is true? 11 P +9 T2...
Can someone please give a detailed explanation of the steps within this reaction? Thank you. ...
Can someone please give a detailed
explanation of the steps within this reaction? Thank you.
Give the products of the reaction below. Give the structure of all possible products and give the names for each product. b) Elimination of water from 2-butanol
Please give a thorough explanation and show all work. Thank you. For the circuit Flnd Yin,...
Please give a thorough explanation and show all work. Thank
you.
For the circuit Flnd Yin, Zin, Wo, Qc and bandwidth w 10rad/s
Hi, Can someone help me with the following organic chemistry question regarding mechanisms? Thank you so...
Hi,
Can someone help me with the following organic chemistry
question regarding mechanisms?
Thank you so much! I will give a thumbs up if it's answered
well!
Explain the product ratios obtained below. Your explanation should include the mechanism(s) for the rate-limiting step(s) of each reaction, and an approx. 100-word discussion. hv 86% 14% 1 - 2x Br2 hv <1% >99%
Can someone help me understand why this one is wrong? thank you so much. Incorrect Question...
Can someone help me understand why this one is wrong?
thank you so much.
Incorrect Question 2 0/2 pts Calculate the change in internal energy for a system that is giving off 45.0 kJ of heat and is performing 855 J of work on the surrounding. -45.9 kJ 44.1 kJ 9.00 x 10^2 kJ -9.00 x 10^2 kJ
Can someone give me a step by step explanation pls thank you 2. If you take...
Can someone give me a step by step explanation pls thank
you
2. If you take snapshots of a standing wave on a string, there are certain instants when the string is totally flat. What has happened to the energy of the wave at those instants?
Can someone please help me with these homework questions. Thank you so much. 1. A pharmaceutical...
Can someone please help me with these homework questions. Thank you so much. 1. A pharmaceutical company states that the average number of people that have serious medical issues with their medicine is only 5 people per year. The medicine is sold to millions of people. a) What is the probability that 1 or more people will have serious medical issues with their medicine? Give answer to 3 decimal places. b) What is the probability that fewer than 1...
Please give an explanation to this question
in paragraph form. Thank you.
? A total charge, Q, is distributed uniformly throughout a cube of edge length, a. Is the resultant Q electric field at an external point, P, a distance r from the center. C, of the cube, given by E 4160 m2 If not, can E be found by constructing a "cocentric" cubical Gaussian surface? If not, explain why not. Can you say anything about E ifr » a?
Please give a thorough explanation, thank you!
You are running a bank and a customer wants to deposit $10m into the bank starting in 244 days and ending in 366 days. You will pay interest on an ACT/360 basis and will set the rate at 0.40% below fair. Interest rates are: Days Cont. Comp. Rates 244 3.01 366 3.65 What rate do you charge? Give your rate to 2 decimal places and enter 3.05% as 3.05.
Why is the correct answer none of the above
statements. Can you give a thorough explanation.
Consider a hollow spherical conducting shell with inner and outer radiuses rį and r2 that carries no net charge but that has a charge +9 at its geometric center. A second charge of equal magnitude but opposite sign -q is brought to a point P outside the shell as shown in the figure. Which of the following statements is true? 11 P +9 T2...
Can someone please give a detailed
explanation of the steps within this reaction? Thank you.
Give the products of the reaction below. Give the structure of all possible products and give the names for each product. b) Elimination of water from 2-butanol
Please give a thorough explanation and show all work. Thank
you.
For the circuit Flnd Yin, Zin, Wo, Qc and bandwidth w 10rad/s
Hi,
Can someone help me with the following organic chemistry
question regarding mechanisms?
Thank you so much! I will give a thumbs up if it's answered
well!
Explain the product ratios obtained below. Your explanation should include the mechanism(s) for the rate-limiting step(s) of each reaction, and an approx. 100-word discussion. hv 86% 14% 1 - 2x Br2 hv <1% >99%
Can someone help me understand why this one is wrong?
thank you so much.
Incorrect Question 2 0/2 pts Calculate the change in internal energy for a system that is giving off 45.0 kJ of heat and is performing 855 J of work on the surrounding. -45.9 kJ 44.1 kJ 9.00 x 10^2 kJ -9.00 x 10^2 kJ
Can someone give me a step by step explanation pls thank
you
2. If you take snapshots of a standing wave on a string, there are certain instants when the string is totally flat. What has happened to the energy of the wave at those instants?
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 minute ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 32 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago