Homework Answers
Add Answer to:
Can someone explain why this is the answer?
13. What is(are) the product(s) of the following...
Hello! Just double checking the answers my organic chemistry study guide. Please go ahead and answer ALL the questions you see below, if you can't answer all then PLEASE let someone else do them!...
Hello! Just double checking the answers my organic chemistry
study guide. Please go ahead and answer ALL the
questions you see below, if you can't answer all then
PLEASE let someone else do them! High rating only
given to ALL questions complete
roboration/Oxidationn 11. Predict the major product for each of the hydroboration-oxidation reactions shown below 1. BH3" THF 2. H202, NaOH 1. BH3. THF 2. H202 NaOH b. C. 1. BH3. THF 2. H202 NaOH 12. Show the full...
Hi can someone explain why this is a diastermer I’m not able to figure out the...
Hi can someone explain why this is a diastermer I’m not able
to figure out the configuration of the ch3 because isn’t that
achril because of the two oh groups ? Can someone show if it is the
chiral the priority groups labeled around the ch3 ?
For the second picture is this answer key wrong because I’m
getting a solid wedge for ethyl not dashed ??
all-cis all-trans CH3 CH3 но но diastereomer он он
Given the following hydroboration-oxidation reaction, draw the expected trialkylborane intermediate (Part 1) and the expected product(s)...
Given the following hydroboration-oxidation reaction, draw the expected trialkylborane intermediate (Part 1) and the expected product(s) (Part 2). When drawing the product(s), include the correct stereochemistry. 1) BH3'THF 2)H202, NaOH, H2O 3rd attempt Part1 (1point) d See Periodic Table See Hint For the trialkylborane product, stereochemistry is not required Draw the trialkvlborane intermediate
Can someone explain why the answer is not cis-1,2-cyclohexanediol and ethanol? Question 7 What are the...
Can someone explain why the answer is not
cis-1,2-cyclohexanediol and ethanol?
Question 7 What are the products of the reaction shown below? O CH heat O IH OA. cyclohexanone and ethanol O B. cis-1,2-cyclohexanediol and ethanol O C. trans-1,2-cyclohexanediol and ethanol O D. cyclohexanone and ethanal 0 E. cis-1,2-cyclohexanediol and ethanal
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2....
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2. H2O2. HO- B. H20, H2SO4 C. OsO4 H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 21. Provide the major organic product of the reaction below. 10. 2. (CHS uraw the major organic product generated in the reaction below. Pay particular attention to and stereochemical detail. CH3 CH, KMnO4 (warm, conc.) CH, H 23. Give the structure of the alkene which would yield the...
10. Provide the reagents necessary to complete the following transformation. 13. Provide the structure of the...
10.
Provide the reagents necessary to complete the following
transformation. 13. Provide the structure of the major organic
product of the reaction below
10. Provide the reagents necessary to complete the following transformation. A. 1. BH3 THF 2. H202, HO B). H20, H2SO4 C. OsO4. H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 11. Which of the following is the best reaction sequence to use if one wants to accomplish a Markovnikov addition of water to an alkene with...
2 problems including answer options [Review Topics) [References) In each case below select the synthetic procedure/s...
2 problems including answer options
[Review Topics) [References) In each case below select the synthetic procedure/s that could be used to carry out the transformation, giving the alcohol shown as the single major product. The procedures are: Hydroboration oxidation: alkene +BH3, then H,02, "OH. Oxymercuration: alkene + Hg(OAc)2, H2O, then NaBH4 OH a- CH3 CH3 Submit Answer Retry Entire Group 4 more group attempts remaining thetic procedure/s that could be used to carry out the transformation, + BHz; then H202,...
Can someone please explain the answer with detailed mechanisms? Thank you! 52) What would be the...
Can someone please explain the answer with detailed mechanisms?
Thank you!
52) What would be the major product of the following reaction? Br2, CCI4 C2H5 C2H5 C2H5 CH3 CH3 H3C H3C Br C3H7 C3H7 C3H7 C3H7 IV A) Equal amounts of I and II B) Equal amounts of II and III. C) Equal amounts of III and IV D) I and II as major products, III and IV as minor products. E) All of these choices in equal amounts Answer:...
Identify the two diastereomeric hydroboration-oxidation products that can be formed from the following alkene by dragging...
Identify the two diastereomeric hydroboration-oxidation products that can be formed from the following alkene by dragging the product pair to the product bin. Then suggest which product should be the major product or whether they will be formed in equal amounts by dragging the appropriate label to the bin under the products. Note: If one or more labels are incorrectly placed, a single red X will appear on the top left. 1) BH3, THF 2) H2O2, -OH Incorrect. o do.com...
3. Predict the majoe product(s) for the following reactions. Show the stereochemistry of the product(s) when...
3. Predict the majoe product(s) for the following reactions. Show the stereochemistry of the product(s) when applicable. HCI (1) Hg(OAc)2 (2) NaBH4 (1) BH3 THF (2) H202. OH Br, Br2. H20 Pt (I) CH3CO3H (2) H,O+ (2) DMS HBr ROOR
Hello! Just double checking the answers my organic chemistry
study guide. Please go ahead and answer ALL the
questions you see below, if you can't answer all then
PLEASE let someone else do them! High rating only
given to ALL questions complete
roboration/Oxidationn 11. Predict the major product for each of the hydroboration-oxidation reactions shown below 1. BH3" THF 2. H202, NaOH 1. BH3. THF 2. H202 NaOH b. C. 1. BH3. THF 2. H202 NaOH 12. Show the full...
Hi can someone explain why this is a diastermer I’m not able
to figure out the configuration of the ch3 because isn’t that
achril because of the two oh groups ? Can someone show if it is the
chiral the priority groups labeled around the ch3 ?
For the second picture is this answer key wrong because I’m
getting a solid wedge for ethyl not dashed ??
all-cis all-trans CH3 CH3 но но diastereomer он он
Given the following hydroboration-oxidation reaction, draw the expected trialkylborane intermediate (Part 1) and the expected product(s) (Part 2). When drawing the product(s), include the correct stereochemistry. 1) BH3'THF 2)H202, NaOH, H2O 3rd attempt Part1 (1point) d See Periodic Table See Hint For the trialkylborane product, stereochemistry is not required Draw the trialkvlborane intermediate
Can someone explain why the answer is not
cis-1,2-cyclohexanediol and ethanol?
Question 7 What are the products of the reaction shown below? O CH heat O IH OA. cyclohexanone and ethanol O B. cis-1,2-cyclohexanediol and ethanol O C. trans-1,2-cyclohexanediol and ethanol O D. cyclohexanone and ethanal 0 E. cis-1,2-cyclohexanediol and ethanal
20. Provide the reagents necessary to complete the following the following transformation. A. 1. BH3 THF2. H2O2. HO- B. H20, H2SO4 C. OsO4 H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 21. Provide the major organic product of the reaction below. 10. 2. (CHS uraw the major organic product generated in the reaction below. Pay particular attention to and stereochemical detail. CH3 CH, KMnO4 (warm, conc.) CH, H 23. Give the structure of the alkene which would yield the...
10.
Provide the reagents necessary to complete the following
transformation. 13. Provide the structure of the major organic
product of the reaction below
10. Provide the reagents necessary to complete the following transformation. A. 1. BH3 THF 2. H202, HO B). H20, H2SO4 C. OsO4. H202 D. CH3CO3H E. 1. CH3CO3H 2. H, H20 11. Which of the following is the best reaction sequence to use if one wants to accomplish a Markovnikov addition of water to an alkene with...
2 problems including answer options
[Review Topics) [References) In each case below select the synthetic procedure/s that could be used to carry out the transformation, giving the alcohol shown as the single major product. The procedures are: Hydroboration oxidation: alkene +BH3, then H,02, "OH. Oxymercuration: alkene + Hg(OAc)2, H2O, then NaBH4 OH a- CH3 CH3 Submit Answer Retry Entire Group 4 more group attempts remaining thetic procedure/s that could be used to carry out the transformation, + BHz; then H202,...
Can someone please explain the answer with detailed mechanisms?
Thank you!
52) What would be the major product of the following reaction? Br2, CCI4 C2H5 C2H5 C2H5 CH3 CH3 H3C H3C Br C3H7 C3H7 C3H7 C3H7 IV A) Equal amounts of I and II B) Equal amounts of II and III. C) Equal amounts of III and IV D) I and II as major products, III and IV as minor products. E) All of these choices in equal amounts Answer:...
Identify the two diastereomeric hydroboration-oxidation products that can be formed from the following alkene by dragging the product pair to the product bin. Then suggest which product should be the major product or whether they will be formed in equal amounts by dragging the appropriate label to the bin under the products. Note: If one or more labels are incorrectly placed, a single red X will appear on the top left. 1) BH3, THF 2) H2O2, -OH Incorrect. o do.com...
3. Predict the majoe product(s) for the following reactions. Show the stereochemistry of the product(s) when applicable. HCI (1) Hg(OAc)2 (2) NaBH4 (1) BH3 THF (2) H202. OH Br, Br2. H20 Pt (I) CH3CO3H (2) H,O+ (2) DMS HBr ROOR
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 39 seconds ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 50 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago