Can an Rf value be less than 0? Can it be greater than 1? Why or...
Homework Answers
No R_f value can't be greater than 1 or less than 0 as it is defined as the ratio of distance travelled by a sample compound on the TLC plate divided by that of the solvent. As, solvent will always have highest mobility on the TLC plate, R_f value thus can't be greater than 1. And the ratio can't be negative as distance travelled by a compound is always a positive quantity, thus it can't be less than 0.
The value of Rf is: a. greater than or equal to one b. less than or...
The value of Rf is: a. greater than or equal to one b. less than or equal to zero c. less than or equal to one d. none of the above Explain
1) positive, greater than 0 OR negative, less than 0 2) positive, greater than 0 OR...
1) positive, greater than 0
OR negative, less than 0
2) positive, greater than 0 OR negative, less
than 0
3) positive, greater than 0 OR negative, less
than 0
4) positive, greater than 0 OR negative, less
than 0
5) smaller, larger, smaller or larger depending on temp.
FOLLOW-UP PROBLEM 20.7 Determining the Effect of Temperature on AG A reaction is nonspontaneous at room temperature but is spontaneous at 500°C. What can you say about the signs and...
In chromotagraphy separation of photosynthetic pigments, is it possible for have an Rf value greater than...
In chromotagraphy separation of photosynthetic pigments, is it possible for have an Rf value greater than 1? = Rf value Distance moved by pigment / Distance moved by solvent yes no
How can you separate two substances with a Rf(rate of flow) value difference of less than 0.05 in the TLC?
How can you separate two substances with a Rf(rate of flow) value difference of less than 0.05 in the TLC?
Correlation Can a Pearson's r value be great than 1 or less than -l? Why or...
Correlation Can a Pearson's r value be great than 1 or less than -l? Why or why not? How do we calculate Pearson's r? How do we calculate df for a correlation? o What does the covariance represent mathematically? 0 How many standard deviations do we need to calculate to calculate the r value? 0 What is an example of an r value that represents a strong correlation, what about a weak correlation? What is the r value associated with...
why can the Rf value be used to distinguish the substances from one another? and Why...
why can the Rf value be used to distinguish the substances from one another? and Why is anRf value rather than the distance the spot moved used to help identify a substance by TLC?
An F statistic can have what values? 1). less than or equal to zero 2). greater...
An F statistic can have what values? 1). less than or equal to zero 2). greater than or equal to zero 3). greater than zero 4). greater than or less than zero less than zero
1. a) Why does biphenyl have a higher Rf value than either benzophenone or triphenylmethanol? Exp...
1. a) Why does biphenyl have a higher Rf value than either benzophenone or triphenylmethanol? Explain based on the structures and their effect on mobility in the TLC process. b) Which compound, benzophenone or triphenylmethanol has a higher Rf value? Explain, based on their structures, how you can predict this. c) You developed your TLC using a 10% mixture of diethyl ether in petroleum ether. Petroleum ether is a mixture of non-polar alkanes, so this TLC solvent is composed of...
* (For angles greater than or equal to 0 degrees, and less than or equal to...
* (For angles greater than or equal to 0 degrees, and less than or equal to 90 degrees) If Secant t - 17 (where't' is an angle), What is Sint ? O a. Sint=1/17 and -1/17 b. Sint - 1/17 O C. Sint = .998 and -998 + od. Sint-.998
1. Is the pressure inside a rubber balloon greater than, less than, or equal to the...
1. Is the pressure inside a rubber balloon greater than, less than, or equal to the ambient atmospheric pressure? a. greater than b. equal to c. less than 2. Arches can span much greater distances using less material than post and beams by a. converting tension stresses into compression that stone and wood handle much better b. converting compression stresses into tension that stone and wood handle much better 3. The units for strain are a. length divided by force...
1) positive, greater than 0
OR negative, less than 0
2) positive, greater than 0 OR negative, less
than 0
3) positive, greater than 0 OR negative, less
than 0
4) positive, greater than 0 OR negative, less
than 0
5) smaller, larger, smaller or larger depending on temp.
FOLLOW-UP PROBLEM 20.7 Determining the Effect of Temperature on AG A reaction is nonspontaneous at room temperature but is spontaneous at 500°C. What can you say about the signs and...
In chromotagraphy separation of photosynthetic pigments, is it possible for have an Rf value greater than 1? = Rf value Distance moved by pigment / Distance moved by solvent yes no
Correlation Can a Pearson's r value be great than 1 or less than -l? Why or why not? How do we calculate Pearson's r? How do we calculate df for a correlation? o What does the covariance represent mathematically? 0 How many standard deviations do we need to calculate to calculate the r value? 0 What is an example of an r value that represents a strong correlation, what about a weak correlation? What is the r value associated with...
* (For angles greater than or equal to 0 degrees, and less than or equal to 90 degrees) If Secant t - 17 (where't' is an angle), What is Sint ? O a. Sint=1/17 and -1/17 b. Sint - 1/17 O C. Sint = .998 and -998 + od. Sint-.998
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 35 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 7 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago