Homework Answers
Add Answer to:
help explain how to get products in all questions
please!!!
What is the product for the...
What is the major product obtained from the following reaction sequence? Br2 EtONa NACN D HBr...
What is the major product obtained from the following reaction sequence? Br2 EtONa NACN D HBr B A ETOH hv peroxides heat CN CN CN CN II III O A. III OB. IV O C.V OD II O E. I What would be the major product of the following reaction sequence? 1. HBr, ROOR, hv 2. CH CO-H, CH coNa OH 0.CCH 0.cCH Ph Ph I III IV O A.I O B. II O C. IV O D. II O...
What product or products are expected from the following reaction sequence? 1. What product or products...
What product or products are expected from the following
reaction sequence?
1. What product or products are expected from the following reaction sequence? H₃C 1. Na(s)/ NI,d) 2.0, 3.11,02 CH2CH3 IV. o н сн, но a. I & III сн, н ан,сн, но b. ll & III c. II and IV d. 1 & IV снусна e. Ill & IV
answer multiple choice questions 28-33 Spring 201 (2 pounts) What is the major product of the following reaction sequence? 28. 1. H3o 2. Jones Reagent (CrO3+ H2SO4) 5. NaH 6. CH3Br Ph Ph Ph OC...
answer multiple choice questions 28-33
Spring 201 (2 pounts) What is the major product of the following reaction sequence? 28. 1. H3o 2. Jones Reagent (CrO3+ H2SO4) 5. NaH 6. CH3Br Ph Ph Ph OCH3 Ph OH OCH3 IV v. a) I b) II c) III points) Which of the following structures is the most stable (lowest energy)? d) IV e) V. 29. a) I b) II d) IV (2 pointa) Predict the major product of the following reaction. c)...
10. What is a major problem with Friedel-Crafts alkylation? A) It requires high temperatures. B) The...
10. What is a major problem with Friedel-Crafts alkylation? A) It requires high temperatures. B) The conditions are too acidic. C) The starting material is frequently over-alkylated. D) The products coordinate with the aluminum chloride. 11. Which of the following statements about the mechanism of electrophilic aromatic substitution is not true? A) All electrophilic aromatic substitution reactions occur via a two-step mechanism. B) The transition state of the first step is lower in energy. C) The first step is the...
can you answer all the questions please? thanks What is the order of decreasing acidity for the following acids? 5....
can you answer all the questions please? thanks
What is the order of decreasing acidity for the following acids? 5. соон СОон COOH COOH iv) OCH CN OCH3 CN e. lil> v>i> d. ii>i> iv i a. ii> iv> l>i b.i>iv c. i>iv>i 6. What would be the final product of the following reaction? 1. P O10 NH2 2. CHMgBr 3. Hy0 CH3 NH2 d. b. C. NH2 NH он 7. Predict the major product of the following reaction sequence:...
16. What is the final product of the following reaction sequence? Give structural details of all...
16. What is the final product of the following reaction sequence? Give structural details of all significant intermediates. i. NaH ii. Br CO 2Et CO 2Et Br iii. NaOEt iv. NaOH, heat v. H2O7, heat Part I. Multiple Choice, select best answer. 1. In the molecule below, which of the hydrogens are the most acidic? II IV sonryer i II í V (a) 1 (b) II (c) III (d) IV 6. What would be the major product of the following...
Answer all please What is the major product obtained from the following reaction? Brz H2O Ye...
Answer all please
What is the major product obtained from the following reaction? Brz H2O Ye Boh OH HO Br A) I B) II C) III D) IV Predict the major product of the following reaction. HO H2SO4 A) I B) II C) III D) IV Which of the following compounds has the highest boiling point? A) I B) II C) III D) IV
12. What would be the major product of the following reaction? i. Brz, NaOH ii. H20"...
12. What would be the major product of the following reaction? i. Brz, NaOH ii. H20" ? mo Br НО. O II III Br Br ho IV A. I B. II C. III D. IV E. V 13. What would be the major product of the following reaction sequence? A. I B. II C. III D. IV E. V 2 i. LDA ii. CHEI De ci II I III IV V 14. Which of the following could be used to...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is mixed with allyl chloride and that product is heated and then hydrolyzed? HO ora III A) I B) II C) III D) IV E) V 59. Which reagent would best serve as the basis for a simple chemical test to distinguish between CH3 ? CH3 and M A) NaOI (12 in NaOH) B) Bry/CCL C) CrO3/H2SO4 D) NaHCO3/H20 E) Ag(NH3)2+ 60. What would be...
plz help 9. What would be the major product of the following reaction? H2O+ CHECCHCH2CH3 +...
plz help
9. What would be the major product of the following reaction? H2O+ CHECCHCH2CH3 + Brz ? CH3 Br OH i OH concen CBH CCHCHCH3 C6H5CcBrCH2CH3 CeHCCHCHCH3 Corsa CH3 CH3 CH3 C. B. A. CeHCBr2CHCH2CH3 məcsidcmen.com m-BrCH CCHCH2CH3 D. CH3 E. CH3 10. What would be the product, C, of the following reaction sequence? OH H307, heat НА COH CH + CH3CH2CH 25 °C (-H,0) i H2, Ni high pressure corporal CHECCHCH2OH CH3 CHCH2CHCH2OH B. CHE CeHCH,CHCH сн. A....
What is the major product obtained from the following reaction sequence? Br2 EtONa NACN D HBr B A ETOH hv peroxides heat CN CN CN CN II III O A. III OB. IV O C.V OD II O E. I What would be the major product of the following reaction sequence? 1. HBr, ROOR, hv 2. CH CO-H, CH coNa OH 0.CCH 0.cCH Ph Ph I III IV O A.I O B. II O C. IV O D. II O...
What product or products are expected from the following
reaction sequence?
1. What product or products are expected from the following reaction sequence? H₃C 1. Na(s)/ NI,d) 2.0, 3.11,02 CH2CH3 IV. o н сн, но a. I & III сн, н ан,сн, но b. ll & III c. II and IV d. 1 & IV снусна e. Ill & IV
answer multiple choice questions 28-33
Spring 201 (2 pounts) What is the major product of the following reaction sequence? 28. 1. H3o 2. Jones Reagent (CrO3+ H2SO4) 5. NaH 6. CH3Br Ph Ph Ph OCH3 Ph OH OCH3 IV v. a) I b) II c) III points) Which of the following structures is the most stable (lowest energy)? d) IV e) V. 29. a) I b) II d) IV (2 pointa) Predict the major product of the following reaction. c)...
10. What is a major problem with Friedel-Crafts alkylation? A) It requires high temperatures. B) The conditions are too acidic. C) The starting material is frequently over-alkylated. D) The products coordinate with the aluminum chloride. 11. Which of the following statements about the mechanism of electrophilic aromatic substitution is not true? A) All electrophilic aromatic substitution reactions occur via a two-step mechanism. B) The transition state of the first step is lower in energy. C) The first step is the...
can you answer all the questions please? thanks
What is the order of decreasing acidity for the following acids? 5. соон СОон COOH COOH iv) OCH CN OCH3 CN e. lil> v>i> d. ii>i> iv i a. ii> iv> l>i b.i>iv c. i>iv>i 6. What would be the final product of the following reaction? 1. P O10 NH2 2. CHMgBr 3. Hy0 CH3 NH2 d. b. C. NH2 NH он 7. Predict the major product of the following reaction sequence:...
16. What is the final product of the following reaction sequence? Give structural details of all significant intermediates. i. NaH ii. Br CO 2Et CO 2Et Br iii. NaOEt iv. NaOH, heat v. H2O7, heat Part I. Multiple Choice, select best answer. 1. In the molecule below, which of the hydrogens are the most acidic? II IV sonryer i II í V (a) 1 (b) II (c) III (d) IV 6. What would be the major product of the following...
Answer all please
What is the major product obtained from the following reaction? Brz H2O Ye Boh OH HO Br A) I B) II C) III D) IV Predict the major product of the following reaction. HO H2SO4 A) I B) II C) III D) IV Which of the following compounds has the highest boiling point? A) I B) II C) III D) IV
12. What would be the major product of the following reaction? i. Brz, NaOH ii. H20" ? mo Br НО. O II III Br Br ho IV A. I B. II C. III D. IV E. V 13. What would be the major product of the following reaction sequence? A. I B. II C. III D. IV E. V 2 i. LDA ii. CHEI De ci II I III IV V 14. Which of the following could be used to...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is mixed with allyl chloride and that product is heated and then hydrolyzed? HO ora III A) I B) II C) III D) IV E) V 59. Which reagent would best serve as the basis for a simple chemical test to distinguish between CH3 ? CH3 and M A) NaOI (12 in NaOH) B) Bry/CCL C) CrO3/H2SO4 D) NaHCO3/H20 E) Ag(NH3)2+ 60. What would be...
plz help
9. What would be the major product of the following reaction? H2O+ CHECCHCH2CH3 + Brz ? CH3 Br OH i OH concen CBH CCHCHCH3 C6H5CcBrCH2CH3 CeHCCHCHCH3 Corsa CH3 CH3 CH3 C. B. A. CeHCBr2CHCH2CH3 məcsidcmen.com m-BrCH CCHCH2CH3 D. CH3 E. CH3 10. What would be the product, C, of the following reaction sequence? OH H307, heat НА COH CH + CH3CH2CH 25 °C (-H,0) i H2, Ni high pressure corporal CHECCHCH2OH CH3 CHCH2CHCH2OH B. CHE CeHCH,CHCH сн. A....
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago