left side compd : phenyl propanoate
Right side compd : Butyl 3-chloro propanoate
Give the systematic (IUPAC) names for these molecules. Oolon,CH, -OCCH2CH3 CH2CH2CO(CH2)3CH3 CV Propyl benzoate methyl 4-methylpentanoate
Give the systematic (IUPAC) names for these molecules. LOCH.CH OCCH2CH3 CH3CH2OCCHCH2CH3 CH3 Propyl benzoate | butyl3-chloropropanoate
Give the systematic (IUPAC) names for these molecules. CH CH thylpropionate entylpropionate Give the systematic (IUPAC) names for these molecules. CH CH thylpropionate entylpropionate
Write the systematic (IUPAC) names for the amines. The names should have the format alkanamine. HỌC-CH-N-CH-CH, systematic (IUPAC) name: NHẠCH, H,C-CH-CH2-CH systematic (IUPAC) name: These compounds are amines. CH3CH2OCCHCH2CH3 CH3 IUPAC name: methyl 4-methylpentanoate A carboxylic acid reacts with water to form a carboxylate ion and H, Ot. Complete the reaction. reaction: CH, CHOHCOOH + H,0 = Write the IUPAC name of the carboxylate ion formed in the reaction. IUPAC name: What is the IUPAC name for the compound shown?...
1. Provide IUPAC names for the following molecules: CH,CH2 Y 2. Draw structures (diagram) from the following names: a) 3-propyl cyclopentene b) (2)-2-bromo-3-methyl-2-heptene 3. Provide a step-by-step mechanism for the following reaction: 4 - t
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
Give the systematic (IUPAC) names for these molecules. -OCCH2CH3 IUPAC name: BI X2 X CH,OCCH2CH2CHCH CH3 IUPAC name: SPECIAL GREEK ALPHABET
Give the systematic (IUPAC) names for these molecules. < Hint боснен, -OCCH2CH3 These molecules are classified as esters. IUPAC name: словолосые см CH3OCCH2CH2CHCH3 CH3 IUPAC name:
Be sure to answer all parts. Give the IUPAC name for the following compound. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3
2). Give the systematic (IUPAC) names of the following alkenes. a. CH2=CH-CH2-CH=CH23. Determine which compounds show cis-trans isomerism. Draw and label the isomers, using both the cis-trans and E-Z nomenclatures where applicable. a. pent-1-ene b. pent-2-ene c. hex-3-ene d. 1,1-dibromopropene e. 1,2-dibromopropene
? What are the systematic (IUPAC) names for the compounds shown? он. H3C systematic (IUPAC) name: B. H3C—CH2-CH-CH2 CH3 OH systematic (IUPAC) name: