Homework Answers
Add Answer to:
can you throughly explain this...
The following compound can become protonated on any of the three...
Can you please explain these throughly!! I will give good rate thank you!! For the next...
Can you please explain these throughly!! I will give good rate
thank you!!
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: 0 0 OH CH3CH2OH F C HCOH HOCF3 HC 0 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking, 4. The following compounds can all...
reactants are in second picture! circled Label your assigned reactants in these acid-base reactions as Lewis...
reactants are in second picture! circled
Label your assigned reactants in these acid-base reactions as Lewis acids (electrophiles) or Lewis bases (nucleophiles) 2. The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH CH-NH-C NH b. For each resonance structure, give the formal charges on each...
Please just answer part " b". Please explain your ranking based on inductive, electronegativity,resonance stability, size....
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: H, COH HOCF3 HCL-OH CH3CH2OH E C. 1 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking,
1. The molecules PF5 and AsF5 exist, but the analogous molecule NF5 does not. Why not?...
1. The molecules PF5 and AsF5 exist, but the analogous molecule NF5 does not. Why not? 2. For the molecule N2O there are five unique Lewis structures that satisfy the octet rule. Three have the N-N-O bond skeleton and two would have the N-O-N skeleton. a) Draw the five UNIQUE Lewis structures. b) By considering the formal charges, can you suggest which structures could be eliminated due to low stability (i.e. have like charges next to each other). c) Which...
The compound HN2 can exist as two distinct species, one polar and one non-polar. Draw the...
The compound HN2 can exist as two distinct species, one polar and one non-polar. Draw the 3-dimensional geometry of the molecules and give the bond angles. What makes one polar and the other non-polar? Three isomers of N,CO are known one of which has the following structures of this molecule and determine the formal charges on all atoms. Which one do you predict to be the most s atom connectivity, NOCN. Draw the most important resonance Explain why PCh, is...
Which is not a stable molecule ? If you can explain me how to understand if...
Which is not a stable molecule ? If you can explain me how to
understand if it is stable molecule or not , it will be
appreciated
50. The nitrite ion, NO can be represented as a resonance hybrid of two significant Lewis structures. Which statements about this are correct? I. The two resonance structures contribute equally to the Structure. II. The formal charge of nitrogen is zero in both resonance structures. (A) I only (B) II only (C) oth...
Nitromethane structures: Consider nitromethane (CH3NO2). Three reasonable lewis structures (resonance structures) can be drawn for this...
Nitromethane structures:
Consider nitromethane (CH3NO2). Three reasonable lewis structures (resonance structures) can be drawn for this molecule. a. Draw each of the three most reasonable Lewis structures (two of them look almost identical to each other). b. Calculate the formal charges on C, N and O in each of your Lewis structures. c. Give the hybridization on each atom in each resonance structure. d. Will the geometry of the molecule change depending on which resonance structure is the dominant contributor...
For the next problems, your explanation needs to refer to one or more of the following...
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: O HC OH HOCF3unhoOH CH3CH2OH E a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking.
(V) 10pts. When aniline (C6H3-NH2) reacts with bromonium ion (NO2. the nitro group can become bonded...
(V) 10pts. When aniline (C6H3-NH2) reacts with bromonium ion (NO2. the nitro group can become bonded to a carbon at one of the three possible positions: ortho, meta, and para to the -NH2 group in the benzene ring. Consider meta and ortho attack and draw RESONANCE STRUCTURES for the carbocations that result when NO2 undergoes electrophilic aromatic substitution to aniline. Then, on the basis of these resonance structures, explain whether the --NH2, group.is meta director, or ortho/para director. Show which...
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1....
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1. Normally, what is the maximum number of valence electrons possible around an atom? the Lewis dot structure/diagram for the following neutral atoms: C.N.O.S.P. CI 2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O, SO, HONO (N in the middle). SiH.CI CO (C in center).CH..NH. NO,...
Can you please explain these throughly!! I will give good rate
thank you!!
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: 0 0 OH CH3CH2OH F C HCOH HOCF3 HC 0 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking, 4. The following compounds can all...
reactants are in second picture! circled
Label your assigned reactants in these acid-base reactions as Lewis acids (electrophiles) or Lewis bases (nucleophiles) 2. The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH CH-NH-C NH b. For each resonance structure, give the formal charges on each...
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: H, COH HOCF3 HCL-OH CH3CH2OH E C. 1 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking,
The compound HN2 can exist as two distinct species, one polar and one non-polar. Draw the 3-dimensional geometry of the molecules and give the bond angles. What makes one polar and the other non-polar? Three isomers of N,CO are known one of which has the following structures of this molecule and determine the formal charges on all atoms. Which one do you predict to be the most s atom connectivity, NOCN. Draw the most important resonance Explain why PCh, is...
Which is not a stable molecule ? If you can explain me how to
understand if it is stable molecule or not , it will be
appreciated
50. The nitrite ion, NO can be represented as a resonance hybrid of two significant Lewis structures. Which statements about this are correct? I. The two resonance structures contribute equally to the Structure. II. The formal charge of nitrogen is zero in both resonance structures. (A) I only (B) II only (C) oth...
Nitromethane structures:
Consider nitromethane (CH3NO2). Three reasonable lewis structures (resonance structures) can be drawn for this molecule. a. Draw each of the three most reasonable Lewis structures (two of them look almost identical to each other). b. Calculate the formal charges on C, N and O in each of your Lewis structures. c. Give the hybridization on each atom in each resonance structure. d. Will the geometry of the molecule change depending on which resonance structure is the dominant contributor...
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: O HC OH HOCF3unhoOH CH3CH2OH E a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking.
(V) 10pts. When aniline (C6H3-NH2) reacts with bromonium ion (NO2. the nitro group can become bonded to a carbon at one of the three possible positions: ortho, meta, and para to the -NH2 group in the benzene ring. Consider meta and ortho attack and draw RESONANCE STRUCTURES for the carbocations that result when NO2 undergoes electrophilic aromatic substitution to aniline. Then, on the basis of these resonance structures, explain whether the --NH2, group.is meta director, or ortho/para director. Show which...
Chemical Bonding Name Directions: If needed, answer the following on a separate sheet of paper: 1. Normally, what is the maximum number of valence electrons possible around an atom? the Lewis dot structure/diagram for the following neutral atoms: C.N.O.S.P. CI 2. Using the directions from your notes or book, draw a Lewis Structure for the following compounds on separate sheets of paper. Show calculations of valence electrons. O, SO, HONO (N in the middle). SiH.CI CO (C in center).CH..NH. NO,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 9 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 59 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago