Can you please explain these throughly!! I will give good rate thank you!!
Homework Answers
Add Answer to:
Can you please explain these throughly!! I will give good rate
thank you!!
For the next...
Please just answer part " b". Please explain your ranking based on inductive, electronegativity,resonance stability, size....
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: H, COH HOCF3 HCL-OH CH3CH2OH E C. 1 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking,
For the next problems, your explanation needs to refer to one or more of the following...
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: O HC OH HOCF3unhoOH CH3CH2OH E a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking.
can you throughly explain this... The following compound can become protonated on any of the three...
can you throughly explain this...
The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH | CHG-NH-C NH For each resonance structure, give the formal charges on each of the N and on the C with all the N attached. Determine which nitrogen is the most...
lel For the next problems, your explanation needs to refer to one or more of the...
lel For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3 The following compounds can all behave as acids O FaC OH CHCH2OH CF H3C Он но н.с Он For each compound, draw its conjugate base. a. Explain your ranking Rank the acids in order of increasing acidity. b. 4. The following compounds can all behave as hases: NaOH CH CH2OH NANH2 CH CH2NH NH2 For each...
Please just answer part " b". Please explain your ranking based on inductive, electronegativity,resonance stability, size....
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
4. The following compounds can all behave as bases: NANH2 NaOH CHCH,ОН CH3CH2NH2 NH2 For each compound, draw its conjugate acid. a. b. Rank the acids in order of increasing basicity. Explain your ranking.
please answer all the parts The following compounds can all behave as bases: 4. NANH2 NAOH...
please answer all the parts
The following compounds can all behave as bases: 4. NANH2 NAOH CH3CH2OH CH3CH2NH2 NH2 For each compound, draw its conjugate acid. а. Rank the acids in order of increasing basicity. Explain your ranking. b.
reactants are in second picture! circled Label your assigned reactants in these acid-base reactions as Lewis...
reactants are in second picture! circled
Label your assigned reactants in these acid-base reactions as Lewis acids (electrophiles) or Lewis bases (nucleophiles) 2. The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH CH-NH-C NH b. For each resonance structure, give the formal charges on each...
Rank the following acids in order of increasing acid strength when dissolved in water. EXPLAIN your...
Rank the following acids in order of increasing acid strength when dissolved in water. EXPLAIN your ranking using both inductive effect (think about the O atoms) and the stability of the product (draw all the resonances of the product, think about the number of resonances) HMnO4, H3AsO4, H2SO3, H2SO4
1) Predict relative acidity. Rank in order of increasing acidity (be able to explain): a) CH3CH2SO3H,...
1) Predict relative acidity. Rank in order of increasing acidity (be able to explain): a) CH3CH2SO3H, b) CH3CHClCO2H, c) CH3CH2OH, d) ClCH2CH2CO2H, e) CH3CH2CO2H 2) Predict relative acidity. Rank the following in order in increasing acidity: NH3, H2SO4, CH3OH, CH3CO2H, H3O+, H2O Hint: think of what would produce the most stable species after deprotonation. A good acid would gladly lose a proton (to form a stable conjugate base). 3) Predict relative basicity. Rank the following in order in increasing basicity:...
Can you explain how you came upon the answer also 1. Rank the following compounds in...
Can you explain how you came upon the answer also
1. Rank the following compounds in order of increasing stability (least to most stable). As you answer this question, think of why (give reasons) one molecule is more or less stable than another. 2. Predict the MAJOR product(s) for the reaction below. Pay close attention to stereochemistry. Provide a mechanism as to how you arrive with your answer. If your compound is chiral, indicate the configuration [(R) or (S)] of...
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: H, COH HOCF3 HCL-OH CH3CH2OH E C. 1 a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking,
For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3. The following compounds can all behave as acids: O HC OH HOCF3unhoOH CH3CH2OH E a. For each compound, draw its conjugate base. b. Rank the acids in order of increasing acidity. Explain your ranking.
can you throughly explain this...
The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH | CHG-NH-C NH For each resonance structure, give the formal charges on each of the N and on the C with all the N attached. Determine which nitrogen is the most...
lel For the next problems, your explanation needs to refer to one or more of the following factors: inductive, electronegativity, resonance stability, size 3 The following compounds can all behave as acids O FaC OH CHCH2OH CF H3C Он но н.с Он For each compound, draw its conjugate base. a. Explain your ranking Rank the acids in order of increasing acidity. b. 4. The following compounds can all behave as hases: NaOH CH CH2OH NANH2 CH CH2NH NH2 For each...
Please just answer part " b". Please explain your
ranking based on inductive, electronegativity,resonance stability,
size.
4. The following compounds can all behave as bases: NANH2 NaOH CHCH,ОН CH3CH2NH2 NH2 For each compound, draw its conjugate acid. a. b. Rank the acids in order of increasing basicity. Explain your ranking.
please answer all the parts
The following compounds can all behave as bases: 4. NANH2 NAOH CH3CH2OH CH3CH2NH2 NH2 For each compound, draw its conjugate acid. а. Rank the acids in order of increasing basicity. Explain your ranking. b.
reactants are in second picture! circled
Label your assigned reactants in these acid-base reactions as Lewis acids (electrophiles) or Lewis bases (nucleophiles) 2. The following compound can become protonated on any of the three N atoms. However, one of the N is much more basic than the others. a. Draw the molecule with all three N protonated and then draw resonance structures for this protonated molecule. NH CH-NH-C NH b. For each resonance structure, give the formal charges on each...
Can you explain how you came upon the answer also
1. Rank the following compounds in order of increasing stability (least to most stable). As you answer this question, think of why (give reasons) one molecule is more or less stable than another. 2. Predict the MAJOR product(s) for the reaction below. Pay close attention to stereochemistry. Provide a mechanism as to how you arrive with your answer. If your compound is chiral, indicate the configuration [(R) or (S)] of...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 45 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago