Homework Answers
Spectral analysis
The reaction is shown below
Structure of compound X is drawn as needed
IR shows,
N-H stretch at 3300 cm-1
2850-3000 cm-1 for sp3 -C-H stretch
1440 cm-1 for N-H stretch
Mass would show,
M+ at 104
Add Answer to:
nd os a structure for the compound X from the reaction below. 1. ????, CH,NH2 Compound...
Spectroscopy of C5H10O 1. Correctly label 2 peaks in the IR spectrum with the appropriate functional...
Spectroscopy of C5H10O
1. Correctly label 2 peaks in the IR spectrum with the appropriate functional group. 2. Correctly label 1 peak in the 13C NMR spectrum. 3. Draw some possible structures (isomers) as you analyze the 'H NMR spectrum. 4. Draw your final choice of structure to match the IR. 13C NMR, and H NMR 5. Label the different types of hydrogens on your structure as a, b, c, etc. Label the peaks in the 'H NMR spectrum with...
1H-NMR: interpret the spectrum detailing chemical shifts and splittings. draw the structure of the compound and label t...
1H-NMR: interpret the spectrum detailing chemical shifts and
splittings. draw the structure of the compound and label the
hydrogens for the signals.
13C-NMR: draw the structure of the compound and label the
carbons for the signals.
IR: draw the structure of the compound and label functional
groups that are responsible for the stretches.
100 7 90 80 70 60 20 10 0 -10 2500 Wavenumbers (cm-1) 1000 4000 3500 3000 1500 2000 %Transmittance 3075.91 2937.08 2805.05 2736.70 1593.81 1575.40 1508.95...
Provide the correct structure for your unknown based on the spectroscopic data provided. Provide the correct...
Provide the correct structure for your unknown based on the
spectroscopic data provided. Provide the correct name for your
compound. Either the IUPAC name, or a commonly accepted name (i.e.,
ethyl acetate in place of ethyl ethanoate) will be accepted.IR
spectrum: Assign as many peaks as possible. In particular, you
should assign peaks that were important in making your structural
interpretation (i.e. functional group peaks such as OH, C=O, N-H,
etc.).
1H-NMR spectrum: Assign all the peaks in the spectrum...
A compound with molecular formula C7H160 displays the following IR and 'H-NMR spectra. The 13C NMR...
A compound with molecular formula C7H160 displays the following IR and 'H-NMR spectra. The 13C NMR data suggest that there is some symmetry within the molecule. a) Calculate the degrees of unsaturation (DU) for the compound in the space provided below. DU = b) Identify and label the two indicated peaks in the IR spectrum in the boxes provided. Identify and label ALL peaks in the 'H NMR spectrum below. The numbers given on the 'H NMR are integration values...
The mass spectrum of compound A shows molecular ion peak at m/z 88. The IR spectrum...
The mass spectrum of compound A shows molecular ion peak at m/z 88. The IR spectrum of this compound has a broad peak between 3200 and 3550 cm-1. The 1H NMR spectrum of A shows the following peaks: a triplet at d 0.9, a singlet at d 1.1, one more singlet at d 1.15, and a quartet at d 1.6. The area ratio of these peaks is 3:6:1:2. The 13C NMR contains 4 signals. In the space below, propose a...
the first photo has the questions, the second are the H-nmr, C-nmr, and IR. 6. 'H-NMR...
the
first photo has the questions, the second are the H-nmr, C-nmr, and
IR.
6. 'H-NMR spectrum On the proton spectrum, interpretate ACTUAL 1H-NMR data, detailing chemical shifts, integrations, and splittings. Draw the structure of the unknown compound and label hydrogens (a, b, orc, etc...) for which signals. 7. 13C-NMR spectrum Draw the structure of your molecule and label carbons (a, b, or c, etc...) are responsible for which signals. 8. IR spectrum • Draw the structure of your molecule...
Label the significant peaks in the IR and NMR spectra. When analyzing the signals in the 'HNMR, b...
Label the significant peaks in the IR and NMR spectra. When analyzing the signals in the 'HNMR, be sure to include all appropriate information. For example: 3H, singlet, 0 neighbors, and c (the letter referring to the corresponding unique type of hydrogens that were labeled in the structure). It is recommended to provide more analysis for each signal than what is described above, when necessary, such as labeling any coupling constants if any are provided For NMR label each peak...
A compound with molecular formula C H160 displays the following IR and 'H-NMR spectra. The 13C...
A compound with molecular formula C H160 displays the following IR and 'H-NMR spectra. The 13C NMR data suggest that there is some symmetry within the molecule. a) Calculate the degrees of unsaturation (DU) for the compound in the space provided below. DU = b) Identify and label the two indicated peaks in the IR spectrum in the boxes provided. Identify and label ALL peaks in the 'H NMR spectrum below. The numbers given on the 'H NMR are integration...
A compound of unknown structure gave the following spectroscopic data: Mass spectrum: M+ = 88.1 IR:...
A compound of unknown structure gave the following
spectroscopic data:
Mass spectrum: M+ = 88.1
IR: 3600cm-1
1H NMR: 1.4 (2H, quartet, J=7Hz); 1.2 (6H, singlet); 1.0 (1H,
singlet); 0.9 (3H, triplet, J=7Hz)
13C NMR: 74, 35, 27, 25
a. assuming that the compound contains C and H but may or may not
contain O, give three possible molecular formulas.
b. how many protons (H) does the compound contain?
c. what functional group(s) does the compound contain?
d. how many...
4. In Chapter 18 we will learn about the electrophilic aromatic substitution reaction shown below. structure...
4. In Chapter 18 we will learn about the electrophilic aromatic substitution reaction shown below. structure of the product of the reaction based on the data given below Predict the Br2 AlBr3 Product Molecular Formula: CH1302Br Calculate the units of unsaturation-(2C+ N + 2-X-H)/2 where X is any halogen. 13C NMR (ppm): 9.7, 19.9,29.5, 73.6,123.0, 128.9, 129.6,132.0, 132.3,135.9,165.9 List at least one thing you can learn from the 13C NMR data Indicate the functional group and specific bond that each...
Spectroscopy of C5H10O
1. Correctly label 2 peaks in the IR spectrum with the appropriate functional group. 2. Correctly label 1 peak in the 13C NMR spectrum. 3. Draw some possible structures (isomers) as you analyze the 'H NMR spectrum. 4. Draw your final choice of structure to match the IR. 13C NMR, and H NMR 5. Label the different types of hydrogens on your structure as a, b, c, etc. Label the peaks in the 'H NMR spectrum with...
1H-NMR: interpret the spectrum detailing chemical shifts and
splittings. draw the structure of the compound and label the
hydrogens for the signals.
13C-NMR: draw the structure of the compound and label the
carbons for the signals.
IR: draw the structure of the compound and label functional
groups that are responsible for the stretches.
100 7 90 80 70 60 20 10 0 -10 2500 Wavenumbers (cm-1) 1000 4000 3500 3000 1500 2000 %Transmittance 3075.91 2937.08 2805.05 2736.70 1593.81 1575.40 1508.95...
Provide the correct structure for your unknown based on the
spectroscopic data provided. Provide the correct name for your
compound. Either the IUPAC name, or a commonly accepted name (i.e.,
ethyl acetate in place of ethyl ethanoate) will be accepted.IR
spectrum: Assign as many peaks as possible. In particular, you
should assign peaks that were important in making your structural
interpretation (i.e. functional group peaks such as OH, C=O, N-H,
etc.).
1H-NMR spectrum: Assign all the peaks in the spectrum...
A compound with molecular formula C7H160 displays the following IR and 'H-NMR spectra. The 13C NMR data suggest that there is some symmetry within the molecule. a) Calculate the degrees of unsaturation (DU) for the compound in the space provided below. DU = b) Identify and label the two indicated peaks in the IR spectrum in the boxes provided. Identify and label ALL peaks in the 'H NMR spectrum below. The numbers given on the 'H NMR are integration values...
the
first photo has the questions, the second are the H-nmr, C-nmr, and
IR.
6. 'H-NMR spectrum On the proton spectrum, interpretate ACTUAL 1H-NMR data, detailing chemical shifts, integrations, and splittings. Draw the structure of the unknown compound and label hydrogens (a, b, orc, etc...) for which signals. 7. 13C-NMR spectrum Draw the structure of your molecule and label carbons (a, b, or c, etc...) are responsible for which signals. 8. IR spectrum • Draw the structure of your molecule...
Label the significant peaks in the IR and NMR spectra. When analyzing the signals in the 'HNMR, be sure to include all appropriate information. For example: 3H, singlet, 0 neighbors, and c (the letter referring to the corresponding unique type of hydrogens that were labeled in the structure). It is recommended to provide more analysis for each signal than what is described above, when necessary, such as labeling any coupling constants if any are provided For NMR label each peak...
A compound with molecular formula C H160 displays the following IR and 'H-NMR spectra. The 13C NMR data suggest that there is some symmetry within the molecule. a) Calculate the degrees of unsaturation (DU) for the compound in the space provided below. DU = b) Identify and label the two indicated peaks in the IR spectrum in the boxes provided. Identify and label ALL peaks in the 'H NMR spectrum below. The numbers given on the 'H NMR are integration...
A compound of unknown structure gave the following
spectroscopic data:
Mass spectrum: M+ = 88.1
IR: 3600cm-1
1H NMR: 1.4 (2H, quartet, J=7Hz); 1.2 (6H, singlet); 1.0 (1H,
singlet); 0.9 (3H, triplet, J=7Hz)
13C NMR: 74, 35, 27, 25
a. assuming that the compound contains C and H but may or may not
contain O, give three possible molecular formulas.
b. how many protons (H) does the compound contain?
c. what functional group(s) does the compound contain?
d. how many...
4. In Chapter 18 we will learn about the electrophilic aromatic substitution reaction shown below. structure of the product of the reaction based on the data given below Predict the Br2 AlBr3 Product Molecular Formula: CH1302Br Calculate the units of unsaturation-(2C+ N + 2-X-H)/2 where X is any halogen. 13C NMR (ppm): 9.7, 19.9,29.5, 73.6,123.0, 128.9, 129.6,132.0, 132.3,135.9,165.9 List at least one thing you can learn from the 13C NMR data Indicate the functional group and specific bond that each...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 9 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 32 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago