For a parallel reaction A goes to B with rate constant k1 and A goes to...
For a parallel reaction A goes to B with rate constant k1 and A goes to C with rate constant k2, you determine that the activation energies are 38.3 kJ/mol for k1 and 169.3 kJ/mol for k2. If the rate constants are equal at a temperature of 316 K, at what temperature (in K) will k1/k2 = 2?
Homework Answers
Add Answer to:
For a parallel reaction A goes to B with rate constant k1 and A
goes to...
The rate constant of a chemical reaction increased from 0.100 s−1 to 2.80 s−1 upon raising...
The rate constant of a chemical reaction increased from 0.100 s−1 to 2.80 s−1 upon raising the temperature from 25.0∘C to 55.0 ∘C a) Calculate the value of (1/T2−1/T1) where T1 is the initial temperature and T2 is the final temperature. (in K^-1) b)Calculate the value of ln(k1/k2) where k1 and k2 correspond to the rate constants at the initial and the final temperatures as defined in part A. c) What is the activation energy of the reaction? (in kJ/mol)
The rate constant of a chemical reaction increased from 0.100 s−1 to 3.10 s−1 upon raising...
The rate constant of a chemical reaction increased from 0.100 s−1 to 3.10 s−1 upon raising the temperature from 25.0 ∘C to 47.0 ∘C . part A : Calculate the value of (1/T2−1/T1) where T1 is the initial temperature and T2 is the final temperature. = K−1 Part B : Calculate the value of ln(k1/ k2) where k1 and k2 correspond to the rate constants at the initial and the final temperatures as defined in part A. Part C :...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Ea is the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction at two different absolute...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Ea is the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction at two different absolute...
Use the Arrhenius equation to calculate the activation energy. The rate constant of a chemical reaction...
Use the Arrhenius equation to calculate the activation energy. The rate constant of a chemical reaction increased from 0.100 s−1 to 2.70 s−1 upon raising the temperature from 25.0 ∘C to 43.0 ∘C . a) Calculate the value of (1/T2−1/T1) where T1 is the initial temperature and T2 is the final temperature. (in units of k-1) b) Calculate the value of ln(k1/k2) where k1 and k2 correspond to the rate constants at the initial and the final temperatures as defined...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Ea is the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction at two different absolute...
The reaction A ------> B (1) with rate constant, k1= 0.5 min-1 at 400 K is...
The reaction A ------> B (1) with rate constant, k1= 0.5 min-1 at 400 K is to be carried out in an isothermal PFR. However, a second reaction A ----> C (2) with rate constant, k2= 0.1 min-1at 400 K occurs concurrently with reaction (1). The concentration of Ain the feed is CA0= 2 mol dm-3 and the volumetric flow rate of the feed is v0= 4 dm3min-1. (a) Determine the mean residence time, t and the reactor volume, V...
Using the Arrhenius equation to calculate the activation energy. The rate constant of a chemical reaction...
Using the Arrhenius equation to calculate the activation energy. The rate constant of a chemical reaction increased from 0.100s-1 to 2.90s-1 upon raising the temperature from 25 to 45 C (1/t2 -1/t1)= -2.11x10^-4 K-1 Calculate the value of In (k1/k2) where k1 and k2 corresponds to the rate constant at the initial and the final temperature as found above. In(k1/k2)=?? Also, what is the activation energy of the reaction? Expressed in kilojoules per mile Ea=??
Please answer questions 1 and 2 on The rate constant for the reaction answered A +...
Please answer questions 1 and 2
on The rate constant for the reaction answered A + B->C out of 1.0 is 4.1 x104 U(mol s) at 593 K. The activation energy is 101 kj/mol. question Determine the temperature when the rate constant is 1.2 x10-3 L/(mol s)- Answer: 2 One (often inaccurate) rule of thumb in biology is that a 10 °C change increases the rate by a factor of ten. If the lower temperature is 3 °C, what activation...
Learning Goal: To use the Arrhenius equation to calculate the activation energy. As temperature rises, the...
Learning Goal: To use the Arrhenius equation to calculate the activation energy. As temperature rises, the average kinetic energy of molecules increases. In a chemical reaction, this means that a higher percentage of the molecules possess the required activation energy, and the reaction goes faster. This relationship is shown by the Arrhenius equation k=Ae−Ea/RT where k is the rate constant, A is the frequency factor, Ea is the activation energy, R = 8.3145 J/(K⋅mol) is the gas constant, and T...
Please answer questions 1 and 2
on The rate constant for the reaction answered A + B->C out of 1.0 is 4.1 x104 U(mol s) at 593 K. The activation energy is 101 kj/mol. question Determine the temperature when the rate constant is 1.2 x10-3 L/(mol s)- Answer: 2 One (often inaccurate) rule of thumb in biology is that a 10 °C change increases the rate by a factor of ten. If the lower temperature is 3 °C, what activation...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 33 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago