![7. If AGfor the reaction A(aq) + 3B(aq) - 2C(aq) + D(aq) is equal to-43.85 kJ, what is AG at 350 K IF(A=0.12 M. [B]=0.38 M, a](http://img.homeworklib.com/questions/b9309720-d5e5-11ea-a19a-cbbc4bd06d51.png?x-oss-process=image/resize,w_560)
Homework Answers
![9 Given 19:= -43.85 Kg . · Acaq.) + 3B(aq) → 2014g.) + Dla9.) Keq = [<][0]. Cosu?x10.54) - LAJ[3] 10.12) x 0-38*0.38 9.23 0.](http://img.homeworklib.com/questions/bb1d2700-d5e5-11ea-af1d-c95980fe81e7.png?x-oss-process=image/resize,w_560)
Add Answer to:
7. If AGfor the reaction A(aq) + 3B(aq) - 2C(aq) + D(aq) is equal to-43.85 kJ,...
Balance each redox reaction occurring in acidic aqueous solution. a. PbO2(s) + (aq) Pb2+(aq) + 12(s)...
Balance each redox reaction occurring in acidic aqueous solution. a. PbO2(s) + (aq) Pb2+(aq) + 12(s) b. SO32-(aq) + MnO4 (aq) — 3042-(aq) + Mn²+(aq) c. S2032-(aq) + Cl2(g) 8042-(aq) + Cl²(aq)
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the...
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the standard cell potential of this cell from the standard electrode potentials, and from this, obtain AG" for the cell reaction. Calculate AF. Use these values of AN and AG to obtain AS for the cell reaction. Ca²+ (aq) +20 + Ca() --2.76 V Cu? (g) +20 + Cu(s) - 0.84 V AH;(O.*()) -- 542.8 kJ/mol AH;(Out (as)) - 64.8 kJ/mol V AG- AH- kJ...
use the example to answer 8,9,10&11 Here's an example: Balance the following redox reaction, which occurs...
use the example to answer
8,9,10&11
Here's an example: Balance the following redox reaction, which occurs in acidic solution: Fe (aq)+ MnO4'(aq) -Fe (aq) + Mn (aq) Solution: +2 +7 +3 Step 1) +2 Fe2 (aq)+ MnOa (aq) Fe(aq) + Mn2 (aq) Fe (aq) MnO4 (aq) Mn2 (aq) 1 Fe on each side; 1 Mn on each side; no adjustment necessary Fe2 (aq) Fe 3'(aq) + e 5 e + MnO4(aq) Fe (aq) Fe (aq) + e (2+ on each...
Write the equilibrium-constant expression for the reaction A(s)+3B(l)<------->2C(aq)+D(aq) in terms of [A], [B], [C], and [D]...
Write the equilibrium-constant expression for the reaction A(s)+3B(l)<------->2C(aq)+D(aq) in terms of [A], [B], [C], and [D] as needed. Kc=? *Kc, which is sometimes symbolized as Keq, denotes that the equilibrium constant is expressed using molar concentrations. For this question, Kc means the same thing as Keq.
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for...
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for the dissociation of As.CO, (s) + 2 Ag+CO, isk=8.1 10-at 25°C. a) Calculate AG for the reaction when Agtl -1.0 x 102 M and CO, 9-10 x 10 M. (4pts) Ans: b) (pt) is the reaction spontaneous or onspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; INOCHE 2NO(g) + Calculate K, for this...
17) Determine the oxidizing agent in the following reaction. Ni(s) + 2 AgClO4(aq) → Ni(ClO4)2(aq) +...
17) Determine the oxidizing agent in the following reaction. Ni(s) + 2 AgClO4(aq) → Ni(ClO4)2(aq) + 2 Ag(s) A) Ag B) Ni C) CI D) O E) This is not an oxidation-reduction reaction. 18) When an aqueous solution of manganese (II) nitrate is combined with an aqueous solution of ammonium sulfide, what should precipitate out? A) Mns B) Mn(SO3)2 C) Mn(SO4)2 D) Mn 2503 E) Mn 2504 19) If 4.89 g of ZnCl2 is dissolved in enough water to give a total...
1. A voltaic cell is constructed based on the following redox reaction: Sn2+ (aq) + Mn...
1. A voltaic cell is constructed based on the following redox reaction: Sn2+ (aq) + Mn (s)àSn (s) + Mn2+ (aq) Calculate Ecell at 25 oC under the following conditions: (a) Standard conditions (b) [Sn2+] = 0.0200 M; [Mn2+] = 4.00 M (c) [Sn2+] = 0.500 M; [Mn2+] = 0.00250 M 2. Consider the following redox reaction at 25oC: MnO2 (s)àMn2+ (aq) + MnO4- (aq) (a) Balance the equation in acid (b) Calculate Eocell (c) CalculateDGorxn (d) Calculate K Hint!!!...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a)...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a) Write the equilibrium constant expression b) Would the reaction shift toward the products or reactants if the volume of the sealed react container was suddenly doubled? Would the reaction shift toward the products or reactants if the temperature was increase d) Would the reaction shift toward the products or reactants if more A was added? e) Would the value of K change in any...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a)...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a) Write the equilibrium constant expression b) Would the reaction shift toward the products or reactants if the volume of the sealed react container was suddenly doubled? Would the reaction shift toward the products or reactants if the temperature was increased di Would the reaction shift toward the products or reactants if more A was added? e) Would the value of K change in any...
For reaction 2A + 3B → 2C + D, following data of concentration and rate was...
For reaction 2A + 3B → 2C + D, following data of concentration and rate was obtained Trial Initial [A] Initial [B] Initial Rate (M/sec) 1 0.015 M 0.200 M 3.67 x 10^-6 20.030 M 0.200 M 7.33 x 10^-6 30.015 M 0.400 M 1.47 x 10^-5 The special rate constant k = A 1.2 x 10^-3 (1/M.sec) 9.2 x 10^-4 (1/M-sec) C 1.6 x 10^-3 (1/M-sec) 6.1 x 10^-3 (1/M^2-sec) E 8.2 x 10^-3 (1/M^2-sec)
Balance each redox reaction occurring in acidic aqueous solution. a. PbO2(s) + (aq) Pb2+(aq) + 12(s) b. SO32-(aq) + MnO4 (aq) — 3042-(aq) + Mn²+(aq) c. S2032-(aq) + Cl2(g) 8042-(aq) + Cl²(aq)
Consider the following cell reaction at 18°C: Ca(e)+Cu+ (aq) + Ca2+ (aq) + Cu() Calculate the standard cell potential of this cell from the standard electrode potentials, and from this, obtain AG" for the cell reaction. Calculate AF. Use these values of AN and AG to obtain AS for the cell reaction. Ca²+ (aq) +20 + Ca() --2.76 V Cu? (g) +20 + Cu(s) - 0.84 V AH;(O.*()) -- 542.8 kJ/mol AH;(Out (as)) - 64.8 kJ/mol V AG- AH- kJ...
use the example to answer
8,9,10&11
Here's an example: Balance the following redox reaction, which occurs in acidic solution: Fe (aq)+ MnO4'(aq) -Fe (aq) + Mn (aq) Solution: +2 +7 +3 Step 1) +2 Fe2 (aq)+ MnOa (aq) Fe(aq) + Mn2 (aq) Fe (aq) MnO4 (aq) Mn2 (aq) 1 Fe on each side; 1 Mn on each side; no adjustment necessary Fe2 (aq) Fe 3'(aq) + e 5 e + MnO4(aq) Fe (aq) Fe (aq) + e (2+ on each...
1. (3pts.) Complete and balance the nuclear equation in+U - Br+3n+ 2. The equilibrium constant for the dissociation of As.CO, (s) + 2 Ag+CO, isk=8.1 10-at 25°C. a) Calculate AG for the reaction when Agtl -1.0 x 102 M and CO, 9-10 x 10 M. (4pts) Ans: b) (pt) is the reaction spontaneous or onspontaneous at these concentrations? Ans: 3. (4pts) Nitrosyl chloride (NOCI) decomposes at elevated temperatures according to the equation below; INOCHE 2NO(g) + Calculate K, for this...
17) Determine the oxidizing agent in the following reaction. Ni(s) + 2 AgClO4(aq) → Ni(ClO4)2(aq) + 2 Ag(s) A) Ag B) Ni C) CI D) O E) This is not an oxidation-reduction reaction. 18) When an aqueous solution of manganese (II) nitrate is combined with an aqueous solution of ammonium sulfide, what should precipitate out? A) Mns B) Mn(SO3)2 C) Mn(SO4)2 D) Mn 2503 E) Mn 2504 19) If 4.89 g of ZnCl2 is dissolved in enough water to give a total...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a) Write the equilibrium constant expression b) Would the reaction shift toward the products or reactants if the volume of the sealed react container was suddenly doubled? Would the reaction shift toward the products or reactants if the temperature was increase d) Would the reaction shift toward the products or reactants if more A was added? e) Would the value of K change in any...
A (1) +3B (g) + 2 (aq) + 4D(g) + 7E(s) AH = 25 kJ/mole a) Write the equilibrium constant expression b) Would the reaction shift toward the products or reactants if the volume of the sealed react container was suddenly doubled? Would the reaction shift toward the products or reactants if the temperature was increased di Would the reaction shift toward the products or reactants if more A was added? e) Would the value of K change in any...
For reaction 2A + 3B → 2C + D, following data of concentration and rate was obtained Trial Initial [A] Initial [B] Initial Rate (M/sec) 1 0.015 M 0.200 M 3.67 x 10^-6 20.030 M 0.200 M 7.33 x 10^-6 30.015 M 0.400 M 1.47 x 10^-5 The special rate constant k = A 1.2 x 10^-3 (1/M.sec) 9.2 x 10^-4 (1/M-sec) C 1.6 x 10^-3 (1/M-sec) 6.1 x 10^-3 (1/M^2-sec) E 8.2 x 10^-3 (1/M^2-sec)
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 12 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 43 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago