Homework Answers
Initial mass of substance 
Half life of substance 
Time taken 
Amount of substance left after 100 years is 0.977 grams
Add Answer to:
3 pts It is handy to have an equation to quickly determine the number of atoms...
The number of grams A of a certain radioactive substance present at time, in years from...
The number of grams A of a certain radioactive substance present at time, in years from the present, t is given by the formula A=45e^-0.0045t What is initial amount of this substance What is half-life of this substance How much will be around in 2500 years
1. [T] (4) Determine the equation of the tangent to the curve y = e-* at...
1. [T] (4) Determine the equation of the tangent to the curve y = e-* at the point where x =-1. 2. [A] (4) A certain radioactive material decays exponentially. The percent, P, of the material left after t years is given by P(t) = 100(1.2)-! a. Determine the half-life of the substance. b. How fast is the substance decaying at the point where the half-life is reached?
h= half life a0 = original amount a(t) = amount present after t years t =...
h= half life
a0 = original amount
a(t) = amount present after t years
t = time
What information do you need?
TH 100 - D100 Use equation : acca un Page 4 of 5 4. Suppose we have Xo amount of a certain radioactive substance. It has been observed that this substance losses 5% of its mass every 10 years. @ How much of the initial mass Xo remains after 10 years? What about 20 years? (b) Use the...
If a radioactive isotope has half-life h, then the number of atoms in a sample is...
If a radioactive isotope has half-life h, then the number of atoms in a sample is given by a(t)=a-2-/h where ao gives the number of atoms in the sample at time 0. The radio active decay of carbon-14 leads to clever way of determining the age of fossils and remnants of plants and animals. When an organism dies, the radioactive carbon- 14 in it decays, with half of it gone in 5,730 years. a. Suppose a mummified cat has a...
Review | Constants Periodic Table In the parts that follow, use the following abbreviations for time...
Review | Constants Periodic Table In the parts that follow, use the following abbreviations for time If a substance is radioactive, this means that the nucleus is unstable and will therefore decay by any number of processes (alpha decay, beta decay, etc.). The decay of radioactive elements follows first-order kinetics. Therefore, the rate of decay can be described by the same integrated rate equations and half-life equations that are used to describe the rate of first-order chemical reactions: Measure of...
Review Constants Periodic a substance active times that the countable and will therefore decay by my...
Review Constants Periodic a substance active times that the countable and will therefore decay by my name of processes the decay Del decay of the day of radioactive comm o der Therefore theme of daycan t orbed by the megrated w omen e n we used to describe the food chemical con In where the mo s t coloraty t he com by man of these quo ng 0. the world when contre long for fraction remaining - - (0.5)"...
dy 1.A. Solve the differential equation: = = y2ex dx dy B. Solve the initial value...
dy 1.A. Solve the differential equation: = = y2ex dx dy B. Solve the initial value problem: + 2y = 3x2 ; y(0) = 1 dx C.A certain radioactive substance has a half life of 1300 years. Assume an amount yo was initially present. a.Find a formula for the amount of radioactive substance present at any time t. b.In how many years will only 1/10 of the original amount remain?
1) Carbon-14 is formed as the decay product of Nitrogen-15, which was formed when a cosmic...
1) Carbon-14 is formed as the decay product of Nitrogen-15, which was formed when a cosmic ray bombards the N-15. What is the particle equivalent of the cosmic ray involved in this decay process? 2) Carbon-14 get locked in organic material through this process. 3) How many half-lives of Carbon-14 decay will leave behind approximately 1/8 of the original mass of Carbon-14? 4) Using the equation for radioactive decay, if you start with one gram of radioactive substance that has...
need help with these two questions. Question 5 (1 point) Willmonite-35 is a newly found radioactive substance with...
need help with these two questions.
Question 5 (1 point) Willmonite-35 is a newly found radioactive substance with a half life of 450 years. How much of 14,000 grams of Willmonite-35 will be left after 180 years? Round to the nearest gram. Your Answer: Answer Question 6 (1 point) A 5.5-volt battery is connected to a series in which the inductance is 0.25 henry and the resistance is 8 ohms. Determine the current after 1 second if the initial current...
A radioactive substance has a half-life of 17.33 years. Use the formula n(t) = n0e^ −kt...
A radioactive substance has a half-life of 17.33 years. Use the formula n(t) = n0e^ −kt which tells you how much is left at time t > 0 to find how much of a 20-gm sample would remain one hundred years after it is collected. Round your answer to the nearest two decimal places.
1. [T] (4) Determine the equation of the tangent to the curve y = e-* at the point where x =-1. 2. [A] (4) A certain radioactive material decays exponentially. The percent, P, of the material left after t years is given by P(t) = 100(1.2)-! a. Determine the half-life of the substance. b. How fast is the substance decaying at the point where the half-life is reached?
h= half life
a0 = original amount
a(t) = amount present after t years
t = time
What information do you need?
TH 100 - D100 Use equation : acca un Page 4 of 5 4. Suppose we have Xo amount of a certain radioactive substance. It has been observed that this substance losses 5% of its mass every 10 years. @ How much of the initial mass Xo remains after 10 years? What about 20 years? (b) Use the...
If a radioactive isotope has half-life h, then the number of atoms in a sample is given by a(t)=a-2-/h where ao gives the number of atoms in the sample at time 0. The radio active decay of carbon-14 leads to clever way of determining the age of fossils and remnants of plants and animals. When an organism dies, the radioactive carbon- 14 in it decays, with half of it gone in 5,730 years. a. Suppose a mummified cat has a...
Review | Constants Periodic Table In the parts that follow, use the following abbreviations for time If a substance is radioactive, this means that the nucleus is unstable and will therefore decay by any number of processes (alpha decay, beta decay, etc.). The decay of radioactive elements follows first-order kinetics. Therefore, the rate of decay can be described by the same integrated rate equations and half-life equations that are used to describe the rate of first-order chemical reactions: Measure of...
Review Constants Periodic a substance active times that the countable and will therefore decay by my name of processes the decay Del decay of the day of radioactive comm o der Therefore theme of daycan t orbed by the megrated w omen e n we used to describe the food chemical con In where the mo s t coloraty t he com by man of these quo ng 0. the world when contre long for fraction remaining - - (0.5)"...
dy 1.A. Solve the differential equation: = = y2ex dx dy B. Solve the initial value problem: + 2y = 3x2 ; y(0) = 1 dx C.A certain radioactive substance has a half life of 1300 years. Assume an amount yo was initially present. a.Find a formula for the amount of radioactive substance present at any time t. b.In how many years will only 1/10 of the original amount remain?
need help with these two questions.
Question 5 (1 point) Willmonite-35 is a newly found radioactive substance with a half life of 450 years. How much of 14,000 grams of Willmonite-35 will be left after 180 years? Round to the nearest gram. Your Answer: Answer Question 6 (1 point) A 5.5-volt battery is connected to a series in which the inductance is 0.25 henry and the resistance is 8 ohms. Determine the current after 1 second if the initial current...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 1 minute ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago