Homework Answers
1. The Correct option is : C. +82.6°
2. The Correct option is : A. Decrease to one-fourth the Original Rate
3. The Correct option is : D. Reaction 3 and 5
4. The Correct option is : C.
5. The Correct option is : A. a Nucleophile in an SN1 Reaction.
6. The Correct option is : D. Racemic 3-methoxy-3-methylhexane
As experts we're allowed to answer only the first 4 parts of a single question. But I've answered all the parts of your question for your convenience. So, please don't post more than 4 parts in a single question next time. Thank You.
Add Answer to:
3. Which of the reactions proceeded predominantly by the Si substitution mechanism? Passage 10 (Questions 1-6)...
Predict the substitution product(s) for each of the following reactions and mechanisms by which they are...
Predict the substitution product(s) for each of the following reactions and mechanisms by which they are formed. If no reaction is expected, write no (a) (R)-2-bromobutane with sodium iodide in acetone (b) (R)-3-bromo-3-methylhexane with H20 (c) trans-1-bromo-2-ethylcyclopentane with potassium ethoxide in ethanol (d) trans-1-bromo-3-methylcyclopentane with Nal in acetone 5. For the following set of compounds, predict the order of reactivity with sodium iodide in acetone solution (list them in increasing order of reactivity). C. D. 2-bromobutane 1-chlorobutane 2-chloro-3-methylbutane 2-bromo-2-methylpropane 1-bromobutane...
For the chemical reaction answer the following questions: 1. Is the mechanism Sn1 or Sn2? 2....
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
Chem 233 Exam III (A) October 28, 2019 Page 7 14. Which of the following would...
Chem 233 Exam III (A) October 28, 2019 Page 7 14. Which of the following would an of the following would be the best base for performing the following elimination? A KOCHA B. KOCH(CH) C. KOC(CH.) D. this reaction is not an elimination reaction 15. Which of the following statements is (are) true of Sul reactions of alkyl halides in general? A) The rate of an SNI reaction depends on the concentration of the alkyl halide. B) The rate of...
Name: 5. Identify the correct statement for the given reactions given. - Reaction A Reaction B...
Name: 5. Identify the correct statement for the given reactions given. - Reaction A Reaction B Room Temp. CH, a. Reaction A is an allylic halogenation reaction, and reaction B is an electrophilic addition reaction. b. Reaction A is an electrophilic addition reaction, and reaction B is an allylic substitution reaction. c. Reactions A and B are allylic substitution reactions. d. Reaction A is a displacement reaction, and reaction B is an allylic halogenation reaction. 6. The reaction of methyl...
answer all 1. In each of the following, indicate which S2 reaction will occur faster. Explain...
answer all
1. In each of the following, indicate which S2 reaction will occur faster. Explain your reasoning. a. 1-bromo-2,2-dimethylpropane or 1-bromo-3-methylbutane with Nal in DMSO. b. 1-iodopentane with NaN, in ethanol or NaSCH, in ethanol, c. Reaction of isobutyl iodide with NaBr in acetone or in ethanol. 2. In each of the following, indicate which S, 1 reaction will occur faster. Explain your reasoning. a. Reaction of I-chloro-1-methylcyclohexane or 1-chloro-2-methylcyclohexane in aqueous ethanol. b. Reaction of 2-chloropentane or 3-bromohexane...
Part 2 Multiple Choice. Select the best answer for each of the questions below: 1. Which...
Part 2 Multiple Choice. Select the best answer for each of the questions below: 1. Which of these molecules is not an electrophile? a) CH4 b) CH3+ c) H* d) BF3 2. Which of these molecules is not a nucleophile ? a) NH3 b) OH c) CN d) H* 3. Water behaves as: a) a nucleophile b) an electrophile c) both d) neither 4. The SN2 reaction has how many steps? a) 1 b) 2 c) 3 d) 4 5....
organic chemistry Introduction to Sul and 52 Reactions Alkyl Halides, RX, can undergo substitution reaction. These...
organic chemistry
Introduction to Sul and 52 Reactions Alkyl Halides, RX, can undergo substitution reaction. These reactions are described as a reaction between an electrophile and a nucleophile. The generk equation for these reactions Nu + R-X - - R-Nu + X 2. Merent rate laws and mechanisms describe There are two types of substitution reactions, Seland them. 5.1 Unimolecular substitution reaction ratek [RXI 52 Bimolecular Substitution reaction ratek TRXIN] Mechanisms L Complete the 5.2 reaction by adding the curved...
CHEM 2123/Pre-Lab Study Questions /Exp. #6 Reactivities of Alkyl Halides in Nucleophilic Subs. Reactions Amonda salas...
CHEM 2123/Pre-Lab Study Questions /Exp. #6 Reactivities of Alkyl Halides in Nucleophilic Subs. Reactions Amonda salas Name 1. Classify the following substrates as 1°, 2, 3, aryl, allylic, or benzy lic: CH OCH CHB сна 2. Identify the substrate, nucleophile/base, and the leaving group in the following reactions and indicate the type of reaction (i.e. SN1, SN2, EI, E2) taking place: Br Nal Accionc H.с н.с Нас, CH,OH HEAT сH,он CH-Br Н-о CH CHs CH,CH-ONa HEAT Нс CH3 3. Rank...
(R)–3-chloro-2-methylhexane may undergo a nucleophilic substitution reaction in the presence of sodium ethoxide and ethanol. Complete...
(R)–3-chloro-2-methylhexane may undergo a nucleophilic
substitution reaction in the presence of sodium ethoxide and
ethanol. Complete the mechanism and draw the products of the
reaction.
<Chapter 7 SN2 and E2 Reactions of Alkyl Halides DOCH: FU MacBook Air
Predict the substitution product(s) for each of the following reactions and mechanisms by which they are formed. If no reaction is expected, write no (a) (R)-2-bromobutane with sodium iodide in acetone (b) (R)-3-bromo-3-methylhexane with H20 (c) trans-1-bromo-2-ethylcyclopentane with potassium ethoxide in ethanol (d) trans-1-bromo-3-methylcyclopentane with Nal in acetone 5. For the following set of compounds, predict the order of reactivity with sodium iodide in acetone solution (list them in increasing order of reactivity). C. D. 2-bromobutane 1-chlorobutane 2-chloro-3-methylbutane 2-bromo-2-methylpropane 1-bromobutane...
For the chemical reaction answer the following questions:
1. Is the mechanism Sn1 or Sn2?
2. What kind of substrate reacts in the following reaction? (2 °
, 2 ° allylic , 3 ° )
3. Is the role of the alkyl halide reactant an acid, base,
electrophile, nucleophile , or both a nucleophile and base?
4. Is the role of the reagent KI an acid, base, electrophile,
nucleophile , or both a nucleophile and base?
5. What is the...
Chem 233 Exam III (A) October 28, 2019 Page 7 14. Which of the following would an of the following would be the best base for performing the following elimination? A KOCHA B. KOCH(CH) C. KOC(CH.) D. this reaction is not an elimination reaction 15. Which of the following statements is (are) true of Sul reactions of alkyl halides in general? A) The rate of an SNI reaction depends on the concentration of the alkyl halide. B) The rate of...
Name: 5. Identify the correct statement for the given reactions given. - Reaction A Reaction B Room Temp. CH, a. Reaction A is an allylic halogenation reaction, and reaction B is an electrophilic addition reaction. b. Reaction A is an electrophilic addition reaction, and reaction B is an allylic substitution reaction. c. Reactions A and B are allylic substitution reactions. d. Reaction A is a displacement reaction, and reaction B is an allylic halogenation reaction. 6. The reaction of methyl...
answer all
1. In each of the following, indicate which S2 reaction will occur faster. Explain your reasoning. a. 1-bromo-2,2-dimethylpropane or 1-bromo-3-methylbutane with Nal in DMSO. b. 1-iodopentane with NaN, in ethanol or NaSCH, in ethanol, c. Reaction of isobutyl iodide with NaBr in acetone or in ethanol. 2. In each of the following, indicate which S, 1 reaction will occur faster. Explain your reasoning. a. Reaction of I-chloro-1-methylcyclohexane or 1-chloro-2-methylcyclohexane in aqueous ethanol. b. Reaction of 2-chloropentane or 3-bromohexane...
Part 2 Multiple Choice. Select the best answer for each of the questions below: 1. Which of these molecules is not an electrophile? a) CH4 b) CH3+ c) H* d) BF3 2. Which of these molecules is not a nucleophile ? a) NH3 b) OH c) CN d) H* 3. Water behaves as: a) a nucleophile b) an electrophile c) both d) neither 4. The SN2 reaction has how many steps? a) 1 b) 2 c) 3 d) 4 5....
organic chemistry
Introduction to Sul and 52 Reactions Alkyl Halides, RX, can undergo substitution reaction. These reactions are described as a reaction between an electrophile and a nucleophile. The generk equation for these reactions Nu + R-X - - R-Nu + X 2. Merent rate laws and mechanisms describe There are two types of substitution reactions, Seland them. 5.1 Unimolecular substitution reaction ratek [RXI 52 Bimolecular Substitution reaction ratek TRXIN] Mechanisms L Complete the 5.2 reaction by adding the curved...
CHEM 2123/Pre-Lab Study Questions /Exp. #6 Reactivities of Alkyl Halides in Nucleophilic Subs. Reactions Amonda salas Name 1. Classify the following substrates as 1°, 2, 3, aryl, allylic, or benzy lic: CH OCH CHB сна 2. Identify the substrate, nucleophile/base, and the leaving group in the following reactions and indicate the type of reaction (i.e. SN1, SN2, EI, E2) taking place: Br Nal Accionc H.с н.с Нас, CH,OH HEAT сH,он CH-Br Н-о CH CHs CH,CH-ONa HEAT Нс CH3 3. Rank...
(R)–3-chloro-2-methylhexane may undergo a nucleophilic
substitution reaction in the presence of sodium ethoxide and
ethanol. Complete the mechanism and draw the products of the
reaction.
<Chapter 7 SN2 and E2 Reactions of Alkyl Halides DOCH: FU MacBook Air
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago