We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Question 22 (2 points) What is the name of the following structure? H CH2CH3 C=C 1...
Give the IUPAC name for the following compound
H H₃G CH3 도 H CH2CH3 CH(CH3)2 I
IUPAC Nomenclature 4.39 Give the IUPAC name for each compound. h. tyn my 1. -CH(CH2CH3)2 i. a. CH3CH2CHCH2CHCH2CH2CH3 CH3 CH2CH3 CH2CH3 CH3 b. CH3CH2CCH_CH2CHCHCH2CH2CH3 CH2CH3 CH2CH3 C. CH3CH,CH,C(CH3)2C(CH3)2CH2CH3 d. CH3CH2C(CH2CH3)2CH(CH3)CH(CH2CH2CH3)2 e. (CH3CH2),CCH(CH3)CH2CH2CH3 f. CH3CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)3CH3 g. (CH2CH2CH2)4C more on mo .
Please Help!!
QUESTION 1 What is the IUPAC name for this compound? CH3 CH3CH2 QUESTION 2 What is the IUPAC name for this compound? CH2CH3 QUESTION 3 What is the IUPAC name for this compound? снэ HE
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
help I need this before 11 pm
QUESTION 1 What is the IUPAC name for this compound? CH,CH= CHCH2CH2CH2CH, QUESTION 2 What is the IUPAC name for this compound? H3 CH2CH3 QUESTION 3 What is the IUPAC name for this compound? CHE CH3CH2CH2CCH CHE CHCH, QUESTION 4 What is the IUPAC name for this compound? CH3 CH3 QUESTION 5 Which of the following is NOT a type of unsaturated compound? O alkene O alkyne O aromatic O alkane
Question 5 Which structure below is a tertiary amine? (CH3CH2)3CNHCH2CH3 (CH3)3CHNH2 CH3CH2NHCH(CH3)2 CH3CH2N(CH3)CH2CH3 Question 6 What is the IUPAC name of CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH3? 4-isopropyl-2,2-dimethyheptane 2,2,3,4-tetramethylheptane 4-ethyl-2,2-dimethylheptane 2,2,4-trimethyloctane
12. What is the correct IUPAC name of the following compound? CH2CH3 CH3 B. cis-1-ethyl-2-methylcyclohexane trans-1-ethyl-2-methylcyclohexane cis-1-ethyl-6-methylcyclohexane trans-1-ethyl-6-methylcyclohexane
A-
B-
C-
D-
What is the correct name of the following? H_F _HH H-C- C C -C-H H H C=C H H H Ocis-3-hexene 4-methyl-2-pentyne 4-methyl-1-pentene 3-hexyne 3-methylpentane What is the correct name of the following? CH3-CH2-O-CH2-CH2 – CH2 CH3 1-methoxypropane 1-ethoxypropane 1-ethoxybutane What is the correct IUPAC name for the following structure: ОН What is the correct IUPAC name for the following structure: NH,
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene