Homework Answers
Option A is the correct answer because liquids have surface tension , in which force acts perpendicularly....As a result , liquids wants to occupy minimum surface area and thus formed spherical shapes.....
Please like and support...
Add Answer to:
Why does a drop of medicine form a teardrop when there are no forces acting on...
why does a precipitate form when a drop of 0.6 M HCL is added to a...
why does a precipitate form when a drop of 0.6 M HCL is added to a solution of 0.1 M potassium iodide and 0.2 M potassium iodate?
9. (4 pts.) When refluxing, a mixture of toluene and water is refluxing and condensing in...
9. (4 pts.) When refluxing, a mixture of toluene and water is refluxing and condensing in the Hickman still head. A specific mixture of toluene and water will actually boil at a LOWER TEMPERATURE then either pure toluene or pure water. This is the azeotrope mixture, toluene and water can from an azeotrope. The practical consequence of this is that the toluene solvent will always have at least some water in it when it boils, which is how we are...
Spreading forces over surfaces I. Block that floats when released A cubical block is observed to...
Spreading forces over surfaces I. Block that floats when released A cubical block is observed to float in a beaker of water. The block is then held near the center of the beaker as shown and released. A. Describe the motion of the block after it is released. Lab section B. Draw a free-body diagram for the block at the instant that it is Free-body diagram for block at instant it is released released. Rather than drawing a single force...
explain why Name: when an On which of the following does the buoyant force on an...
explain why
Name: when an On which of the following does the buoyant force on an object floating on the surface of a liquid most directly depend? Choose 1 answer @ viscosity of the liquid volume of the object © density of the liquid O mass of the liquid
Explain why each change in conditions would affect the reaction rate of reaction when sodium metal...
Explain why each change in conditions would affect the reaction rate of reaction when sodium metal reacts with chlorine gas to form NaCl? As a catalyst is added to the mixture the reaction rate will increase because As temperature decreases the reaction rate will decrease because As volume decreases the reaction rate will increase because As concentration increases the reaction rate will increase because As the surface area of a molecule is decreased the reaction rate will decrease because As...
ntatinn of ave Effervescence: A mineral may react (fizz) when a drop of weak hydrochloric acid is placed on it...
ntatinn of ave Effervescence: A mineral may react (fizz) when a drop of weak hydrochloric acid is placed on its surface Habit: Characteristic form in which the mineral grows. Related to crystal structure. What would you use a streak plate for? How soft does a mineral have to be for you to scratch it with your fingernail? How hard does a mineral have to be for it to scratch a glass plate? Describe the difference between cleavage and fracture. Why...
Explain why each change in conditions would affect the reaction rate of reaction when sodium metal...
Explain why each change in conditions would affect the reaction rate of reaction when sodium metal reacts with chlorine gas to form NaCl? As volume increases the reaction rate will decrease because ? As concentration increases the reaction rate will increase because? As the surface area of a molecule is increased the reaction rate will increase because? As temperature decreases the reaction rate will decrease because? As pressure decreases the reaction rate will decrease because? As a catalyst is added...
Question 1 1 pts When acetic acid and sodium bicarbonate react, why does the total mass...
Question 1 1 pts When acetic acid and sodium bicarbonate react, why does the total mass decrease? the bubbling of the reaction mixture always causes spattering of the sodium bicarbonate which causes the overall mass to decrease. O a gas is released in the reaction so it's mass is not part of the reaction mixture after the reaction is complete some of the acetic acid gets consumed in the reaction which causes the overall mass to decrease the total mass...
i got 1.4 but it was incorrect and i am not sure why. Please help! READING 2 Materials fracture when the force per unit area, called STRESS, exceeds a critical value. In general, the critical stress...
i got 1.4 but it was incorrect
and i am not sure why. Please help!
READING 2 Materials fracture when the force per unit area, called STRESS, exceeds a critical value. In general, the critical stress depends on the direction as well as the magnitude of the force. For example, bones break differently when subjected to torsional (twisting) stress than when subjected to compressional (or squeezing) stress. Let us consider compressional stress. Wet human bone for 20-39 year olds has...
Lab Exercise 3A Discuss why you think cells would evolve to have a certain shape. Think...
Lab Exercise 3A Discuss why you think cells would evolve to have a certain shape. Think about tf cells that you looked at earlier with shapes other than a sphere or cube. How doy think a shape other than spherical or cuboidal could help speed up difusion acros 2) the plasma membrane? OSMOSIS ANI QUESTION: CAN THE TONICITY DETERMINED EXPERIMENTALL 3) Mature red blood cells (RBCs) do not have a nucleus, which changes its shape from spherica OBJECTIVES I to...
9. (4 pts.) When refluxing, a mixture of toluene and water is refluxing and condensing in the Hickman still head. A specific mixture of toluene and water will actually boil at a LOWER TEMPERATURE then either pure toluene or pure water. This is the azeotrope mixture, toluene and water can from an azeotrope. The practical consequence of this is that the toluene solvent will always have at least some water in it when it boils, which is how we are...
Spreading forces over surfaces I. Block that floats when released A cubical block is observed to float in a beaker of water. The block is then held near the center of the beaker as shown and released. A. Describe the motion of the block after it is released. Lab section B. Draw a free-body diagram for the block at the instant that it is Free-body diagram for block at instant it is released released. Rather than drawing a single force...
explain why
Name: when an On which of the following does the buoyant force on an object floating on the surface of a liquid most directly depend? Choose 1 answer @ viscosity of the liquid volume of the object © density of the liquid O mass of the liquid
ntatinn of ave Effervescence: A mineral may react (fizz) when a drop of weak hydrochloric acid is placed on its surface Habit: Characteristic form in which the mineral grows. Related to crystal structure. What would you use a streak plate for? How soft does a mineral have to be for you to scratch it with your fingernail? How hard does a mineral have to be for it to scratch a glass plate? Describe the difference between cleavage and fracture. Why...
Question 1 1 pts When acetic acid and sodium bicarbonate react, why does the total mass decrease? the bubbling of the reaction mixture always causes spattering of the sodium bicarbonate which causes the overall mass to decrease. O a gas is released in the reaction so it's mass is not part of the reaction mixture after the reaction is complete some of the acetic acid gets consumed in the reaction which causes the overall mass to decrease the total mass...
i got 1.4 but it was incorrect
and i am not sure why. Please help!
READING 2 Materials fracture when the force per unit area, called STRESS, exceeds a critical value. In general, the critical stress depends on the direction as well as the magnitude of the force. For example, bones break differently when subjected to torsional (twisting) stress than when subjected to compressional (or squeezing) stress. Let us consider compressional stress. Wet human bone for 20-39 year olds has...
Lab Exercise 3A Discuss why you think cells would evolve to have a certain shape. Think about tf cells that you looked at earlier with shapes other than a sphere or cube. How doy think a shape other than spherical or cuboidal could help speed up difusion acros 2) the plasma membrane? OSMOSIS ANI QUESTION: CAN THE TONICITY DETERMINED EXPERIMENTALL 3) Mature red blood cells (RBCs) do not have a nucleus, which changes its shape from spherica OBJECTIVES I to...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 55 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago