Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Question 1 1 pts When acetic acid and sodium bicarbonate react, why does the total mass...
1. The reaction mixture contains isopentyl acetate, isopentyl alcohol, water, acetic acid and sulfuric acid. a)...
1. The reaction mixture contains isopentyl acetate, isopentyl alcohol, water, acetic acid and sulfuric acid. a) Why is the reaction mixture extracted with sodium bicarbonate? In other words, what two substances does sodium bicarbonate react with in the reaction mixture and why are these reactions useful? (4 pts) b) Write a balanced chemical equation for each reaction involving sodium bicarbonate. c) When the reaction mixture is extracted with sodium bicarbonate solution, what substances will be in the aqueous layer? What...
Question 3 1 pts The molar mass of carbon dioxide is g/mol. Use the periodic table...
Question 3 1 pts The molar mass of carbon dioxide is g/mol. Use the periodic table on the inside cover of your textbook. Question 4 1 pts A sample of NaHCO3 weighs 2.80g. The number of moles of NaHCO3 in the sample is .0333 moles. Question 5 1 pts A 2.83g sample of carbon dioxide contains .0643 moles of carbon dioxide.
Reaction 1: Vinegar (acetic acid) and sodium bicarbonate CH3COOH(aq) + NaHCO3(s) -- CH3COONa (aq) + H2O(l)...
Reaction 1: Vinegar (acetic acid) and sodium bicarbonate CH3COOH(aq) + NaHCO3(s) -- CH3COONa (aq) + H2O(l) + CO2(g) Reaction 2: Vinegar (acetic acid) and ammonia CH3C02H(aq) + NH3(aq)-> CH3CO2NH4(aq) Observe the following reaction: N2(g) + O2(g) XX2NO(g) (reaction 4) Reaction 5: Dissolution of ammonium chloride: NH,Cl(s)-- NH (aq) + Cl(aq) AH = 14.4 kJ/mol (reaction 5) The following endothermic reaction does not occur: CO2(g) + H20(L) X H2CO3(aq) (reaction 6) 2N205(g)-→ 4NO2(g) + O2(g) AH = +13.1 kcal (reaction 7)...
Question 13 of 36 > Attempt 3 Baking soda is sodium bicarbonate, NaHCO3, and vinegar is...
Question 13 of 36 > Attempt 3 Baking soda is sodium bicarbonate, NaHCO3, and vinegar is primarily acetic acid, HC,H,O2- At room temperature, the addition of baking soda to vinegar results in a reaction that produces a tremendous amount of gas, as shown in the video. 201 - Fall 19 (Session ll) - DAYAO Activities and Due Dates > HW 4 signment Score: 32.9% Resources [ Give Up? Feedback Try Again Question 13 of 36 > Attempt 3 < Feedback...
4. Vinegar is a solution of acetic acid. Acetic acid has a 1:1 ratio when reacted...
4. Vinegar is a solution of acetic acid. Acetic acid has a 1:1 ratio when reacted with NaOH. a. Suppose that the molarity of acetic acid in vinegar is 0.5 M, how many grams of acetic acid are present in the 5 ml of vinegar solution used in the titration? (molar mass of acetic acid = 60 g/mol). b. If vinegar has a density of 1.01 g/mol. Calculate the % of acetic acid in vinegar by mass. 5. 50 ml...
molarity of acid: 0.1435M volume:25ml 1. Use the molar mass and moles of acetic acid to...
molarity of acid: 0.1435M
volume:25ml
1. Use the molar mass and moles of acetic acid to determine the mass of the acetic acid in the 25.00-ml sample. 2. Calculate the mass/volume percentage (m/v %) by dividing the mass of acetic acid in grams by the volume of the vinegar sample in mL and multiplying by 100. 3. For the reaction of sodium hydroxide solution with a solution of hydrochloric acid: a. Write a balanced molecular equation for the reaction, including...
An Alka-Seltzer tablet consists of NaHCOs (sodium bicarbonate), citric acid (H3C&HsO; citric acid...
I Need the pre-lab
Questions, please
An Alka-Seltzer tablet consists of NaHCOs (sodium bicarbonate), citric acid (H3C&HsO; citric acid is triprotic), aspirin and other inert ingredients. When dissolved in water, citric acid and NaHCO3 components react as follows: In the first part of the experiment, we will determine the mass of NaHCO in a tablet of Alka Seltzer. To do this, we will use a known mass of a powdered sample of Alka-Seltzer and determine the mass of CO2 gas...
1. Calculate the molar mass of NaHCO3: of NaHCO: 0 84.01, 2. Write the balance chemical...
1. Calculate the molar mass of NaHCO3: of NaHCO: 0 84.01, 2. Write the balance chemical equation for the reaction of sodium bicarbonate with hydrochloric acid: NaHCO3 (s) +_ HCI (aq) → 3. Calculate the volume of CO2 (in mL) of 0.005 moles of CO2 (Remember the gas equation, PV = nRT, where R -0.082 L-atm-mol''.K. Room temperature, T = 20.0°C and Pco2 = 738.5 mm Hg; 1 atm = 760 mm Hg). 4. Calculate the volume of CO2 that...
PM Mon Apr 20 Question 1 3 pts You are preparing the reaction between citric acid...
PM Mon Apr 20 Question 1 3 pts You are preparing the reaction between citric acid and sodium bicarbonate. HO OH sodium bicarbonate sodium citrate carbonic acid CO HO Before the reaction start, the temperature of the citric acid is 20 °C. After adding the sodium bicarbonate the temperature decreases to 15°C Is this reaction endothermic or exothermic? there is not enough information endothermic exothermic • Previous Next Not saved Submit Quiz
Why did you wash the ether solution with sodium bicarbonate? Write chemical equations for the rea...
Why did you wash the ether solution with sodium bicarbonate? Write chemical equations for the reactions that took place. b. At which purification steps was the unreacted methanol removed in the reaction? Some of it may have been removed in more than one place. c. Three-Step Synthesis of Methyl Anisate (Step 3) 0 CHOH. Н.so, cat.) Wear gloves. Methanol is poisonous. Ether is an anesthetic, so don't breathe it. Sulfuric acid is a strong corrosive acid. Wash any you spill...
1. The reaction mixture contains isopentyl acetate, isopentyl alcohol, water, acetic acid and sulfuric acid. a) Why is the reaction mixture extracted with sodium bicarbonate? In other words, what two substances does sodium bicarbonate react with in the reaction mixture and why are these reactions useful? (4 pts) b) Write a balanced chemical equation for each reaction involving sodium bicarbonate. c) When the reaction mixture is extracted with sodium bicarbonate solution, what substances will be in the aqueous layer? What...
Question 3 1 pts The molar mass of carbon dioxide is g/mol. Use the periodic table on the inside cover of your textbook. Question 4 1 pts A sample of NaHCO3 weighs 2.80g. The number of moles of NaHCO3 in the sample is .0333 moles. Question 5 1 pts A 2.83g sample of carbon dioxide contains .0643 moles of carbon dioxide.
Reaction 1: Vinegar (acetic acid) and sodium bicarbonate CH3COOH(aq) + NaHCO3(s) -- CH3COONa (aq) + H2O(l) + CO2(g) Reaction 2: Vinegar (acetic acid) and ammonia CH3C02H(aq) + NH3(aq)-> CH3CO2NH4(aq) Observe the following reaction: N2(g) + O2(g) XX2NO(g) (reaction 4) Reaction 5: Dissolution of ammonium chloride: NH,Cl(s)-- NH (aq) + Cl(aq) AH = 14.4 kJ/mol (reaction 5) The following endothermic reaction does not occur: CO2(g) + H20(L) X H2CO3(aq) (reaction 6) 2N205(g)-→ 4NO2(g) + O2(g) AH = +13.1 kcal (reaction 7)...
Question 13 of 36 > Attempt 3 Baking soda is sodium bicarbonate, NaHCO3, and vinegar is primarily acetic acid, HC,H,O2- At room temperature, the addition of baking soda to vinegar results in a reaction that produces a tremendous amount of gas, as shown in the video. 201 - Fall 19 (Session ll) - DAYAO Activities and Due Dates > HW 4 signment Score: 32.9% Resources [ Give Up? Feedback Try Again Question 13 of 36 > Attempt 3 < Feedback...
4. Vinegar is a solution of acetic acid. Acetic acid has a 1:1 ratio when reacted with NaOH. a. Suppose that the molarity of acetic acid in vinegar is 0.5 M, how many grams of acetic acid are present in the 5 ml of vinegar solution used in the titration? (molar mass of acetic acid = 60 g/mol). b. If vinegar has a density of 1.01 g/mol. Calculate the % of acetic acid in vinegar by mass. 5. 50 ml...
molarity of acid: 0.1435M
volume:25ml
1. Use the molar mass and moles of acetic acid to determine the mass of the acetic acid in the 25.00-ml sample. 2. Calculate the mass/volume percentage (m/v %) by dividing the mass of acetic acid in grams by the volume of the vinegar sample in mL and multiplying by 100. 3. For the reaction of sodium hydroxide solution with a solution of hydrochloric acid: a. Write a balanced molecular equation for the reaction, including...
I Need the pre-lab
Questions, please
An Alka-Seltzer tablet consists of NaHCOs (sodium bicarbonate), citric acid (H3C&HsO; citric acid is triprotic), aspirin and other inert ingredients. When dissolved in water, citric acid and NaHCO3 components react as follows: In the first part of the experiment, we will determine the mass of NaHCO in a tablet of Alka Seltzer. To do this, we will use a known mass of a powdered sample of Alka-Seltzer and determine the mass of CO2 gas...
1. Calculate the molar mass of NaHCO3: of NaHCO: 0 84.01, 2. Write the balance chemical equation for the reaction of sodium bicarbonate with hydrochloric acid: NaHCO3 (s) +_ HCI (aq) → 3. Calculate the volume of CO2 (in mL) of 0.005 moles of CO2 (Remember the gas equation, PV = nRT, where R -0.082 L-atm-mol''.K. Room temperature, T = 20.0°C and Pco2 = 738.5 mm Hg; 1 atm = 760 mm Hg). 4. Calculate the volume of CO2 that...
PM Mon Apr 20 Question 1 3 pts You are preparing the reaction between citric acid and sodium bicarbonate. HO OH sodium bicarbonate sodium citrate carbonic acid CO HO Before the reaction start, the temperature of the citric acid is 20 °C. After adding the sodium bicarbonate the temperature decreases to 15°C Is this reaction endothermic or exothermic? there is not enough information endothermic exothermic • Previous Next Not saved Submit Quiz
Why did you wash the ether solution with sodium bicarbonate? Write chemical equations for the reactions that took place. b. At which purification steps was the unreacted methanol removed in the reaction? Some of it may have been removed in more than one place. c. Three-Step Synthesis of Methyl Anisate (Step 3) 0 CHOH. Н.so, cat.) Wear gloves. Methanol is poisonous. Ether is an anesthetic, so don't breathe it. Sulfuric acid is a strong corrosive acid. Wash any you spill...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago