Homework Answers
similarly in last one with benzene , ring cannot lose its aromaticity on attacking br+ , so it remains inacti
Add Answer to:
Write out the mechanism for each transformation then explain
the observations between all of the reactions....
Write the complete mechanism for each then explain the observations of each as well. ++ 901...
Write the complete mechanism for each then explain the
observations of each as well.
++ 901 yield OH Ticla. 90% yield OH Heat * No Reaction
answer with explanations please What set of reactions are necessary to carry out the following transformation?...
answer with explanations please
What set of reactions are necessary to carry out the following transformation? 1 EN 2. Pin 1. A 2 Heat WH he c Q Zoom А B C D E More than one answer is possible ? Ph 1. Brz, NaOH, then H* workup 2. Pyridine, Heat 3. Ph Culi, then H2O workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph2Culi, then H20 workup A B 1. Brz, NaOH, then H* workup 2. Phli, then...
please do all and explain sn1 sn2 e1e2 1. Write a full, complete mechanism for each...
please do all and explain sn1 sn2 e1e2
1. Write a full, complete mechanism for each of the following reactions. Be sure to indicate all mechanism arrows, charges, and lone electrons. Show stereochemistry where appropriate. Do not show transition states. You must show all possible products, but you only have to write the full mechanism for the formation of one product. (15 points): Br: a) ~ Br H2O2 b) 0-5- NaOH NaOCH, 4.5 de the reaction mat occurs more quickly...
? What set of reactions are necessary to carry out the following transformation? Ph 1. Brz,...
? What set of reactions are necessary to carry out the following transformation? Ph 1. Brz, NaOH, then Ht workup 2. Pyridine, Heat 3. Ph Culi, then H20 workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph Culi, then H20 workup A B 1. Brz, NaOH, then Hworkup 2. Phli, then H20 workup 1. PhMgBr, then H20 workup 2. Brz. NaOH, then H* workup 3. Pyridine, Heat C D Zoom A A B B С D D E More...
Sn1 vs. Sn2 Predict the Product and write out a complete mechanism for each of the...
Sn1 vs. Sn2
Predict the Product and write out a complete mechanism for each
of the following reactions:
Please help!! SO LOST!
(a) KCN DMSO (b) HO (c) NaSH DMSO (d) NH Br (e) Br CH Nal CHs acetone
Q: What set of reactions are necessary to carry out the following transformation? Q: Which of...
Q: What set of reactions are necessary to carry out the
following transformation?
Q: Which of the following compounds are H2O
soluble?
? ? Ph 1. Br2, NaOH, then Ht workup 2. Pyridine, Heat 3. Ph Culi, then H20 workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph2Culi, then H20 workup A B 1. Bra, NaOH, then Ht workup 2. Phli, then H2O workup 1. PhMgBr, then H2O workup 2. Brz, NaOH, then H* workup 3. Pyridine, Heat с...
Write out a complete mechanism for the following transformation: Br CH3CH2OH Show transcribed image text
Write out a complete mechanism for the following
transformation:
Br CH3CH2OH
What set of reactions are necessary to carry out the following transformation? ? Ph 1. Brz,...
What set of reactions are necessary to carry out the following transformation? ? Ph 1. Brz, NaOH, then H* workup 2. Pyridine, Heat 3. Ph, Culi, then H20 workup A 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph_Culi, then H20 workup B 1. Brz, NaOH, then H* workup 2. Phli, then H20 workup 1. PhMgBr then H2O workup 2. Brz, NaOH, then He workup 3. Pyridine, Heat D с A B с D E
give the product(s) for each of the reactions and choose any two that draw/write the mechanism...
give the product(s) for each of the reactions and choose any
two that draw/write the mechanism for the transformation
Many useful synthetic produces involve sequences of aldol. Claisen, Michael, and Mannich reactions. The following questions describe a few samples. Give the product(s) for each of the following reactions (2 points each). Also, choose any two to write/draw mechanisms for the transformation (3 points/each) (15 points) 1) NaOC2Hs 2) H30 &heat 1 CeHs C2HsO2C 1) NaOC2Hs & heat co22Hs 2)heat 2...
Write a mechanism for the given reaction. Identify each sequence of the mechanism. Use proper curvedamow...
Write a mechanism for the given reaction. Identify each sequence of the mechanism. Use proper curvedamow Caleate a AH for each step of the reaction. You only have to show your mechanism one time, but write out all ble stereoisomers and point out any relationships between them (enantiomers, diastereomers mesos Specify absolute configurations in your first stereoisomer. There may or may not be fewer structures than letters below. (25 pts) bond energies cc 63 ROOR (cat.) D- Br Product(s) D-Br...
Write the complete mechanism for each then explain the
observations of each as well.
++ 901 yield OH Ticla. 90% yield OH Heat * No Reaction
answer with explanations please
What set of reactions are necessary to carry out the following transformation? 1 EN 2. Pin 1. A 2 Heat WH he c Q Zoom А B C D E More than one answer is possible ? Ph 1. Brz, NaOH, then H* workup 2. Pyridine, Heat 3. Ph Culi, then H2O workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph2Culi, then H20 workup A B 1. Brz, NaOH, then H* workup 2. Phli, then...
please do all and explain sn1 sn2 e1e2
1. Write a full, complete mechanism for each of the following reactions. Be sure to indicate all mechanism arrows, charges, and lone electrons. Show stereochemistry where appropriate. Do not show transition states. You must show all possible products, but you only have to write the full mechanism for the formation of one product. (15 points): Br: a) ~ Br H2O2 b) 0-5- NaOH NaOCH, 4.5 de the reaction mat occurs more quickly...
? What set of reactions are necessary to carry out the following transformation? Ph 1. Brz, NaOH, then Ht workup 2. Pyridine, Heat 3. Ph Culi, then H20 workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph Culi, then H20 workup A B 1. Brz, NaOH, then Hworkup 2. Phli, then H20 workup 1. PhMgBr, then H20 workup 2. Brz. NaOH, then H* workup 3. Pyridine, Heat C D Zoom A A B B С D D E More...
Sn1 vs. Sn2
Predict the Product and write out a complete mechanism for each
of the following reactions:
Please help!! SO LOST!
(a) KCN DMSO (b) HO (c) NaSH DMSO (d) NH Br (e) Br CH Nal CHs acetone
Q: What set of reactions are necessary to carry out the
following transformation?
Q: Which of the following compounds are H2O
soluble?
? ? Ph 1. Br2, NaOH, then Ht workup 2. Pyridine, Heat 3. Ph Culi, then H20 workup 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph2Culi, then H20 workup A B 1. Bra, NaOH, then Ht workup 2. Phli, then H2O workup 1. PhMgBr, then H2O workup 2. Brz, NaOH, then H* workup 3. Pyridine, Heat с...
Write out a complete mechanism for the following
transformation:
Br CH3CH2OH
What set of reactions are necessary to carry out the following transformation? ? Ph 1. Brz, NaOH, then H* workup 2. Pyridine, Heat 3. Ph, Culi, then H20 workup A 1. Brz, Acetic acid 2. Pyridine, Heat 3. Ph_Culi, then H20 workup B 1. Brz, NaOH, then H* workup 2. Phli, then H20 workup 1. PhMgBr then H2O workup 2. Brz, NaOH, then He workup 3. Pyridine, Heat D с A B с D E
give the product(s) for each of the reactions and choose any
two that draw/write the mechanism for the transformation
Many useful synthetic produces involve sequences of aldol. Claisen, Michael, and Mannich reactions. The following questions describe a few samples. Give the product(s) for each of the following reactions (2 points each). Also, choose any two to write/draw mechanisms for the transformation (3 points/each) (15 points) 1) NaOC2Hs 2) H30 &heat 1 CeHs C2HsO2C 1) NaOC2Hs & heat co22Hs 2)heat 2...
Write a mechanism for the given reaction. Identify each sequence of the mechanism. Use proper curvedamow Caleate a AH for each step of the reaction. You only have to show your mechanism one time, but write out all ble stereoisomers and point out any relationships between them (enantiomers, diastereomers mesos Specify absolute configurations in your first stereoisomer. There may or may not be fewer structures than letters below. (25 pts) bond energies cc 63 ROOR (cat.) D- Br Product(s) D-Br...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 21 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 43 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago