Homework Answers
Add Answer to:
13 (1 Point) Sulphu dioxide gas forms an acidic solution. The equation showing the predominant species...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag)...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S B) HI C) HBr D) H2SO4 E) HCIO 2. Identify the major ionic species present in an aqueous solution of H2SO4. A) S6, 036-(plus H2O as a neutral species) B) H', OH, 56,302- C) 2H, 56, 402- D) H', HS04 E) 24*, SO42- 3. Which of the following represents an acid-base neutralization reaction? A) 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) B) SO2(g) +...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e)...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O Weak acid O Strong acid Strong base Which of the following is the correct molecular equation for the following reaction? HC2H302 (aq) Ba(OH)2 (aq) O 2 H (aq) + Ba(ОН)2 (s) +2 H20 ) +2 C2H302 (aq) +2 C2H302 Ba2+ (aq) (aq) Ba2+ (aq) 2 OH O 2 H(aq)+2 C2H302 (aq) Ba2 (aq) +2 C2H3O2 (aq)+ 2 H20 (aq) (1) +Ba(OH)2 (aq) O 2...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated calcium hydroxide) solution for several minutes. At Step 8 the lime water solution was heated on a steam bath for about three minutes and a precipitate was observed to form. From the options below, which give the equation(s) that accurate explain the observed results? Select one: a. CO2(aq) + CO2(g) then CO2(aq) + Ca2+ (aq) + 2H0- (aq) = CaCO3(s) + H20(aq) O b....
1. Which of the followi ch of the following reactions is not readily explained by the...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids a...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas....
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
What is acidity and what are the compounds controlling it? Acidity is a measure of the...
What is
acidity and what are the compounds controlling it?
Acidity is a measure of
the concentration of hydrogen ions (H+ or protons) in a solution. We
use pH (potential of H+) as a scale of acidity and this can be
calculated as below:
pH =
-log10[H+] =
log10
(1/[H+])
Q1. Figure 10.3 shows you a range
of pH in some common liquids. Pick 2 liquids (one each from acidic
and basic solutions) and compare the molarity of
[H+] in...
3. i). Write the formula of four strong acids and four strong bases. ii). List four...
3. i). Write the formula of four strong acids and four strong bases. ii). List four factors that affect the strength of an acid. iii). Predict the relative strength of the following compounds: H2O, H2S and H2Se. iv). Which of the following is the stronger acids: CHCICOOH or CHCI-COOH? Explain. v). Al 3* is not a Bronsted acid, Al(H2O)" is. Explain. vi). All Bronsted acids are Lewis acids, but the reverse is not true. Give two examples of two Lewis...
a Choose the balanced equation for the following half-reaction, which takes place in acidic solution НВFO,(ag) —> Вr (aq) 4 8e7H (aq) + HBr04 (aq) -> Br (aq) + 4H20(1) 8e H (aq)HBrO4 (aq) -> Br (aq)4H20() Se + 7H* (ag) + HBFO, (ag) — 2Br (аq) + 4H20() Зе + 7H* (ад) + HBFO4(ag) — Br (aq) + 4H20() b Choose the balanced equation for the following half-reaction, which takes place in acidic solution NO3 (ag) > NО2(9) 3e2H...
1. Which of the following compounds in an aqueous solution is a weak acid? A) H2S B) HI C) HBr D) H2SO4 E) HCIO 2. Identify the major ionic species present in an aqueous solution of H2SO4. A) S6, 036-(plus H2O as a neutral species) B) H', OH, 56,302- C) 2H, 56, 402- D) H', HS04 E) 24*, SO42- 3. Which of the following represents an acid-base neutralization reaction? A) 2Al(s) + 3H2SO4(aq) → Al2(SO4)3(aq) + 3H2(g) B) SO2(g) +...
5. Which of the following species is amphiprotic in aqueous solution? (a) CH3NH2 c) NH4 (e) HSO (d) F (b) Н:0" 6, Use Table 15.2 (page 529) to decide whether the species on the left or those on the right are favored by the reaction. a. NH4 (aq) + H2PO4" (aq) # NH3(aq) + HsPO b. HCN (aq) + HS(aq) CN" (aq) +H2S c. HCO +OH CO2 H2S d. Al(H20)6 3+ +OH = Al(H20) s2+ OH 7. The equilibrium constant...
Classify HF as a strong or weak acid or base in aqueous solution. Weak base O Weak acid O Strong acid Strong base Which of the following is the correct molecular equation for the following reaction? HC2H302 (aq) Ba(OH)2 (aq) O 2 H (aq) + Ba(ОН)2 (s) +2 H20 ) +2 C2H302 (aq) +2 C2H302 Ba2+ (aq) (aq) Ba2+ (aq) 2 OH O 2 H(aq)+2 C2H302 (aq) Ba2 (aq) +2 C2H3O2 (aq)+ 2 H20 (aq) (1) +Ba(OH)2 (aq) O 2...
In part B of this experiment carbon dioxide gas was bubbled through a lime water (saturated calcium hydroxide) solution for several minutes. At Step 8 the lime water solution was heated on a steam bath for about three minutes and a precipitate was observed to form. From the options below, which give the equation(s) that accurate explain the observed results? Select one: a. CO2(aq) + CO2(g) then CO2(aq) + Ca2+ (aq) + 2H0- (aq) = CaCO3(s) + H20(aq) O b....
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
1. Which of the followi ch of the following reactions is not readily explained by the Arrhenius concept of acids and bases? a. A. HCl(aq) + NaOH(aq) - NaCl(aq) + H20() b. H30(aq) + OH-(aq) + 2H20(1) c. HCI(g) + NH3(g) - NH4Cl(s) d. HC2H302(aq) + H2O(l) H30*(aq) + C2H302-(ag) e. H30 (aq) + OH-(aq) + 2H2O(aq) 2. Classify each of the following species as Brønsted acid or base or both: a) H20, b) OH", c) H30, d) NH3, e)...
Question 1 (1 point) Reaction of chromium metal with phosphoric acid produces chromium(lI) phosphate and hydrogen gas. Select the correct balanced equation O2Cr(s)+2H3PO4laq)-- 2CrPO4(s)+6H(g) O2Cr(s)+2H3PO4laq)--2CrPO4(s)+3H2(g) O3Cr(s)+3H3PO4(aq)--Cr3(PO4]3(s)+3 H2{g) O2Cr(s)+2H3PO3(aq)--2CrPO3(s)+3H2(g) Question 2 (1 point) Methane gas (CH4) reacts with steam (H20 (g)) to produce hydrogen gas and carbon monoxide gas. Select the correct balanced equation. OCHalg) +H20(g) -- 6H(g)+CO(g) O2CH4(8)+H20(g)- 3H2(g)+2CO(g) OCH4(8) +H20(g) - 3H2(g)+CO(g) OCH4(8) +2H208)-- 4H2{g)+CO2{g) Question 3 (1 point) When the following equation is balanced using the smallest possible...
What is
acidity and what are the compounds controlling it?
Acidity is a measure of
the concentration of hydrogen ions (H+ or protons) in a solution. We
use pH (potential of H+) as a scale of acidity and this can be
calculated as below:
pH =
-log10[H+] =
log10
(1/[H+])
Q1. Figure 10.3 shows you a range
of pH in some common liquids. Pick 2 liquids (one each from acidic
and basic solutions) and compare the molarity of
[H+] in...
3. i). Write the formula of four strong acids and four strong bases. ii). List four factors that affect the strength of an acid. iii). Predict the relative strength of the following compounds: H2O, H2S and H2Se. iv). Which of the following is the stronger acids: CHCICOOH or CHCI-COOH? Explain. v). Al 3* is not a Bronsted acid, Al(H2O)" is. Explain. vi). All Bronsted acids are Lewis acids, but the reverse is not true. Give two examples of two Lewis...
Most questions answered within 3 hours.
-
Required information
[The following information applies to the questions
displayed below.]
In 2019, Alliant Corporation acquired...
asked 7 minutes ago -
How much must I invest today if I want to withdraw 1/3 of my
original investment...
asked 2 hours ago -
What is meant by a “term premium”?
What can explain such a premium? Is it a...
asked 3 hours ago -
23. Which molecule has only covalent bonds? A. CO2 B. Al2O3 C.
Mg3N2
24. The octet...
asked 4 hours ago -
the
total pressure for a mixture of N2O4 and NO2 is 2.20 atm. If Kp=
7.10...
asked 4 hours ago -
Delaware Corp. prepared a master budget that included $22,385
for direct materials, $28,600 for direct labor,...
asked 4 hours ago -
For pesticide HCB (hexachlorobenzene), its logarithmic partition
coefficient log Kow is 5.6. What would be the...
asked 4 hours ago -
A chemist requires 0.422 mil Na2CO3 for a reaction. How many
grams does this correspond to?
asked 4 hours ago -
If the vapor pressure of carvone is approximately 9.4 torr at 99
°C, approximately how much...
asked 4 hours ago -
A juice bottling company is carrying out a test at 10%
significance that the mean population...
asked 4 hours ago -
What is the reflectivity (in percent) needed to keep water at a
temperature near its freezing...
asked 4 hours ago -
Suppose that the average surface temperature of Earth is 300K.
Assume this is uniform over its...
asked 4 hours ago