Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
best synthesis plan form benzene ring?
how do you make this molecule from a standard benzene...
The synthesis of 3-ethylaniline from benzene The synthesis of 3-ethylaniline from benzene represents a common complex...
The synthesis of 3-ethylaniline from benzene The synthesis of 3-ethylaniline from benzene represents a common complex synthesis problem in organic chemistry. The target molecule has two new substituent groups with particular regiochemistry. Furthermore, there are limitations to the direct synthesis of the molecule due to peculiarities groups attached to the molecule Amino groups cannot be directly added to the ring middotAmino groups react strongly with Lewis acids forming a highly deactivated ring Friedel-Crafts reactions will not work on deactivated rings....
4. Propose an efficient synthesis of the molecule below starting with benzene. You can use any...
4. Propose an efficient synthesis of the molecule below starting with benzene. You can use any other reagents you want. NOTE: Some reactions produce ortho- and para-products. It is allowable to just take ONE of the products and use it in the next synthesis or claim it as the final product (we assume that ortho- and para-products can be separated). (3 points) CH2CH2CH Br
In this lab, the product obtained was nitrobenzoic acid. If you were required to do H-NMR,...
In this lab, the product obtained was nitrobenzoic acid. If you were required to do H-NMR, how would you be able to tell if your synthesis went Ortho, Para, or Meta? Make sure you talk about all three outcomes and assume no mixtures. (Focus just on the Hydrogens on the Benzene Ring.)
I am am trying to figure out how to get from the starting benzene ring using...
I am am trying to figure out
how to get from the starting benzene ring using friedel-crafts
acylation and getting a double bond on the end, or a halide on the
end. The halide can easily be turned into the double bond.
We were unable to transcribe this imageCHM all
Here is a molecule. Do a retro synthesis (reaction scheme) on the molecule and go all the way back to produce the molecu...
Here is a molecule. Do a retro synthesis (reaction
scheme) on the molecule and go all the way back to produce the
molecule until you can't go back anymore (think benzene or carbon).
You can use any source and synthesis/reaction to produce the
molecule above. Some notes about the molecule:
I would say start by writing down all the one step
reactions you know that would make the molecule without considering
from where the starting material comes. With some luck...
Here is a molecule. Do a retro synthesis (reaction scheme) on the molecule and go all the way back to produce the molecu...
Here is a molecule. Do a retro synthesis (reaction
scheme) on the molecule and go all the way back to produce the
molecule until you can't go back anymore (think benzene or carbon).
You can use any source and synthesis/reaction to produce the
molecule above. Some notes about the molecule:
I would say start by writing down all the one step
reactions you know that would make the molecule without considering
from where the starting material comes. With some luck...
1. please check what is wrong. Thank you! Determine the product formed when each compound is treated with...
1. please check what is wrong. Thank you!
Determine the product formed when each compound is treated with Br2 and FeBr3. Drag the atom labels to their appropriate positions. CN Atom labels H H Br Br2 A. FeBr Br H OH OH Br Br. Br2 FeBr3 H H Br Br H Br2 FeBr H1 H Reset T Rank the compounds in each group in order of decreasing reactivity in electrophilic aromatic substitution. CI Decreasing reactivity Rank the compounds in each...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions:...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions: Reactions 1. Halogenation 2. Nitration 3. Sulfonation 4. Friedel-Crafts acylation 5. Friedel-Crafts alkylation 6. Oxidation of methyl group 7. Reduction of nitro group • Choose the starting material from the drop-down list • Enter the number(s) of the desired reactions in the order that you wish to use them without commas between • If a reaction is used more than once, enter its number...
Question 3 1s 3 ORTHO Today we learned about adding a second group to a mono-substituted...
Question 3
1s 3 ORTHO Today we learned about adding a second group to a mono-substituted benzene ring. Any group on a benzene will affect the rate of the reaction (activated or deactivated relative to benzene) and the regioselectivity Where does the electrophile add? Ortho? Meta? Para? Some combination thereof? We found that EDGs (electron-donating groups) direct the electrophile to the ortho and para positions while EWGs (electron-withdrawing groups) direct the electrophile to the meta position. Now, it is time...
QUESTIONS 1. What is the purpose of the sulfuric acid (yes, it's a catalyst, but why...
QUESTIONS 1. What is the purpose of the sulfuric acid (yes, it's a catalyst, but why is it a catalyst? What is it doing that makes the reaction possible? Would the reaction just go slower without it, or would the reaction not go at all? Why?) 2. If isobutyl alcohol (2 methyl propanol) is used instead of tert butyl alcohol, a mixture of products is obtained. One the products is the same as the product obtained with the tert butyl...
The synthesis of 3-ethylaniline from benzene The synthesis of 3-ethylaniline from benzene represents a common complex synthesis problem in organic chemistry. The target molecule has two new substituent groups with particular regiochemistry. Furthermore, there are limitations to the direct synthesis of the molecule due to peculiarities groups attached to the molecule Amino groups cannot be directly added to the ring middotAmino groups react strongly with Lewis acids forming a highly deactivated ring Friedel-Crafts reactions will not work on deactivated rings....
4. Propose an efficient synthesis of the molecule below starting with benzene. You can use any other reagents you want. NOTE: Some reactions produce ortho- and para-products. It is allowable to just take ONE of the products and use it in the next synthesis or claim it as the final product (we assume that ortho- and para-products can be separated). (3 points) CH2CH2CH Br
I am am trying to figure out
how to get from the starting benzene ring using friedel-crafts
acylation and getting a double bond on the end, or a halide on the
end. The halide can easily be turned into the double bond.
We were unable to transcribe this imageCHM all
Here is a molecule. Do a retro synthesis (reaction
scheme) on the molecule and go all the way back to produce the
molecule until you can't go back anymore (think benzene or carbon).
You can use any source and synthesis/reaction to produce the
molecule above. Some notes about the molecule:
I would say start by writing down all the one step
reactions you know that would make the molecule without considering
from where the starting material comes. With some luck...
Here is a molecule. Do a retro synthesis (reaction
scheme) on the molecule and go all the way back to produce the
molecule until you can't go back anymore (think benzene or carbon).
You can use any source and synthesis/reaction to produce the
molecule above. Some notes about the molecule:
I would say start by writing down all the one step
reactions you know that would make the molecule without considering
from where the starting material comes. With some luck...
1. please check what is wrong. Thank you!
Determine the product formed when each compound is treated with Br2 and FeBr3. Drag the atom labels to their appropriate positions. CN Atom labels H H Br Br2 A. FeBr Br H OH OH Br Br. Br2 FeBr3 H H Br Br H Br2 FeBr H1 H Reset T Rank the compounds in each group in order of decreasing reactivity in electrophilic aromatic substitution. CI Decreasing reactivity Rank the compounds in each...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions: Reactions 1. Halogenation 2. Nitration 3. Sulfonation 4. Friedel-Crafts acylation 5. Friedel-Crafts alkylation 6. Oxidation of methyl group 7. Reduction of nitro group • Choose the starting material from the drop-down list • Enter the number(s) of the desired reactions in the order that you wish to use them without commas between • If a reaction is used more than once, enter its number...
Question 3
1s 3 ORTHO Today we learned about adding a second group to a mono-substituted benzene ring. Any group on a benzene will affect the rate of the reaction (activated or deactivated relative to benzene) and the regioselectivity Where does the electrophile add? Ortho? Meta? Para? Some combination thereof? We found that EDGs (electron-donating groups) direct the electrophile to the ortho and para positions while EWGs (electron-withdrawing groups) direct the electrophile to the meta position. Now, it is time...
QUESTIONS 1. What is the purpose of the sulfuric acid (yes, it's a catalyst, but why is it a catalyst? What is it doing that makes the reaction possible? Would the reaction just go slower without it, or would the reaction not go at all? Why?) 2. If isobutyl alcohol (2 methyl propanol) is used instead of tert butyl alcohol, a mixture of products is obtained. One the products is the same as the product obtained with the tert butyl...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 3 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago