In the decomposition reaction using ammonium carbonate, (NH4)2CO3, you should have noticed a fine mist or...
In the decomposition reaction using ammonium carbonate, (NH4)2CO3, you should have noticed a fine mist or liquid deposited on the inside of the test tube after the reaction. What is the identity of that liquid?
|
a. carbon dioxide |
||
|
b.water |
||
|
c. ammonia |
||
|
d.citric acid |
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
In the decomposition reaction using ammonium carbonate,
(NH4)2CO3, you should have noticed
a fine mist or...
QUESTION 2 Propose a full and balanced reaction showing how ammonium carbonate, (NH4)2CO3, neutralizes stomach acid....
QUESTION 2 Propose a full and balanced reaction showing how ammonium carbonate, (NH4)2CO3, neutralizes stomach acid. Then provide the net ionic equation for this reaction. TT T Arial 3(12pt) T.E E 5.25 Pathep Words:
CHEM 121 - Extra Credit Name: Signature: Check the box to the right if you want...
CHEM 121 - Extra Credit Name: Signature: Check the box to the right if you want your graded homework to be placed out in the public rack outside Prof. Wicker's office. Otherwise you will have to pick up your homework from Prof. Wicker in person: 1. (10 pts) Aqueous ammonium carbonate can react with hydrochloric acid to form water, aqueous ammonium chloride, and gaseous carbon dioxide. Write the full and net ionic equations associated with this reaction. If you recover...
Use only the precipitation, gaseous, com bustion, synthesis, single displacement or decomposition ONLY. NO REACTION write...
Use only the precipitation, gaseous, com bustion, synthesis, single displacement or decomposition ONLY. NO REACTION write NO RXN Gaseous nitrogen dioxide decomposes to form gaseous nitrogen monoxide and oxygen gas Copper metal reacts with aqueous silver nitrate Aqueous barium chloride is placed in an Erlenmeyer flask containing sulfuric acid Carbonic acid decomposes to form carbon dioxide gas and water liquid Bariam metal is placed in a beaker containing hydrochloric acid Aqueous calcium chloride is added to a test tube containing...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
3.0 PROCEDURE: For each reaction, you should write a total molecular reaction, a total ionic reaction...
3.0 PROCEDURE: For each reaction, you should write a total molecular reaction, a total ionic reaction and then remove any spectator ions to produce a final net ionic reaction. In order to simplify your task each reaction has its driving force listed. In more advanced General Chemistry courses, you will be expected to find the driving force yourself (based on the rules given above), but for our purposes it is best for you to simply "experience the steps of producing...
What is the SN2 reaction? How does Br attach to which carbon as a nucleophile and...
What is the SN2 reaction? How does Br attach to which carbon as
a nucleophile and why? Difference between Unimolecular or
Bimolecular? How NaBr and H2SO4 work in the
reaction? Why Water/Sulfuric Acid/Brine/Sodium
Hydroxide/Na2SO4 in Extraction? What does
each layer have inside in each step of the separation?
Please help. Due to corona, this is a theoretical lab and I am
very confused.
Chapter 16. The Sy2 Reaction: 1-Bromobutane Handout by Dr. Zhiyong Wang CH3CH2CH2CH, OH NaBr, H2SO4 ©Dr. Wang...
Experiment 8 Double Replacement Reactions Background: Some reactions have the net effect of causing the cation...
Experiment 8 Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of each reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms a product with chloride. Note that the formula of each product is determined by the charges of the ions,...
When you write the answers, please write the page number for which the question is located....
When you write the answers, please write the page number for
which the question is located. Thank you!
Experiment 8 Name: Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of cach reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction?...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
can someone please answer number one? im so lost DYES AND DYEING CHAPTER 1. Calculate the...
can someone please answer number one? im so lost
DYES AND DYEING CHAPTER 1. Calculate the amounts of salicylic acid, 1-naphthol, 2-naphthol, 8-anilino-1-naph- thalenesulfonic acid ammonium salt, or N,N-dimethylaniline needed for Part 1B of this experiment (use molecules as assigned by your TA). 190mg 3-aminobenzene 2.5mL Sulfonic acid 2.5% sodium carbonate solution 81mg Sodium nitrate 2. What is the purpose of the sodium carbonate in Part 1A? Why do we add glacial acetic acid in Part 13 when we react...
QUESTION 2 Propose a full and balanced reaction showing how ammonium carbonate, (NH4)2CO3, neutralizes stomach acid. Then provide the net ionic equation for this reaction. TT T Arial 3(12pt) T.E E 5.25 Pathep Words:
CHEM 121 - Extra Credit Name: Signature: Check the box to the right if you want your graded homework to be placed out in the public rack outside Prof. Wicker's office. Otherwise you will have to pick up your homework from Prof. Wicker in person: 1. (10 pts) Aqueous ammonium carbonate can react with hydrochloric acid to form water, aqueous ammonium chloride, and gaseous carbon dioxide. Write the full and net ionic equations associated with this reaction. If you recover...
Use only the precipitation, gaseous, com bustion, synthesis, single displacement or decomposition ONLY. NO REACTION write NO RXN Gaseous nitrogen dioxide decomposes to form gaseous nitrogen monoxide and oxygen gas Copper metal reacts with aqueous silver nitrate Aqueous barium chloride is placed in an Erlenmeyer flask containing sulfuric acid Carbonic acid decomposes to form carbon dioxide gas and water liquid Bariam metal is placed in a beaker containing hydrochloric acid Aqueous calcium chloride is added to a test tube containing...
Chemical Reactions For each reaction you observed, the names of the reactants and products are given below. You must: 1. Write the correct formula for each reactant and product. Balance each equation. 2. A. Combination reactions magnesium oxide 1. Magnesium + oxygen (unbalanced) Mg+ O, MgO sulfur dioxide 2. Sulfur + oxygen B. Analysis of the Copper Content of a Penny po zinc chloride + hydrogen zinc + hydrochloric acid HCI ZnCl, 1. (unbalanced) н, Zn + C. Single Replacement...
3.0 PROCEDURE: For each reaction, you should write a total molecular reaction, a total ionic reaction and then remove any spectator ions to produce a final net ionic reaction. In order to simplify your task each reaction has its driving force listed. In more advanced General Chemistry courses, you will be expected to find the driving force yourself (based on the rules given above), but for our purposes it is best for you to simply "experience the steps of producing...
What is the SN2 reaction? How does Br attach to which carbon as
a nucleophile and why? Difference between Unimolecular or
Bimolecular? How NaBr and H2SO4 work in the
reaction? Why Water/Sulfuric Acid/Brine/Sodium
Hydroxide/Na2SO4 in Extraction? What does
each layer have inside in each step of the separation?
Please help. Due to corona, this is a theoretical lab and I am
very confused.
Chapter 16. The Sy2 Reaction: 1-Bromobutane Handout by Dr. Zhiyong Wang CH3CH2CH2CH, OH NaBr, H2SO4 ©Dr. Wang...
Experiment 8 Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of each reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms a product with chloride. Note that the formula of each product is determined by the charges of the ions,...
When you write the answers, please write the page number for
which the question is located. Thank you!
Experiment 8 Name: Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of cach reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms...
What is the general class of each test reaction in the introduction? Precipitation? Acid-Base? Oxidation eduction? anoina to aizy ona svidstils Reaction Class 1 2 iliw 15 TO15192do art sshommua bns nosgol rond dass 101 12575 gbubnium oY noi de lo enor Som 10 910 w II woy Xd on abian aningstid on naloga uzib 3 OOH 4 5 DHET 6 7 SET adus 00 9 Complex ion formation 10 11 No reaction 12 13 14 Combination 15 16 17...
can someone please answer number one? im so lost
DYES AND DYEING CHAPTER 1. Calculate the amounts of salicylic acid, 1-naphthol, 2-naphthol, 8-anilino-1-naph- thalenesulfonic acid ammonium salt, or N,N-dimethylaniline needed for Part 1B of this experiment (use molecules as assigned by your TA). 190mg 3-aminobenzene 2.5mL Sulfonic acid 2.5% sodium carbonate solution 81mg Sodium nitrate 2. What is the purpose of the sodium carbonate in Part 1A? Why do we add glacial acetic acid in Part 13 when we react...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 7 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 56 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago