Please write clearly and explain.
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Please write clearly and explain.
1. Draw the Sn1, SN2, E1, and Ez reaction mechanisms of...
Please write answers neatly and explain. 1. Draw the SN1, SN2, E., and Ez reaction mechanisms...
Please write answers neatly and explain.
1. Draw the SN1, SN2, E., and Ez reaction mechanisms of (just do all four reactions for each): A. (R)-2-bromo-1-phenylpropane reacting with sodium hydroxide B. (2S,3R)-3-bromo-2-methoxy-3-methylpentane with NaF If the two above reactions (from question 1) were carried out in DMSO at room temperature, which reaction mechanism would be favored and why?
Please make it easy to read (no cursive) THANK YOU SO MUCH :) 1. Draw the...
Please make it easy to read (no cursive) THANK YOU SO MUCH
:)
1. Draw the Sn1, SN2, Es, and Ez reaction mechanisms of (just do all four reactions for each): A. (R)-2-bromo-1-phenylpropane reacting with sodium hydroxide B.(2S,3R)-3-bromo-2-methoxy-3-methylpentane with NaF 2. If the two above reactions (from question 1) were carried out in DMSO at room temperature, which reaction mechanism would be favored and why? 3. Draw the most stable chair conformation of 1-t-butylcyclohexane
Thermodynamics and kinetics of SN1, SN2, E1, and E2 mechanisms. 2. Draw the reaction coordinate diagrams...
Thermodynamics and kinetics of SN1, SN2, E1, and E2 mechanisms. 2. Draw the reaction coordinate diagrams of the following reactions according to the type of mechanisms given and include the following: a) Label the reactant, product, intermediates, and a drawing of the transition state of the rate determining step. If there are multiple E, label the largest E (5 pts) b) State if AG rx is <0 or >0 and make sure your diagram reflects the AGxn. (4 pts) Hint:...
please explain in detail. Thank you in advance . 1. Circle the mechanism (SN2, SN1, E2,...
please explain in detail. Thank you in advance .
1. Circle the mechanism (SN2, SN1, E2, or E1) responsible for the formation of each product in this reaction. If the product cannot be formed in the reaction, circle "not a product". (2 pts) CI CHE CH3 CHE CH3 осна SN2 SN1 E2 E1 S2 SN1 E2 E1 SN2 Sn1 E2 E1 SN2 SN1 E2 E1 not a product not a product not a product not a product 2. These reactions...
Nucleophilic Substitution Reactions Lab (SN1 and SN2 reaction mechanisms) Below are my lab results for SN1...
Nucleophilic Substitution Reactions Lab (SN1 and SN2 reaction mechanisms) Below are my lab results for SN1 and SN2 reactions. This first column of the chart gives the ten starting material halides used in this experiment. The second column gives the reaction time for SN1 mechanisms with silver nitratate in ethanol solution. The third column gives the reaction time for SN2 mechanisms with sodium iodide. In theory, primary alkyl halides are expected to react faster in SN2 mechanisms, and tertiary alkyl...
will this reaction be SN2, SN1, E1 or E2? draw possible products and label the major...
will this reaction be SN2, SN1, E1 or E2?
draw possible products and label the major if applicable
please and thank you!
- - - will this non be SN2, SNI , El or E2? @ then, drow possible products and label the major (if applicable) H2O
1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH3 CI + NaOCH2CH3 2. Draw...
1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH3 CI + NaOCH2CH3 2. Draw complete mechanism with arrows for the SN1/E1 mechanism. Check for carbocation rearrangements. Hac CH + H2O
Determine if the reaction is SN1, SN2, E1 or E2. Write the complete mechanism and answer...
Determine if the reaction is SN1, SN2, E1 or E2. Write
the complete mechanism and answer any questions
*Please don't leave any steps out*
но oplommor + NH3- a. Is the most stable alkene formed? Explain b. Is Zaitsev's rule followed? c. If the concentration of substrate is increased will the rate increase, decrease or remain the same? Explain
1. Determine whether the following reactions will go through SN1, SN2, E1, or E2 mechanism a....
1. Determine whether the following reactions will go through SN1, SN2, E1, or E2 mechanism a. 1-bromobutane + sodium hydroxide b. 2-chloro-2-methylpentane + sodium hydroxide + heat C. 2,3-dimethyl-3-bromopentane + water d. 2-bromobutane + methanol 2. Draw the major product for the following reactions (draw both products if racemic): NaSH DMSO TsO CHA Nal CH, acetone CH,CH,ONa+ ethanol CH,OH/H-0 Solite Nal (1 equiv.) acetone F CH2CH OH 25°C
Please help me!! 3. (6) Give the mechanistic symbols (SN1, SN2, E1, or E2) that are...
Please help me!!
3. (6) Give the mechanistic symbols (SN1, SN2, E1, or E2) that are most consistent with each of the following statements. If none of them apply, write N. More than one symbol may be true for each statement (list all that apply). 1-bromopentane reacts faster than 3-bromo-2,4-dimethylpentane by this/these mechanism(s). Corresponds to the reaction profile at the right. > Which mechanism gives a racemic mixture of substitution products? bin (mort stable goes first)
Please write answers neatly and explain.
1. Draw the SN1, SN2, E., and Ez reaction mechanisms of (just do all four reactions for each): A. (R)-2-bromo-1-phenylpropane reacting with sodium hydroxide B. (2S,3R)-3-bromo-2-methoxy-3-methylpentane with NaF If the two above reactions (from question 1) were carried out in DMSO at room temperature, which reaction mechanism would be favored and why?
Please make it easy to read (no cursive) THANK YOU SO MUCH
:)
1. Draw the Sn1, SN2, Es, and Ez reaction mechanisms of (just do all four reactions for each): A. (R)-2-bromo-1-phenylpropane reacting with sodium hydroxide B.(2S,3R)-3-bromo-2-methoxy-3-methylpentane with NaF 2. If the two above reactions (from question 1) were carried out in DMSO at room temperature, which reaction mechanism would be favored and why? 3. Draw the most stable chair conformation of 1-t-butylcyclohexane
Thermodynamics and kinetics of SN1, SN2, E1, and E2 mechanisms. 2. Draw the reaction coordinate diagrams of the following reactions according to the type of mechanisms given and include the following: a) Label the reactant, product, intermediates, and a drawing of the transition state of the rate determining step. If there are multiple E, label the largest E (5 pts) b) State if AG rx is <0 or >0 and make sure your diagram reflects the AGxn. (4 pts) Hint:...
please explain in detail. Thank you in advance .
1. Circle the mechanism (SN2, SN1, E2, or E1) responsible for the formation of each product in this reaction. If the product cannot be formed in the reaction, circle "not a product". (2 pts) CI CHE CH3 CHE CH3 осна SN2 SN1 E2 E1 S2 SN1 E2 E1 SN2 Sn1 E2 E1 SN2 SN1 E2 E1 not a product not a product not a product not a product 2. These reactions...
will this reaction be SN2, SN1, E1 or E2?
draw possible products and label the major if applicable
please and thank you!
- - - will this non be SN2, SNI , El or E2? @ then, drow possible products and label the major (if applicable) H2O
1. Predict the most likely reaction mechanism (SN1, SN2, E1, E2) and draw all products. CH3 CI + NaOCH2CH3 2. Draw complete mechanism with arrows for the SN1/E1 mechanism. Check for carbocation rearrangements. Hac CH + H2O
Determine if the reaction is SN1, SN2, E1 or E2. Write
the complete mechanism and answer any questions
*Please don't leave any steps out*
но oplommor + NH3- a. Is the most stable alkene formed? Explain b. Is Zaitsev's rule followed? c. If the concentration of substrate is increased will the rate increase, decrease or remain the same? Explain
1. Determine whether the following reactions will go through SN1, SN2, E1, or E2 mechanism a. 1-bromobutane + sodium hydroxide b. 2-chloro-2-methylpentane + sodium hydroxide + heat C. 2,3-dimethyl-3-bromopentane + water d. 2-bromobutane + methanol 2. Draw the major product for the following reactions (draw both products if racemic): NaSH DMSO TsO CHA Nal CH, acetone CH,CH,ONa+ ethanol CH,OH/H-0 Solite Nal (1 equiv.) acetone F CH2CH OH 25°C
Please help me!!
3. (6) Give the mechanistic symbols (SN1, SN2, E1, or E2) that are most consistent with each of the following statements. If none of them apply, write N. More than one symbol may be true for each statement (list all that apply). 1-bromopentane reacts faster than 3-bromo-2,4-dimethylpentane by this/these mechanism(s). Corresponds to the reaction profile at the right. > Which mechanism gives a racemic mixture of substitution products? bin (mort stable goes first)
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago