Which of the following statements is FALSE? When Keq << 1, the reverse reaction is favored...
Which of the following statements is FALSE?
|
When Keq << 1, the reverse reaction is favored and the reactants greatly exceed the products at equilibrium |
||
|
Keq >> 1 implies that the reaction is very fast at producing products |
||
|
When Keq ≈ 1, neither the forward or reverse reaction is strongly favored, and about the same amount of reactants and products exist at equilibrium |
||
|
When Keq >> 1, the forward reaction is favored and products greatly exceed reactants at equilibrium |
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Which of the following statements is FALSE?
When Keq << 1, the reverse reaction
is favored...
A reaction that has a positive AH and a positive AS will be spontaneous at high...
A reaction that has a positive AH and a positive AS will be spontaneous at high temperatures spontaneous at low temperatures spontaneous at all temperatures nonspontaneous at all temperatures QUESTION 6 Which of the following statements is FALSE? Keg for a reaction written in reverse is the reciprocal of the key for the forward reaction A reaction quotient (Q) larger than Keq means that the reaction will shift toward reactants Chemical equilibrium indicates that reactants and products are present in...
MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answer the question 1)...
MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answer the question 1) Which of the following statements is FALSE? A) When K<< 1, the reverse reaction is favored and the forward reaction does not proceed to a great extent. B) K>> implies that the reaction is very fast at producing products. When K>>> 1, the forward reaction is favored and essentially goes to completion. D) When K-1, neither the forward or reverse reaction is strongly favored,...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward reaction stops only the reverse reaction stops both the forward and reverse reactions stop the rate constants for the forward and reverse reactions are equal the rates of the forward and reverse reactions are equal 2. A chemical equilibrium may be established by starting a reaction with reactants only. d. any quantities of reactants and products. products only. e. all the above equal quantities...
9. What does it mean if Keq < 1, at equilibrium? The concentration of reactants is...
9. What does it mean if Keq < 1, at equilibrium? The concentration of reactants is greater than the concentration of products. b. The concentration of products is greater than the concentration of reactants. The rate of the forward reaction is greater than the rate of the reverse reaction. c. d. The rate of the reverse reaction is greater than the rate of the forward reaction. e. The concentration of products and reactants are about the same. Which of the...
Label the following statements about equilibrium as true or false. Adding a catalyst will increase the...
Label the following statements about equilibrium as true or false. Adding a catalyst will increase the amount of products. False The concentrations of reactants and products are constant. False The rate of the forward reaction equals the rate of the reverse reaction. True The value of the equilibrium constant will change if the temperature changes False
Decide which of the following statements are True and which are False about equilibrium systems: For...
Decide which of the following statements are True and which are False about equilibrium systems: For the following reaction: CaCO3(s) = CaO(s) + CO2(g) the (CaCO3] appears in the denominator of the equilibrium expression. For the following reaction: H2(g) + F2(g) = 2HF(g) the values of K and Kp are not the same. The value of K at constant temperature depends on the amounts of reactants and products that are mixed together initially. A large value of K means the...
6. Which of the following statements is not true? A) Bond breaking is endothermic. B) The...
6. Which of the following statements is not true? A) Bond breaking is endothermic. B) The bond dissociation energy for bond breaking is always negative. C) Bond making is exothermic. D) The bond dissociation energy for bond formation is always negative. 37. Using the bond dissociation energies given, calculate AH® for the following reaction. CH,CH -Br + H2O CH,CH-OH + HBr AH KJ/mol Bond A-B CH3CH2-Br H-OH сHCH-он H-Br A) +108 KJ/mol B) -130 KJ/mol C) -22 KJ/mol D) +22...
Which of the following statements are true in this equilibrium state? A. The concentrations of reactants...
Which of the following statements are true in this equilibrium state? A. The concentrations of reactants and prodcuts are still changing with time. B. The concentrations of reactants and products are equal. C. The rates of the forward and reverse reactions are equal. D. The rate of the reverse reaction is greater than that of the forward reaction. E. The rate of the forward reaction is greater than that of the reverse reaction.
For the reaction coordinate diagram shown below, which of the following statements are true? Energy Reaction...
For the reaction coordinate diagram shown below, which of the following statements are true? Energy Reaction Coordinate True AErxn = A-C True Reaction is endothermic False Ea(forward) = Ea(reverse) True A represents the energy of the starting materials False Ea(forward) = B-C True Eg of the forward reaction is less than Ea of the reverse reaction Remember that thermodynamic quantities are calculated by products - reactants. The activation energy can be thought of as the barrier height.
which of the following statements about K of 3.5 calculated for a specific chemical reaction at...
which of the following statements about K of 3.5 calculated for a specific chemical reaction at equilibrium is incorrect? A: It was calculated by dividing the products by that of the reactants B: it indicates that one side of the reaction has most of the matter present C: it is an evaluation of the extent of the two chemical reactions involved: the forward and the reverse reactions D: a K of 3.5 indicates that a catalyst will push the reaction...
A reaction that has a positive AH and a positive AS will be spontaneous at high temperatures spontaneous at low temperatures spontaneous at all temperatures nonspontaneous at all temperatures QUESTION 6 Which of the following statements is FALSE? Keg for a reaction written in reverse is the reciprocal of the key for the forward reaction A reaction quotient (Q) larger than Keq means that the reaction will shift toward reactants Chemical equilibrium indicates that reactants and products are present in...
MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answer the question 1) Which of the following statements is FALSE? A) When K<< 1, the reverse reaction is favored and the forward reaction does not proceed to a great extent. B) K>> implies that the reaction is very fast at producing products. When K>>> 1, the forward reaction is favored and essentially goes to completion. D) When K-1, neither the forward or reverse reaction is strongly favored,...
1. Which of the following is true for a chemical reaction at equilibrium? only the forward reaction stops only the reverse reaction stops both the forward and reverse reactions stop the rate constants for the forward and reverse reactions are equal the rates of the forward and reverse reactions are equal 2. A chemical equilibrium may be established by starting a reaction with reactants only. d. any quantities of reactants and products. products only. e. all the above equal quantities...
9. What does it mean if Keq < 1, at equilibrium? The concentration of reactants is greater than the concentration of products. b. The concentration of products is greater than the concentration of reactants. The rate of the forward reaction is greater than the rate of the reverse reaction. c. d. The rate of the reverse reaction is greater than the rate of the forward reaction. e. The concentration of products and reactants are about the same. Which of the...
Label the following statements about equilibrium as true or false. Adding a catalyst will increase the amount of products. False The concentrations of reactants and products are constant. False The rate of the forward reaction equals the rate of the reverse reaction. True The value of the equilibrium constant will change if the temperature changes False
Decide which of the following statements are True and which are False about equilibrium systems: For the following reaction: CaCO3(s) = CaO(s) + CO2(g) the (CaCO3] appears in the denominator of the equilibrium expression. For the following reaction: H2(g) + F2(g) = 2HF(g) the values of K and Kp are not the same. The value of K at constant temperature depends on the amounts of reactants and products that are mixed together initially. A large value of K means the...
6. Which of the following statements is not true? A) Bond breaking is endothermic. B) The bond dissociation energy for bond breaking is always negative. C) Bond making is exothermic. D) The bond dissociation energy for bond formation is always negative. 37. Using the bond dissociation energies given, calculate AH® for the following reaction. CH,CH -Br + H2O CH,CH-OH + HBr AH KJ/mol Bond A-B CH3CH2-Br H-OH сHCH-он H-Br A) +108 KJ/mol B) -130 KJ/mol C) -22 KJ/mol D) +22...
For the reaction coordinate diagram shown below, which of the following statements are true? Energy Reaction Coordinate True AErxn = A-C True Reaction is endothermic False Ea(forward) = Ea(reverse) True A represents the energy of the starting materials False Ea(forward) = B-C True Eg of the forward reaction is less than Ea of the reverse reaction Remember that thermodynamic quantities are calculated by products - reactants. The activation energy can be thought of as the barrier height.
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 15 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago