Homework Answers
correct option is D, ammonia is very much soluble in water, it reacts to form ammonium ions and hydroxide ions.
Add Answer to:
Question 41 1 pts What particles would be present in NH3(aq)? O water molecules and NH3...
please answer both questions QUESTION 8 The compound ammonia, NH3, is a weak base when dissolved...
please answer both questions
QUESTION 8 The compound ammonia, NH3, is a weak base when dissolved in water. Which of the following is the correct equation for the reaction of ammonia in water? a NH3(aq) + H20(0) NH4(aq) + OH(aq) NH3(aq) + OH(aq) NH2 (aq) + H20(0) NH3(aq) + H20(1) -NH2 (aq) + H30*(aq) NH3(aq) + H200) NH2 (aq) + H30(aq) NH3(aq) + H30aq) NH4+ (aq) + H20(0) QUESTION 9 What is the pH of a solution that is 0.17...
When NH3 is added to water, the following process occurs: NH3 (aq) + H2O (1) +...
When NH3 is added to water, the following process occurs: NH3 (aq) + H2O (1) + NH4+ (aq) + OH- (aq) In this process, what is the role of NH3? Both an Arrhenius Base and a Bronsed-Lowry Base A Bronsted-Lowry Acid An Arrehenius Acid An Arrhenius Base A Bronsted-Lowry Base Molecular level views of three aqueous solutions (A, B, and C) are shown below (H20 molecules have been omitted for clarity, and because I'm lazy...): (A) (B) (C) + Which...
Quest. 4 (15 pts). Ammonia react with water as shown in the following equation: NH3(aq) +...
Quest. 4 (15 pts). Ammonia react with water as shown in the following equation: NH3(aq) + H2O(l) NH4+(aq) + OH(aq) Kb = 1.77 x 10-4 and Ka = 5.65 x 10-10 a) Calculate the pH of the 0.030 M NH solution (Use a labeled ICE table) b) Calculate the pH of the solution at the equivalent point (when equal amount on added. Assume the volume doubles). (Use a labeled ICE table) c) Over which pH range (actual numbers) do you...
One of the reactions that is often studied in an equilibrium experiment is: NH3 (aq) +...
One of the reactions that is often studied in an equilibrium experiment is: NH3 (aq) + H2O < --> NH4+ (aq) + OH- (aq). Use this reaction to answer questions 1-3. 1) Which way would the equilibrium shift if NH4Cl was added to the solution? Briefly explain. 2) What would happen to the concentration of NH3 if you added some pure water to the reaction? Briefly explain. 3) What would happen to the concentration of NH4 if you added some...
Calculate the OH- concentration at equilibrium in the following reaction: NH3 (aq) + H20 (1) ->...
Calculate the OH- concentration at equilibrium in the following reaction: NH3 (aq) + H20 (1) -> NH4+ (aq) + OH- (aq) (Kb = 1.8 x10^(-5) (1 point) O 1x10^(-14) M O2.7 x10^(-3) M O 7.2 x10^(-6) M O None of the above Question 15 Which of the following pH values indicates the most basic solution? (1 point)* O pH=12 O pH=4 O pH=8 O pH=9
This question pertains to the pH of a weak acid/weak base salt combo. For an aq...
This question pertains to the pH of a weak acid/weak base salt combo. For an aq solution of NH4NO2, these are the combinations of reactions that are possible. (1) NH4+(aq) + NO21-(aq) ⇆ NH3(aq) + HNO2(aq)____________K1 = ? (2) NH4+(aq) + H2O(l) ⇆ H3O+(aq) + NH3(aq)_______________Ka = 5.6 x 10-10 (3) NO21- + H2O(l) ⇆ HNO2(aq) + OH-(aq)_________________Kb = 2.2 x 10-11 (4) 2H2O(l) ⇆ H3O+(aq) + OH-(aq)_________________________Kw =1.0 x 10-14 Write the symbolic expression for the equilibrium constants...
+ NH3 H₂O OH NH4+ Given the chemical reaction above, NH3 would be classified as a...
+ NH3 H₂O OH NH4+ Given the chemical reaction above, NH3 would be classified as a O A strong acid O B. weak base O C. Strong base O D. weak acid QUESTION 11 When added to water, which of the following would produce an acid? OMgo Nao NH3 SO3 None of the above. 00000 QUESTION 12 taste. Liquids that have a basic pH can be identified by their O A. salty O B. sour O C. sweet O D....
Question 6 (1 point) What is the conjugate acid of NH3 NH3 NH4+ Он* NH2 Question...
Question 6 (1 point) What is the conjugate acid of NH3 NH3 NH4+ Он* NH2 Question 7 (1 point) The hydrogen ion concentration of a solution is 1 x 10-2 M. What is the pH of the solution, and is it acidic or basic? O pH-10, acidic pH-2, acidic
Question 1 5 pts With regard to Ca(OH)2 (aq) + 2HF (aq) <-->CaF2(s) + 2H,O (aq),...
Question 1 5 pts With regard to Ca(OH)2 (aq) + 2HF (aq) <-->CaF2(s) + 2H,O (aq), in what direction, if any, would the equilibrium be shifted by addition of nitric acid no effect Right Left
I am sort of confused on what these are asking? An explination of the concepts would really help, I will give thumbs up...
I am sort of confused on what these are asking? An explination
of the concepts would really help, I will give thumbs up :)
3. Consider the following reactions: a) The formation of tetraaqua copper (Il) ion in solution Cu2+ + 4H2O(l) = [Cu(H2O)4](aq) b) The reaction of ammonia with water. NH3(aq) + H2O(l) = NH4+ (aq) + OH(aq) c) The self ionization of water 2H2O(0) — H3O*(aq) + OH(aq) d) The formation of copper (II) hydroxide [Cu(H20)4]2+ (aq) +...
please answer both questions
QUESTION 8 The compound ammonia, NH3, is a weak base when dissolved in water. Which of the following is the correct equation for the reaction of ammonia in water? a NH3(aq) + H20(0) NH4(aq) + OH(aq) NH3(aq) + OH(aq) NH2 (aq) + H20(0) NH3(aq) + H20(1) -NH2 (aq) + H30*(aq) NH3(aq) + H200) NH2 (aq) + H30(aq) NH3(aq) + H30aq) NH4+ (aq) + H20(0) QUESTION 9 What is the pH of a solution that is 0.17...
When NH3 is added to water, the following process occurs: NH3 (aq) + H2O (1) + NH4+ (aq) + OH- (aq) In this process, what is the role of NH3? Both an Arrhenius Base and a Bronsed-Lowry Base A Bronsted-Lowry Acid An Arrehenius Acid An Arrhenius Base A Bronsted-Lowry Base Molecular level views of three aqueous solutions (A, B, and C) are shown below (H20 molecules have been omitted for clarity, and because I'm lazy...): (A) (B) (C) + Which...
Quest. 4 (15 pts). Ammonia react with water as shown in the following equation: NH3(aq) + H2O(l) NH4+(aq) + OH(aq) Kb = 1.77 x 10-4 and Ka = 5.65 x 10-10 a) Calculate the pH of the 0.030 M NH solution (Use a labeled ICE table) b) Calculate the pH of the solution at the equivalent point (when equal amount on added. Assume the volume doubles). (Use a labeled ICE table) c) Over which pH range (actual numbers) do you...
Calculate the OH- concentration at equilibrium in the following reaction: NH3 (aq) + H20 (1) -> NH4+ (aq) + OH- (aq) (Kb = 1.8 x10^(-5) (1 point) O 1x10^(-14) M O2.7 x10^(-3) M O 7.2 x10^(-6) M O None of the above Question 15 Which of the following pH values indicates the most basic solution? (1 point)* O pH=12 O pH=4 O pH=8 O pH=9
+ NH3 H₂O OH NH4+ Given the chemical reaction above, NH3 would be classified as a O A strong acid O B. weak base O C. Strong base O D. weak acid QUESTION 11 When added to water, which of the following would produce an acid? OMgo Nao NH3 SO3 None of the above. 00000 QUESTION 12 taste. Liquids that have a basic pH can be identified by their O A. salty O B. sour O C. sweet O D....
Question 6 (1 point) What is the conjugate acid of NH3 NH3 NH4+ Он* NH2 Question 7 (1 point) The hydrogen ion concentration of a solution is 1 x 10-2 M. What is the pH of the solution, and is it acidic or basic? O pH-10, acidic pH-2, acidic
Question 1 5 pts With regard to Ca(OH)2 (aq) + 2HF (aq) <-->CaF2(s) + 2H,O (aq), in what direction, if any, would the equilibrium be shifted by addition of nitric acid no effect Right Left
I am sort of confused on what these are asking? An explination
of the concepts would really help, I will give thumbs up :)
3. Consider the following reactions: a) The formation of tetraaqua copper (Il) ion in solution Cu2+ + 4H2O(l) = [Cu(H2O)4](aq) b) The reaction of ammonia with water. NH3(aq) + H2O(l) = NH4+ (aq) + OH(aq) c) The self ionization of water 2H2O(0) — H3O*(aq) + OH(aq) d) The formation of copper (II) hydroxide [Cu(H20)4]2+ (aq) +...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 58 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago