Question 32 1 pt What is the name of the following structure? 0 Adenine HS-? -Nh-C-C-C-CH2-0-P-0-P-O-CH2...
Question 33 What is the name of the following structure? он сн. HS-CH2-CH-NH-C-CH-CH-NH-C- O Adenine -C OH CH, 0 0" H H H IO=O O-P O OH Coenzyme A Adenosine 3'-phosphate Pantothenic acid B-Mercaptoethylamine
3. The structure of nicotinamide adenine dinucleotide in its reduced form (NADH) is indicated here. CH2-O-P- 07 OH OH Он он a. Describe the structural relationship to of NADH to adenosine diphosphate (ATP). b. When NADH serves as a reductant (as it does in many biological applications), the compound delivers a hydride to the chemical species that to be reduced. Identify the source of hydride in NADH, and draw the structure of the oxidized form of NAD, the oxidized form...
Adenine 0-P=0 Thymine Lo O=r-o Sugar-phosphate backbone Sugar-phosphate backbone Cytosine O-P=0 Guanine 0 NH O=P-O 0-- Nitrogenous bases Where are the hydrogen bonds found in this DNA molecule? between C and H in the nucleotide cytosine between H in cytosine and O in guanine between N and H in the nucleotide containing guanine between H in guanine and N in cytosine
QUESTION 2 What is the common name of this molecule? CH3–CH2–CH2–CH–NH- QUESTION 4 What is the name of this molecule? CH, NHẠC–CH2–CH3 QUESTION 5 Which two reactants are needed to make this molecule? -C-NH₂ aniline and methyl amine O aniline and methanoic acid benzoic acid and ammonia benzoic acid and methyl amine
What is the IUPAC name of the following compound? (1 pt) O CH3-CH-CH2-C-OH 6-0
Experiment 5 Lewis Dot Structure Name 1. Lab day / time CIHO NH 6. 2. HS 7. Cho 3. NH₂ 8. C,H,O 4. CH 9. SiH,P 5. SiH,ci 10. C,H,N
Question 14 4 pts For the following fatty acid molecules, which of the following is correct? Oleic acid CH-(CH2)-CH=CH(CH2),COOH Lauric acid CHECH COOH Arachidonic acid CH3(CH2).CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH3),COOH Stearic acid CH-(CH2)76COOH Linoleic acid CH(CH2).CH=CHCH2CH=CH(CH2),COOH Oleic acid is a polyunsaturated fatty acid and lauric acid is a saturated fatty acid. O Both oleic acid and arachidonic acid are polyunsaturated fatty acids. Lauric acid is a saturated fatty acid and arachidonic acid is a polyunsaturated fatty acid. O Both lauric acid and stearic acid...
name the structure 1 NH 2 N N O=P-OCH 0 CH
3) What is the name of the nucleic acid below 0 0 5 O-P-OCH2 N" "O OH OH A. Adenosine 5'-monophosphate B. Guanosine-5'-monophosphate C. Cytidine-5'-monophosphate D. Uridine-5'-monophosphate E. Thymidine-5'-monophosphate
Question 13 Match each of the following organic compounds with its name A. CH3 -CH2--0--CH3 A. ethyl methyl ether B. propanal 0 11 CH3 CH2 C-H CI 0 C. 3-chloro-2 butanone D. ethanol CH3 CH--C--CH3 CH3-CH2-OH Question 18 CH3-CH2-O- CH2 - CH3 Which of the following active groups is present in the organic structure above A. aldehyde B. alcohol C. acid D. ketone E. ether