Complete the following reactions. (2 points each) a. b. ﹀NH2 1. NaNO2-H2SO4 2. CupC12 Δ (CH3)2CH...
Write the products of these reactions
-NH2 1. NaNO2, HCI 2. CuCN 1. N(CH3)3 2. Ag20, H20 3.A 1. LAIHA 2. H20 NaN3 1. LATHA 2. H2O NaCN 1. LIAH 2. H20 Br NaCN H. Ni HNO3 H2SO4 NaOH H20 1. NaNO2 HCI 2. HBF 4 CH3 HNO3 Na Cr207 H2SO4 H2SO4 Sn HCI 1. NaNO2 HCI 2. CuCN
1. Predict the product(s) for each of the following reactions: H2SO4 NH2 a. 0 1. H2N-NH2, H2S04, -H20 H 2. KOH/H2O b. MeOH, TsOH он H2O C. H2SO4, -H20 HO d. H2O, H30+ e. H20,H30+ 2. Predict the product and draw the full pushing arrow mechanism for the following reaction NH2 H20,H30+ a. b. 3. Devise an efficient synthesis for the following transformation. HO Br Br
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
14. (4 points each) Complete the following reactions showing the major organic product). 2 CH,NH CH CH,OH Ci pyridine 2. 2CH,NH2 Ci AICl I. excess CH,MgBr 2. H CH,CH,CH OH NaOH
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
Predict the major organic product
or products of each of the following reactions:
Identify the mechanism
taking place in each of the reactions and please provide
explanation.
H2SO4 a) (CHỊ) CH CH=CH, HO Hg(OAc)2 NaBH4 b) (CH3)2CH CH=CH2 H2O BH3: THE H2O2, NaOH c) (CH3),CH CH=CH2 H2SO4, H2O d) CHCECH HgSO4 HZ/Ni f) + Cl2 + H2O g) Cold KMnO4 dilute h) 1. CH CO-OH 2. Hz0 Br2 i) CC14
Which of the following compounds undergoes E2 reactions with the fastest rate? a. (CH3)2CH—Cl b. CH3CH2CH2—Cl c. CH3CH2CH2—I d. (CH3)2CH—I e. CH3CH2CH2—Br
7 (- j.) OH 1. NaNO2, HCl(aq) 2. HBF4 NH2 k.) OCH3 SO3 H2SO4 1.) CO2CH3 diazomethane CO2CH3 m.) ОН 1. NaNO2, HCl(aq) 2. CuBr, HBr(aq) NH2
Propose a mechanism for each of the following reactions: b. a. H2SO4 Δ Has ao ОН ОН
Draw the major product for each reaction. он. CH3 heat N(CH3)3 a. LiAIH4, Et20 b. H30*/H20 1. NaCN, DMSO Br 2. a. LiAIH4. THF b. H3O+/H2O 1. NaN3, DMSO Br 2. a. LiAIH4, THF b. H3O /H20 1. HNO3, H2SO4 2. SnCl2 3. Br2 4. a. HNO2, H2SO4 H3C b. H2PO2 NH2 1. NaNO2, HCI, H20 но 2. HBF4
which is the correct answer? give a mechanism
1) S: NH2 NaNO2, HCI A B -CH₃ SOET 2) LiAIHA 3) NaOH 1 N=N-OM MSH NH2 NH2 / CH CH CH3 Bd) NO2 NH2 -NEN NH2 CH3 CH3