Problem 7.4 One mole of Ar initially at 306 K undergoes an adiabatic expansion against a...
Problem 7.4
One mole of Ar initially at 306 K undergoes an adiabatic expansion against a pressure Pexternal = 0 from a volume of 8.5 L to a volume of 82.0 L.
Part A
Calculate the final temperature using the ideal gas equation of state. Assume CV,m = 3R/2.
Express your answer with the appropriate units.
Part B
Calculate the final temperature using the van der Waals equation of state. Assume CV,m = 3R/2.
Express your answer with the appropriate units.
Homework Answers
Add Answer to:
Problem 7.4
One mole of Ar initially at 306 K undergoes an adiabatic
expansion against a...
One mole of an ideal gas undergoes a reversible adiabatic expansion from T_1, to T_2 while...
One mole of an ideal gas undergoes a reversible adiabatic expansion from T_1, to T_2 while tripling the volume of the gas. What is the relation between T_1 and T-2? T-2/3 < T_1<T_2 T_2/3 < T_1 < T-2 T_1= T_2 T_2<T_1 T_1 lessthanorequalto T_2/3 One mole of Ar gas undergoes the reversible transformation shown. Assuming Ar behaves ideally, which statement is true for step 2? Delta U= C_p DeltaT DeltaH < Delta U Delat S= c_p ln(T_c/T_B) W = etaRt...
Initially, at a temperature T, and a molar volume vi, a van der Waals gas undergoes...
Initially, at a temperature T, and a molar volume vi, a van der Waals gas undergoes a change of state to the final temperature T2 and the molar volume V2. The van der Waals gas is characterized by the two parameters a and b (cf. Eq. (3.3)). a. Show that the change in molar entropy is As = c, In 72 + R In º2 = (3.62) 01 - 6 b. A volume of 1 dm is partitioned by a...
One mole of water vapor undergoes reversible isothermal expansion from 1.00 L to 10.00 L at...
One mole of water vapor undergoes reversible isothermal expansion from 1.00 L to 10.00 L at 250C. Calculate the amount of work performed if (a) the gas behaves ideally, and (b) the gas obeys the van der Waals equation with constants a = 5.54 dm6 bar mol-2 and b = 0.031 dm3 /mol please show all the step so I can understand
A sample containing 42.9 g of Ar is enclosed in a container of volume 8.06×10−2 L at 375 K. A) Calculate P using the ide...
A sample containing 42.9 g of Ar is enclosed in a container of volume 8.06×10−2 L at 375 K. A) Calculate P using the ideal gas equation of state. (Should be 415 bar) B) Calculate P using the van der Waals equation of state. (Should be 484 bar) C) Calculate P using the Redlich-Kwong equation of state.
14. A reversible heat engine of one mole of van der waals gas uses a four-step...
14. A reversible heat engine of one mole of van der waals gas uses a four-step cycle consisting of the following steps. Step 1: Adiabatic expansion until the volume with 4V Step 2: Constant-volume cooling Step 3: Adiabatic compression until V Step 4: Constant-volume heating Assume that the heat capacity is approximately constant within the CP,m 3 2, respectively operating temperature range and Cvm Calculate the total work in terms of temperature during one cycle.
14. A reversible heat engine of one mole of van der Waals gas uses a four-step...
14. A reversible heat engine of one mole of van der Waals gas uses a four-step cycle consisting of the following steps. Step 1: Adiabatic expansion until the volume with 4V Step 2: Constant-volume cooling Step 3: Adiabatic compression until v Step 4: Constant-volume heating Assume that the heat capacity is approximately constant within the Cp,m operating temperature range and respectively Cv.m Calculate the total work in terms of temperature during one cycle.
Parts iii) and iv) are the ones I need help with please :) (a) One mole of a monoatomic van der Waals gas obeys the equ...
Parts iii) and iv) are the ones I need help with please :)
(a) One mole of a monoatomic van der Waals gas obeys the equation of state and its internal energy is expressed as U where Cv is the molar apacity of an ideal gas. The gas is initially at pr isochoric heat c essure p and volume V Explain the physical meaning of the parameters a and b in the equation of state of the gas (ii) Write...
One mole of H20( is supercooled to-5.00°C at 1 bar pressure before freezing at that temperature....
One mole of H20( is supercooled to-5.00°C at 1 bar pressure before freezing at that temperature. Calculate ASys, ASum, and ASeotal for this process. Is it spontaneous? CPm (H20, 1)- 75.3 J/mol.K CPm (H20, s)-37.7 J/mol.K AHfusion 6.008 kJ/mol Hint: remember that ASs is computed using q along a reversible path, while ASur is computed using the actual heat transfer during the freezing. For the following equilibrium reaction: Here is an ICE table, starting from no moles of pure 0z...
2.85 moles of an ideal gas with CV,m=3R/2 undergoes the transformations described in the following list...
2.85 moles of an ideal gas with CV,m=3R/2 undergoes the transformations described in the following list from an initial state described by T = 310. K and P = 1.00 bar. Part A:The gas is heated to 600 K at a constant volume corresponding to the initial volume. Calculate q for this process. Express your answer with the appropriate units. Part B:The gas is heated to 600 K at a constant volume corresponding to the initial volume. Calculate w for...
(a) One mole of a monoatomic van der Waals gas obeys the equation of state A3. ) (V-b)=RT (p+ and its internal energy is expressed as U CvT where Cv is the molar isochoric heat capacity of an ideal g...
(a) One mole of a monoatomic van der Waals gas obeys the equation of state A3. ) (V-b)=RT (p+ and its internal energy is expressed as U CvT where Cv is the molar isochoric heat capacity of an ideal gas. The gas is initially at pressure p and volume V (i) Explain the physical meaning of the parameters a and b in the equation of state of the gas (ii) Write down the equation that defines entropy in thermodynamics. Define...
One mole of an ideal gas undergoes a reversible adiabatic expansion from T_1, to T_2 while tripling the volume of the gas. What is the relation between T_1 and T-2? T-2/3 < T_1<T_2 T_2/3 < T_1 < T-2 T_1= T_2 T_2<T_1 T_1 lessthanorequalto T_2/3 One mole of Ar gas undergoes the reversible transformation shown. Assuming Ar behaves ideally, which statement is true for step 2? Delta U= C_p DeltaT DeltaH < Delta U Delat S= c_p ln(T_c/T_B) W = etaRt...
Initially, at a temperature T, and a molar volume vi, a van der Waals gas undergoes a change of state to the final temperature T2 and the molar volume V2. The van der Waals gas is characterized by the two parameters a and b (cf. Eq. (3.3)). a. Show that the change in molar entropy is As = c, In 72 + R In º2 = (3.62) 01 - 6 b. A volume of 1 dm is partitioned by a...
14. A reversible heat engine of one mole of van der waals gas uses a four-step cycle consisting of the following steps. Step 1: Adiabatic expansion until the volume with 4V Step 2: Constant-volume cooling Step 3: Adiabatic compression until V Step 4: Constant-volume heating Assume that the heat capacity is approximately constant within the CP,m 3 2, respectively operating temperature range and Cvm Calculate the total work in terms of temperature during one cycle.
14. A reversible heat engine of one mole of van der Waals gas uses a four-step cycle consisting of the following steps. Step 1: Adiabatic expansion until the volume with 4V Step 2: Constant-volume cooling Step 3: Adiabatic compression until v Step 4: Constant-volume heating Assume that the heat capacity is approximately constant within the Cp,m operating temperature range and respectively Cv.m Calculate the total work in terms of temperature during one cycle.
Parts iii) and iv) are the ones I need help with please :)
(a) One mole of a monoatomic van der Waals gas obeys the equation of state and its internal energy is expressed as U where Cv is the molar apacity of an ideal gas. The gas is initially at pr isochoric heat c essure p and volume V Explain the physical meaning of the parameters a and b in the equation of state of the gas (ii) Write...
One mole of H20( is supercooled to-5.00°C at 1 bar pressure before freezing at that temperature. Calculate ASys, ASum, and ASeotal for this process. Is it spontaneous? CPm (H20, 1)- 75.3 J/mol.K CPm (H20, s)-37.7 J/mol.K AHfusion 6.008 kJ/mol Hint: remember that ASs is computed using q along a reversible path, while ASur is computed using the actual heat transfer during the freezing. For the following equilibrium reaction: Here is an ICE table, starting from no moles of pure 0z...
(a) One mole of a monoatomic van der Waals gas obeys the equation of state A3. ) (V-b)=RT (p+ and its internal energy is expressed as U CvT where Cv is the molar isochoric heat capacity of an ideal gas. The gas is initially at pressure p and volume V (i) Explain the physical meaning of the parameters a and b in the equation of state of the gas (ii) Write down the equation that defines entropy in thermodynamics. Define...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 2 minutes ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 19 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 20 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 34 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago