Homework Answers
Add Answer to:
5. (10 pts) A 1.00 L reaction vessel is filled with N204 (g) at a pressure...
At a particular temperature, Kp-0.39 for the reaction below. N204(g) 2 NO2(g) (a) A flask containing only N204 at an initial pressure of 4.8 atm is allowed to reach equilibrium. Calculate the equi...
At a particular temperature, Kp-0.39 for the reaction below. N204(g) 2 NO2(g) (a) A flask containing only N204 at an initial pressure of 4.8 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the gases. N2O4 NO2 atm (b) A flask containing only NO2 at an initial pressure of 9.6 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the gases. No2 (e) From your answers to parts (e) and (b), does it matter...
2. The following species exist in equilibrium: 2 NO2(g) N204 (g). 0.625 moles of N204 were...
2. The following species exist in equilibrium: 2 NO2(g) N204 (g). 0.625 moles of N204 were introduced into a 5.00 L vessel and was allowed to decompose until equilibrium was reached. At equilibrium, the concentration of N204 was 0.0750 M Calculate the Kc for the reaction.
Consider the decomposition of N204(g) into NO2(g). N204(g) = 2 NO2(g) kp = 47.9 at 400...
Consider the decomposition of N204(g) into NO2(g). N204(g) = 2 NO2(g) kp = 47.9 at 400 K Suppose that 1.00 atm of N204 decomposes and reaches equilibrium at 400 K. Determine the partial pressure of NO2 at equilibrium. 1.96 atm 0.922 atm 1.92 atm 0.960 atm 0.979 atm
22. The initial pressure of N204 = 0.14 atm and the initial pressure of NO2 =...
22. The initial pressure of N204 = 0.14 atm and the initial pressure of NO2 = 0.55 atm. If the Kp for the reaction is 4.32, what is the equilibrium pressure of the NO2 gas? N2O4 (g) 2 NO2 (g) a) 0.0949 atm b) 0.0451 atm c) 0.658 atm d) 0.640 atm e) 0.731 atm x = - -b + vb2 - 4ac 2a
A flask is charged with 1.800 atm of N2O4(g) and 1.00 atm of NO2(g) at 25...
A flask is charged with 1.800 atm of N2O4(g) and 1.00 atm of NO2(g) at 25 ∘C , and the following equilibrium is achieved: N2O4(g)⇌2NO2(g) After equilibrium is reached, the partial pressure of NO2 is 0.519 atm . 1A) What is the partial pressure of N2O4 at equilibrium? 1B) Calculate the value of Kp for the reaction. 1C) Calculate the value of Kc for the reaction.
number 8 please QUESTIONS For the equilibrium N204() 2 NO2(8), at 298 K, Kp = 0.15....
number 8 please
QUESTIONS For the equilibrium N204() 2 NO2(8), at 298 K, Kp = 0.15. For this reaction system, it is found that the partial pressure of N204 is 3.2 * 10 atm at equilibrium. What is the partial pressure of NO2 at equilibrium? a. 0.0022 atm b.21 atm c. 4.6 atm d. 0.0048 atm e. 0.069 atm QUESTION 9 Nitrogen trifluoride decomposes to form nitrogen and fluorine gases according to the following equation: 2 NF3(g) = N2(g) +...
A flask containing only N204 at an initial pressure of 4.5 atm is allowed to reach...
A flask containing only N204 at an initial pressure of 4.5 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the two gases, given Kp 0.25 at a particular temperature for the following reaction. Show your work in the space provided. 3. Noode) 2 NO2(g)
A rigid vessel containing only NO2 (g) is heated to 337 °C and allowed to come...
A rigid vessel containing only NO2 (g) is heated to 337 °C and allowed to come to equilibrium according to the following reaction: 2 NO2 (g) 22 NO(g) + O2 (g) The density of theresulting mixture is measured to be 0.520 g/L at a total pressure of 0.750 atm. What is the value of Kp? A) 0.13 atm B) 7.8 atm C) 0.65 atm D) 1.5 atm E) 1.3 atm
5.00 L flask is evacuated and 47.65 g of solid dinitrogen tetroxide, N204, is introduced at-196...
5.00 L flask is evacuated and 47.65 g of solid dinitrogen tetroxide, N204, is introduced at-196 ℃. The sample is then warmed to 25 °C during which time the N204 vaporizes and some of it dissociates to form brown NO2 gas. The pressure slowly increases until it stabilizes at 3.51 atm. a. Write the balanced reaction for the dissociation of N204 b. What would be the pressure in the flask at 25 °C if the gas were all N204? Number...
A flask is charged with 1.500atm of N2O4(g) and 1.00 atm NO2(g) at 25 degree C,...
A flask is charged with 1.500atm of N2O4(g) and 1.00 atm NO2(g) at 25 degree C, and the following equilibrium is achieved: N2O4(g) 2NO2 After equilibrium is reached, the partial pressure of NO2 is 0.519atm. Calculate the value of Kp for the reaction. Calculate Kc for the reaction.
At a particular temperature, Kp-0.39 for the reaction below. N204(g) 2 NO2(g) (a) A flask containing only N204 at an initial pressure of 4.8 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the gases. N2O4 NO2 atm (b) A flask containing only NO2 at an initial pressure of 9.6 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the gases. No2 (e) From your answers to parts (e) and (b), does it matter...
2. The following species exist in equilibrium: 2 NO2(g) N204 (g). 0.625 moles of N204 were introduced into a 5.00 L vessel and was allowed to decompose until equilibrium was reached. At equilibrium, the concentration of N204 was 0.0750 M Calculate the Kc for the reaction.
Consider the decomposition of N204(g) into NO2(g). N204(g) = 2 NO2(g) kp = 47.9 at 400 K Suppose that 1.00 atm of N204 decomposes and reaches equilibrium at 400 K. Determine the partial pressure of NO2 at equilibrium. 1.96 atm 0.922 atm 1.92 atm 0.960 atm 0.979 atm
22. The initial pressure of N204 = 0.14 atm and the initial pressure of NO2 = 0.55 atm. If the Kp for the reaction is 4.32, what is the equilibrium pressure of the NO2 gas? N2O4 (g) 2 NO2 (g) a) 0.0949 atm b) 0.0451 atm c) 0.658 atm d) 0.640 atm e) 0.731 atm x = - -b + vb2 - 4ac 2a
number 8 please
QUESTIONS For the equilibrium N204() 2 NO2(8), at 298 K, Kp = 0.15. For this reaction system, it is found that the partial pressure of N204 is 3.2 * 10 atm at equilibrium. What is the partial pressure of NO2 at equilibrium? a. 0.0022 atm b.21 atm c. 4.6 atm d. 0.0048 atm e. 0.069 atm QUESTION 9 Nitrogen trifluoride decomposes to form nitrogen and fluorine gases according to the following equation: 2 NF3(g) = N2(g) +...
A flask containing only N204 at an initial pressure of 4.5 atm is allowed to reach equilibrium. Calculate the equilibrium partial pressures of the two gases, given Kp 0.25 at a particular temperature for the following reaction. Show your work in the space provided. 3. Noode) 2 NO2(g)
A rigid vessel containing only NO2 (g) is heated to 337 °C and allowed to come to equilibrium according to the following reaction: 2 NO2 (g) 22 NO(g) + O2 (g) The density of theresulting mixture is measured to be 0.520 g/L at a total pressure of 0.750 atm. What is the value of Kp? A) 0.13 atm B) 7.8 atm C) 0.65 atm D) 1.5 atm E) 1.3 atm
5.00 L flask is evacuated and 47.65 g of solid dinitrogen tetroxide, N204, is introduced at-196 ℃. The sample is then warmed to 25 °C during which time the N204 vaporizes and some of it dissociates to form brown NO2 gas. The pressure slowly increases until it stabilizes at 3.51 atm. a. Write the balanced reaction for the dissociation of N204 b. What would be the pressure in the flask at 25 °C if the gas were all N204? Number...
A flask is charged with 1.500atm of N2O4(g) and 1.00 atm NO2(g) at 25 degree C, and the following equilibrium is achieved: N2O4(g) 2NO2 After equilibrium is reached, the partial pressure of NO2 is 0.519atm. Calculate the value of Kp for the reaction. Calculate Kc for the reaction.
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 1 minute from now -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 16 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 16 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 30 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago