Homework Answers
Answer
i) H2O2(g) ------> 2OH(g)
Explanation
Rate law = k [H2O2]
step1 involved H2O2 only as the reactant, step2 is involved OH also as reactant and step3 is not involved H2O2 as a reactant . So, step1 must be the rate determing steps.
Add Answer to:
13.108. 13.109. 13.102. A proposed mechanism for the decomposition of hydrogen peroxide consists of three elementary...
The following mechanism, proposed for the decomposition of hydrogen peroxide is composed of 2 elementary steps:...
The following mechanism, proposed for the decomposition of hydrogen peroxide is composed of 2 elementary steps: H2O2(aq) + I'(aq) > H2O(l) + 10 (aq) 10 (aq) + H2O2(aq) -> H2O(l) + O2(g) + I'(aq) The rate law predicted by the mechanism is slow fast a) rate = k [H2O2) b) rate =k [H202][I] c) rate =k [H2O2][10] d) rate = k [H202) [1]
The decomposition of hydrogen peroxide (H2O2(aq)) is proposed to follow a reaction mechanism of Step 1:...
The decomposition of hydrogen peroxide (H2O2(aq)) is proposed to follow a reaction mechanism of Step 1: H2O2(aq) + Br(aq)-H2O(l) + BrO (aq) Step 2: Bro (aq) + H2O2(aq),H2O(l) + O2(g) + Br(aq) What is the catalyst, and what is the effect of having a catalyst present? Periodic Table and Datasheet Br is the catalyst, and the reaction follows a faster pathway with Br than without BrO is the catalyst, and the reaction follows a faster pathway with Bro-than without Bro...
1. The mechanism for hydrogen peroxide decomposition is thought to occur in two step: step 1:...
1. The mechanism for hydrogen peroxide decomposition is thought to occur in two step: step 1: H2O2+ I ------> IO + H2O step 2: IO + H2O2 --------> I + H2O + O2 a. describe each step in the mechanism as unimolecular ,bimolecular or termolecular ? b. which species in the mechanism acts as an intermediate.? c. which species in the mechanism acts as catalyst.? d. what is the net reaction?
3. The decomposition of gaseous hydrogen peroxide to O2(g) and H2O(g) is a first-order reaction. Experimentally,...
3. The decomposition of gaseous hydrogen peroxide to O2(g) and H2O(g) is a first-order reaction. Experimentally, at a given temperature, the initial concentration of H2O2 was found to decease to one- half in 17.0 minutes. What fraction of the initial H2O2 would remain after 51 minutes?
The decomposition of hydrogen peroxide in dilute sodium hydroxide at 20 °C H2O2(aq) ------> H2O(l) +...
The decomposition of hydrogen peroxide in dilute sodium hydroxide at 20 °C H2O2(aq) ------> H2O(l) + ½ O2(g) is first order in H2O2 with a rate constant of 1.10×10-3min-1. If the initial concentration of H2O2 is 5.52×10-2 M, the concentration of H2O2 will be 1.56×10-2 M after _____ min have passed.
5) rate = K[A][B] Question 11 (1 point) The reaction mechanism proposed for the decomposition of...
5) rate = K[A][B] Question 11 (1 point) The reaction mechanism proposed for the decomposition of H202 H2O2 + 12 -> H2O + 10-1 (slow) H2O2 + 10-1 --> H2O + O2 + 12 (fast) Which statement is true? 1) The reaction is second order in 1 2) is an intermediate 3) The reaction is first order in and first order in H2O2. 4) 10 1 is a catalyst. 5) The reaction is zero order in ! Question 12110
The decomposition of hydrogen peroxide in dilute sodium hydroxide at 20 °C H2O2(aq)H2O(l) + ½ O2(g)...
The decomposition of hydrogen peroxide in dilute sodium hydroxide at 20 °C H2O2(aq)H2O(l) + ½ O2(g) is first order in H2O2 with a rate constant of 1.10×10-3 min-1. If the initial concentration of H2O2 is 5.66×10-2 M, the concentration of H2O2 will be 9.34×10-3 M after _______ min have passed.
In a study of the gas phase decomposition of hydrogen peroxide at 400 °C H2O2(g)----->H2O(g) +...
In a study of the gas phase decomposition of hydrogen peroxide at 400 °C H2O2(g)----->H2O(g) + ½ O2(g) the concentration of H2O2 was followed as a function of time. It was found that a graph of 1/[H2O2] versus time in seconds gave a straight line with a slope of 0.884 M-1 s-1 and a y-intercept of 7.04 M-1. Based on this plot, the reaction is _______zerofirstsecond order in H2O2 and the rate constant for the reaction is M-1 s-1.
The reaction mechanism that has been proposed for the decomposition of H2O2 by iodide ion is:...
The reaction mechanism that has been proposed for the decomposition of H2O2 by iodide ion is: H2O2 + I- → H2O + IO- (slow) H2O2 + IO- → H2O + O2 + I- (fast) Which one of the following statements is true? Select one: a. The reaction is second order with respect to I-. b. I- is an intermediate. c. The reaction is first order with respect to I-. d. IO- is a catalyst. e. The reaction is zero order...
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition...
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition of nitrous oxide: N20 (g) → N2 (g) + O (g) step 1 N20 (g) + O (g) - N2(g) + O2(g) step 2 Overall Reaction: 2 N20 (g) → 2N2 (g) + O2 (g) What is the molecularity of the first and second elementary steps of the mechanism? The first step is termolecular, and the second step is bimolecular, Both steps are bimolecular,...
The following mechanism, proposed for the decomposition of hydrogen peroxide is composed of 2 elementary steps: H2O2(aq) + I'(aq) > H2O(l) + 10 (aq) 10 (aq) + H2O2(aq) -> H2O(l) + O2(g) + I'(aq) The rate law predicted by the mechanism is slow fast a) rate = k [H2O2) b) rate =k [H202][I] c) rate =k [H2O2][10] d) rate = k [H202) [1]
The decomposition of hydrogen peroxide (H2O2(aq)) is proposed to follow a reaction mechanism of Step 1: H2O2(aq) + Br(aq)-H2O(l) + BrO (aq) Step 2: Bro (aq) + H2O2(aq),H2O(l) + O2(g) + Br(aq) What is the catalyst, and what is the effect of having a catalyst present? Periodic Table and Datasheet Br is the catalyst, and the reaction follows a faster pathway with Br than without BrO is the catalyst, and the reaction follows a faster pathway with Bro-than without Bro...
3. The decomposition of gaseous hydrogen peroxide to O2(g) and H2O(g) is a first-order reaction. Experimentally, at a given temperature, the initial concentration of H2O2 was found to decease to one- half in 17.0 minutes. What fraction of the initial H2O2 would remain after 51 minutes?
5) rate = K[A][B] Question 11 (1 point) The reaction mechanism proposed for the decomposition of H202 H2O2 + 12 -> H2O + 10-1 (slow) H2O2 + 10-1 --> H2O + O2 + 12 (fast) Which statement is true? 1) The reaction is second order in 1 2) is an intermediate 3) The reaction is first order in and first order in H2O2. 4) 10 1 is a catalyst. 5) The reaction is zero order in ! Question 12110
Question 7 1 pts The following two-step mechanism has been proposed for the gas phase decomposition of nitrous oxide: N20 (g) → N2 (g) + O (g) step 1 N20 (g) + O (g) - N2(g) + O2(g) step 2 Overall Reaction: 2 N20 (g) → 2N2 (g) + O2 (g) What is the molecularity of the first and second elementary steps of the mechanism? The first step is termolecular, and the second step is bimolecular, Both steps are bimolecular,...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 2 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago