For the following reaction CCl4 (g) → C(s) + 2 Cl2 (g) Ho = +95.7 KJ;...
For the following reaction CCl4 (g) → C(s) + 2 Cl2 (g) Ho = +95.7 KJ; So = +142.2 J/K 1) What is Go for this reaction at 25 C? 2) What is the equilibrium constant for this reaction at 100 C? I need help with number 2) why would you not recalculate delta G for the reaction because its at a different temperature than 25C?
Homework Answers
Add Answer to:
For the following reaction CCl4 (g) → C(s) + 2 Cl2 (g)
Ho = +95.7 KJ;...
The reaction CCl4--> C(graphite) + 2Cl2 has delta H= +95.7 kJ and delta S= +142.2 J/K...
The reaction CCl4--> C(graphite) + 2Cl2 has delta H= +95.7 kJ and delta S= +142.2 J/K at 25 degrees C. Calculate delta G.
Consider the reaction: 2Cl2(g) + SO2(g) -> SOCl2(g) + Cl2O(g) Cl2(g) SO2(g) SOCl2(g) Cl2O(g) (delta)Hof (kJ/mol):...
Consider the reaction: 2Cl2(g) + SO2(g) -> SOCl2(g) + Cl2O(g) Cl2(g) SO2(g) SOCl2(g) Cl2O(g) (delta)Hof (kJ/mol): 0 -296.8 -212.5 80.3 So (J/K*mol): 223.1 248.1 309.77 266.2 (delta)Gof (kJ/mol): 0 -300.13 -198.3 97.9 A) Use the given data to calculate (delta)Go for the reaction and state specifically if the reaction is product or reactant favored at equilibrium. B) At what temperature will (delta)Go change sign?
find the enthalpy change H for this reaction: CH4(g) + Cl2--> CCl4(g)+HCl Using the following Equations:...
find the enthalpy change H for this reaction: CH4(g) + Cl2--> CCl4(g)+HCl Using the following Equations: C(s)+H2(g)-->CH4 H= -74.6 kJ C(s) + Cl2(g)--> CCl4 H=-95.7 kJ H2(g)+Cl2(g)--> HCl H=-92.3 kJ
A) For the reaction 4HCl(g) + O2(g)---->2H2O(g) + 2Cl2(g) Delta H° = -114.4 kJ and Delta...
A) For the reaction 4HCl(g) + O2(g)---->2H2O(g) + 2Cl2(g) Delta H° = -114.4 kJ and Delta S° = -128.9 J/K The equilibrium constant for this reaction at 306.0 K is _______? Assume that Delta H° and DeltaS° are independent of temperature. B) For the reaction N2(g) + 3H2(g)---->2NH3(g) Delta H° = -92.2 kJ and Delta S° = -198.7 J/K The equilibrium constant for this reaction at 333.0 K is ___? Assume that Delta H° and Delta S° are independent of...
Calculate ΔHrxn for the following reaction: CH4 (g) + 4Cl2(g) → CCl4(g) + 4HCl(g) Using the...
Calculate ΔHrxn for the following reaction: CH4 (g) + 4Cl2(g) → CCl4(g) + 4HCl(g) Using the following reactions: C(s) + 2H2(g) → CH4(g) ∆H = -74.6 kJ C(s) + 2Cl2(g) → CCl4(g) ∆H = -95.7 kJ H2(g) + Cl2(g) → 2HCl(g) ∆H = -184.6 kJ
Calculate Δ Hrxn for the following reaction: CH4(g)+4Cl2(g)→CCl4(g)+4HCl(g) given these reactions and their ΔH values: C(s)C(s)H2(g)+++2H2(g)2Cl2(g)Cl2(g)→→→CH4(g),CCl4(g),2HCl(g),ΔH=−74.6...
Calculate Δ Hrxn for the following reaction: CH4(g)+4Cl2(g)→CCl4(g)+4HCl(g) given these reactions and their ΔH values: C(s)C(s)H2(g)+++2H2(g)2Cl2(g)Cl2(g)→→→CH4(g),CCl4(g),2HCl(g),ΔH=−74.6 kJΔH=−95.7 kJΔH=−184.6 kJ
For the reaction 2HBr(g) + Cl2(g)—>2HCl(g) + Brz(9) AH° = -81.1 kJ and AS° = -1.2...
For the reaction 2HBr(g) + Cl2(g)—>2HCl(g) + Brz(9) AH° = -81.1 kJ and AS° = -1.2 J/K The equilibrium constant for this reaction at 269.0 K is Assume that AHⓇ and AS are independent of temperature. Submit Answer Retry Entire Group 8 more group attempts remaining For the reaction N2(g) + 3H2(g) +2NH3(g) AH° = -92.2 kJ and A Sº = -198.7 JK The equilibrium constant for this reaction at 308.0 K is Assume that AHⓇ and AS are independent...
The equilibrium constant, Kp, for the following reaction is 1.57 at 600 K. CO(g) + Cl2(g)...
The equilibrium constant, Kp, for the following reaction is 1.57 at 600 K. CO(g) + Cl2(g) COCl2(g) If AH° for this reaction is -108 kJ, what is the value of Kp at 716 K? Ko For the reaction S(s,rhombic) + 2CO(g)- SO2(g) + 2C(s,graphite) AH° = -75.8 kJ and AS° = -167.6 J/K The equilibrium constant for this reaction at 305.0 K is Assume that AHⓇ and AS are independent of temperature.
Reaction X: ½ I2 (s) + ½ Cl2 (g) → ICl (g) ∆Hºf,RXN = 18 kJ...
Reaction X: ½ I2 (s) + ½ Cl2 (g) → ICl (g) ∆Hºf,RXN = 18 kJ mol-1RXN, ∆Sº298 = 78 J K-1 mol-1 Reaction Y: ½ I2 (s) + ½ Br2 (l) → IBr (g) ∆Hºf,RXN = 41 kJ mol-1RXN, ∆Sº298 = 124 J K-1 mol-1 Calculate the value of the equilibrium constant, Keq, for reaction X at 25ºC.
a) The equilibrium constant, Kc, for the following reaction is 9.52×10-2at 350 K. CH4(g) + CCl4(g)...
a) The equilibrium constant, Kc, for the following reaction is 9.52×10-2at 350 K. CH4(g) + CCl4(g) -> 2 CH2Cl2(g) Calculate the equilibrium concentrations of reactants and product when 0.251 moles ofCH4and 0.251 moles of CCl4are introduced into a 1.00 L vessel at 350 K. [ CH4] = M [ CCl4] = M [ CH2Cl2] = M b) The equilibrium constant, Kc, for the following reaction is 1.20×10-2 at 500 K. PCl5(g) ->PCl3(g) + Cl2(g) Calculate the equilibrium concentrations of reactant...
For the reaction 2HBr(g) + Cl2(g)—>2HCl(g) + Brz(9) AH° = -81.1 kJ and AS° = -1.2 J/K The equilibrium constant for this reaction at 269.0 K is Assume that AHⓇ and AS are independent of temperature. Submit Answer Retry Entire Group 8 more group attempts remaining For the reaction N2(g) + 3H2(g) +2NH3(g) AH° = -92.2 kJ and A Sº = -198.7 JK The equilibrium constant for this reaction at 308.0 K is Assume that AHⓇ and AS are independent...
The equilibrium constant, Kp, for the following reaction is 1.57 at 600 K. CO(g) + Cl2(g) COCl2(g) If AH° for this reaction is -108 kJ, what is the value of Kp at 716 K? Ko For the reaction S(s,rhombic) + 2CO(g)- SO2(g) + 2C(s,graphite) AH° = -75.8 kJ and AS° = -167.6 J/K The equilibrium constant for this reaction at 305.0 K is Assume that AHⓇ and AS are independent of temperature.
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 minute from now -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 48 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago