Predict whether pre-zygotic isolation is more likely to occur in sympatry or allopatry and explain why.
Predict whether pre-zygotic isolation is more likely to occur in sympatry or allopatry and explain why.
Homework Answers
Answer
Pre zygotic isolation is more likely to occur in sympatry it is due to reinforcement as reinforcement model states that as the time of evolution post zygotic barriers arise first due to the isolation of population in divergence manner. If they rejoin again then they still interbreed between themselves but their hybrids have a lower fitness. So according to the selection for reproductive isolation so selection has been taken place which is reinforced in divergent direction.
Add Answer to:
Predict whether pre-zygotic isolation is more likely to occur in
sympatry or allopatry and explain why.
Predict whether I2 is more likely to dissolve in carbon tetrachloride or in water. A. H2O...
Predict whether I2 is more likely to dissolve in carbon tetrachloride or in water. A. H2O B. CCl4
4. Predict whether each nuclide is more likely to decay by beta decay or positron emission a. Sb-...
4. Predict whether each nuclide is more likely to decay by beta decay or positron emission a. Sb-132 b. Te 139 C. Na - 20 d. Zr - 97
4. Predict whether each nuclide is more likely to decay by beta decay or positron emission a. Sb-132 b. Te 139 C. Na - 20 d. Zr - 97
Come up with a hypothesis why a certain mutation is more likely to occur in male...
Come up with a hypothesis why a certain mutation is more likely to occur in male meiosis or female meiosis. Consider the differences between male and female meiosis and how point mutations, inversions, or deletions can occur.
1) Where are deletions most likely to occur in this dystrrophin gene? 2) Explain why elevated...
1) Where are deletions most likely to occur in this dystrrophin gene? 2) Explain why elevated blood creatine kinase levels are a good proteomic marker for Duchenne muscular dystrophy. 3) Why is it more difficult to screen females for variants in the dystrophin gene? 4)In a muscle cell, where is the dystrophin protein located?
Which of the following mutations are more likely to occur based on their codons, group classifica...
Which of the following mutations are more likely to occur based
on their codons, group classifications, and structures?
4) (20 points) Which of the following mutations are more likely to occur (aka more conservative) based on their codons (show the codons and underline anysingle nucleotide changes), group classifications, and structures (draw or describe the structures)? Circle or underline the mutation you believe is more conservative and explain your choices. BE SURE TO EXPLAIN WHY THE LESS CONSERVATIVE MUTATION IS LESS...
2Does centrifugation occur early in a protein isolation/separation scheme or late in the scheme? 3 Why?
2Does centrifugation occur early in a protein isolation/separation scheme or late in the scheme? 3 Why?
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN...
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN WHY 'Br NaOH Water Heat B (CH₂), CHBr + CH₃ CH₂OH © von Br NCN ethanol, Water 3) ₂ C Br CH₂ CH₃ + Kt-OC (CH₂)₂ CH3)3 COH
4. Is this molecule aromatic? Explain why or why not. For each molecule below, predict whether...
4. Is this molecule aromatic? Explain why or why not. For each molecule below, predict whether the molecule would be expected to show aromatic character or not. Explain your answer in each case. 5. (f 6. Is this molecule aromatic, antiaromatic, or nonaromatic? Explain.
1. Predict whether the following reactions are likely to proceed by an E1 or E2 mechanism....
1. Predict whether the following reactions are likely to proceed
by an E1 or E2 mechanism. PLEASE show the mechanism and product of
the reaction!!!!
2. Explain each prediction.
Predicting mechanisms: E1 or E2? 1. Predict whether the following reactions are likely to proceed by an El or E2 mechanism. 2. Explain each prediction. Br co KOH H2O Br CH,CH,OH Br CH2CH OH CH,0/CH,OH Br
Predict major products and if the reaction cannot occur explain why (mechanisms would be much appreciated...
Predict major products and if the reaction cannot occur explain
why (mechanisms would be much appreciated as well)
HO Br 1.PPh 2. NaOCH3, 1. LiA 2. Hao DCC NH2
4. Predict whether each nuclide is more likely to decay by beta decay or positron emission a. Sb-132 b. Te 139 C. Na - 20 d. Zr - 97
4. Predict whether each nuclide is more likely to decay by beta decay or positron emission a. Sb-132 b. Te 139 C. Na - 20 d. Zr - 97
Which of the following mutations are more likely to occur based
on their codons, group classifications, and structures?
4) (20 points) Which of the following mutations are more likely to occur (aka more conservative) based on their codons (show the codons and underline anysingle nucleotide changes), group classifications, and structures (draw or describe the structures)? Circle or underline the mutation you believe is more conservative and explain your choices. BE SURE TO EXPLAIN WHY THE LESS CONSERVATIVE MUTATION IS LESS...
2Does centrifugation occur early in a protein isolation/separation scheme or late in the scheme? 3 Why?
& PREDICT Product b) state whether (Sni, Sn 2, E, Ez) is Most likely c) EXPLAIN WHY 'Br NaOH Water Heat B (CH₂), CHBr + CH₃ CH₂OH © von Br NCN ethanol, Water 3) ₂ C Br CH₂ CH₃ + Kt-OC (CH₂)₂ CH3)3 COH
4. Is this molecule aromatic? Explain why or why not. For each molecule below, predict whether the molecule would be expected to show aromatic character or not. Explain your answer in each case. 5. (f 6. Is this molecule aromatic, antiaromatic, or nonaromatic? Explain.
1. Predict whether the following reactions are likely to proceed
by an E1 or E2 mechanism. PLEASE show the mechanism and product of
the reaction!!!!
2. Explain each prediction.
Predicting mechanisms: E1 or E2? 1. Predict whether the following reactions are likely to proceed by an El or E2 mechanism. 2. Explain each prediction. Br co KOH H2O Br CH,CH,OH Br CH2CH OH CH,0/CH,OH Br
Predict major products and if the reaction cannot occur explain
why (mechanisms would be much appreciated as well)
HO Br 1.PPh 2. NaOCH3, 1. LiA 2. Hao DCC NH2
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 6 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 56 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago