Homework Answers
Add Answer to:
fill in the blank
Table 1 Secretes releasing hormone, which are sent to the... Produced in...
Exercise 18 Target(s) Hormone Anti-diuretic hormone ADH Gonadotropin- releasing hormone (GnRH) Thyroid stimulating hormone TSH Luteinizing...
Exercise 18 Target(s) Hormone Anti-diuretic hormone ADH Gonadotropin- releasing hormone (GnRH) Thyroid stimulating hormone TSH Luteinizing hormone (LH) oxytocin Luteinizing hormone Follicle-stimulating hormone (FSH) Growthhormone T,/T, Calcitonin Parathyroid hormone Aldosterone Cortisol Epinephrine and norepinephrine Insulin Glucagon Melatonin Estrogen Exercise 18 Hormone Source Target(s) Anti-diuretic hormone ADH Gonadotropin- releasing hormone (GnRH) Thyroid stimulating hormone TSH prolactin Luteinizing hormone (LH) oxytocin Luteinizing hormone Follicle-stimulating hormone (FSH) Growth hormone T,/T, Calcitonin Parathyroid hormone Aldosterone Cortisol Insulin Glucagon Melatonin Testosterone Estrogen Progesterone
HORMONE TABLE ASSIGNMENT ACTION HYPERACTIVITY UNDERACTIVITY HORMONE ORGAN HYPOTHALAMUS 1. GnRH 2. CRH 3. TRH 4. GHR...
HORMONE TABLE ASSIGNMENT ACTION HYPERACTIVITY UNDERACTIVITY HORMONE ORGAN HYPOTHALAMUS 1. GnRH 2. CRH 3. TRH 4. GHRH 5. PIF 6. Oxytocin 7. ADH 8 PITUITARY GH 9. TSH 10. ACTH 11 FSH 12. LH 13. Prolactin 14. MSH PINEAL 15. Melatonin THYROID 16. Thyroxine 17. Calcitonin PARATHYROID 18. PTH THYMUS 19. Thymosine 20. Epinephrine/Nor ADRENAL MEDULLA ADRENAL CORTEX Cortisol 21. 22. Aldosterone 23. DHEA 24. Glucagon PANCREAS 25. Insulin TESTES 26. Testosterone 27. Inhibin OVARIES 28. Estrogen 29. Progestorone SKIN...
TARGET CELLS ACTION DISEASE HORMONE WORKSHEET HYPO ANTERIOR PITUITARY CRH ACTH TRH TSH GnRH FSH GnRH...
TARGET CELLS ACTION DISEASE HORMONE WORKSHEET HYPO ANTERIOR PITUITARY CRH ACTH TRH TSH GnRH FSH GnRH LH PRH Prolactin GHRH GH POSTERIOR PITUITARY ADH (Anti-diuretic hormone) Oxytocin THYROID GLAND T3 Thyroxine (T4) Calcitonin ADRENAL GLAND CORTEX Cortisol (glucocorticoid) Aldosterone (mineralocorticoid) MEDULLA Epinephrine / NE PARATHYROID GLAND PTH (Parathyroid hormone) HEART ANP (Atrial natiuretic peptide) KIDNEYS Renin --> angiotensin --> aldosterone Erythropoietin PANCREAS B-islet cells Insulin a-islet cells Glucagon
Multiple-choice/True-false/Matching: 1. The thyroid parafollicular cells produce parathyroid hormone (PTH). a) true b) false 2. The...
Multiple-choice/True-false/Matching: 1. The thyroid parafollicular cells produce parathyroid hormone (PTH). a) true b) false 2. The sebaceous glands are examples of endocrine glands. a) true b) false 3. An exophthalmic goiter is caused by a deficiency of iodine. a) true b) false 4. Which pancreatic hormone acts to increase blood glucose levels? a) GHRH b) GnRH c) insulin d) FSH e) glucagon 5. The target organs for FSH are both the ovaries and the testes. a) true b) false 6....
27) 27) Gonadotropin-releasing hormone (GnRHD) regulates the release of A) thyrotropin-releasing hormone and thyvroid-stimulating hormone B)...
27) 27) Gonadotropin-releasing hormone (GnRHD) regulates the release of A) thyrotropin-releasing hormone and thyvroid-stimulating hormone B) follicle-stimulating hormone and luteinizing hormone. C) progesterone and prolactin D) prolactin and oxytocin. E) estrogen and testosterone. 28) 28) Which of the following characteristics is associated with hyposecretion of thyroid hormones? A) increased heart rate B) warm, flushed skin C) weight gain D) exophthalmos E) weight loss 29) The major secretory products of the zona glomerulosa of the adrenal cortex are A) catecholamines 29)...
11. For each of the following hormones indicate whether it is tropic, which endocrine structure secretes...
11. For each of the following hormones indicate whether it is tropic, which endocrine structure secretes it, what its major targets are, and how its release is regulated. Antidiuretic hormone Glucagon Prolactin Thyroid-stimulating hormone Growth hormone T3 GHRH ACTH Cortisol FSH & LH PIH Oxytocin Aldosterone Insulin Epinephrine
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin...
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin and calcitrone. B. Oxytocin and prolactin. C. Follicle stimulating hormone and luteinizing hormone D. Luteinizing hormone and oxytocin. E. Oxytocin, prolactin and luteinizing hormone. Which of the following have nontropic effects only? A. FSH B. LH C. MSH D. ACTH E. TSH All of the following are steroid hormones except A. Androgen. B. Cortisol. c. Estrogen. D. Testosterone. E. Insulin Which of the following...
1.The thyroid gland: shrinks when a person has goiter, which is caused by an iodide deficiency....
1.The thyroid gland: shrinks when a person has goiter, which is caused by an iodide deficiency. produces thyrotropin-releasing hormone. sequesters iodide from the diet, and synthesizes thyroxine and T3. produces thyroid-stimulating hormone. stores thyroxine for up to months in the thyrotropes. 2. Increasing the concentrations of which of the following would cause the largest increase in calcium concentrations in the extracellular fluid? activating osteoblasts increasing the plasma concentrations of parathyroid hormone and calcitonin activating the chondrocytes increasing the plasma concentrations...
7. Gonadot ropin-releasing hormone (GnRH) causes the release of what hormone A. Leuteinizing hormone (LH) B....
7. Gonadot ropin-releasing hormone (GnRH) causes the release of what hormone A. Leuteinizing hormone (LH) B. Thyroid-stimulating hormone (TSH) C. Somatostatin D. Growth hormone (GH) emzyme converts an inactive hormone called Anglotensinogen to A. ACE; Renin B. Renin; ACE 、C. Angiotensin I; ACE D. Renin; Angiotensin I 9. Which of the following is not a function of semen: A. Increases pH of reproductive tracts B. Causes secretion of testosterone C. Provides energy for sperm D. Activation and capacitation of sperm...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating hormone and Thyroid stimulating hormone b) Oxytocin and Antidiruetic hormone Oc) Prolactin and Human Growth hormons d) Prolactin and ACTH e) Melatonin stimulating hormone and Oxytocin Question 94 (1 point) Saved Which of the following plasma proteins plays a role in blood clotting?
Exercise 18 Target(s) Hormone Anti-diuretic hormone ADH Gonadotropin- releasing hormone (GnRH) Thyroid stimulating hormone TSH Luteinizing hormone (LH) oxytocin Luteinizing hormone Follicle-stimulating hormone (FSH) Growthhormone T,/T, Calcitonin Parathyroid hormone Aldosterone Cortisol Epinephrine and norepinephrine Insulin Glucagon Melatonin Estrogen Exercise 18 Hormone Source Target(s) Anti-diuretic hormone ADH Gonadotropin- releasing hormone (GnRH) Thyroid stimulating hormone TSH prolactin Luteinizing hormone (LH) oxytocin Luteinizing hormone Follicle-stimulating hormone (FSH) Growth hormone T,/T, Calcitonin Parathyroid hormone Aldosterone Cortisol Insulin Glucagon Melatonin Testosterone Estrogen Progesterone
HORMONE TABLE ASSIGNMENT ACTION HYPERACTIVITY UNDERACTIVITY HORMONE ORGAN HYPOTHALAMUS 1. GnRH 2. CRH 3. TRH 4. GHRH 5. PIF 6. Oxytocin 7. ADH 8 PITUITARY GH 9. TSH 10. ACTH 11 FSH 12. LH 13. Prolactin 14. MSH PINEAL 15. Melatonin THYROID 16. Thyroxine 17. Calcitonin PARATHYROID 18. PTH THYMUS 19. Thymosine 20. Epinephrine/Nor ADRENAL MEDULLA ADRENAL CORTEX Cortisol 21. 22. Aldosterone 23. DHEA 24. Glucagon PANCREAS 25. Insulin TESTES 26. Testosterone 27. Inhibin OVARIES 28. Estrogen 29. Progestorone SKIN...
TARGET CELLS ACTION DISEASE HORMONE WORKSHEET HYPO ANTERIOR PITUITARY CRH ACTH TRH TSH GnRH FSH GnRH LH PRH Prolactin GHRH GH POSTERIOR PITUITARY ADH (Anti-diuretic hormone) Oxytocin THYROID GLAND T3 Thyroxine (T4) Calcitonin ADRENAL GLAND CORTEX Cortisol (glucocorticoid) Aldosterone (mineralocorticoid) MEDULLA Epinephrine / NE PARATHYROID GLAND PTH (Parathyroid hormone) HEART ANP (Atrial natiuretic peptide) KIDNEYS Renin --> angiotensin --> aldosterone Erythropoietin PANCREAS B-islet cells Insulin a-islet cells Glucagon
Multiple-choice/True-false/Matching: 1. The thyroid parafollicular cells produce parathyroid hormone (PTH). a) true b) false 2. The sebaceous glands are examples of endocrine glands. a) true b) false 3. An exophthalmic goiter is caused by a deficiency of iodine. a) true b) false 4. Which pancreatic hormone acts to increase blood glucose levels? a) GHRH b) GnRH c) insulin d) FSH e) glucagon 5. The target organs for FSH are both the ovaries and the testes. a) true b) false 6....
27) 27) Gonadotropin-releasing hormone (GnRHD) regulates the release of A) thyrotropin-releasing hormone and thyvroid-stimulating hormone B) follicle-stimulating hormone and luteinizing hormone. C) progesterone and prolactin D) prolactin and oxytocin. E) estrogen and testosterone. 28) 28) Which of the following characteristics is associated with hyposecretion of thyroid hormones? A) increased heart rate B) warm, flushed skin C) weight gain D) exophthalmos E) weight loss 29) The major secretory products of the zona glomerulosa of the adrenal cortex are A) catecholamines 29)...
Which combination of hormones helps a mother to produce milk and nurse her baby? A. Prolactin and calcitrone. B. Oxytocin and prolactin. C. Follicle stimulating hormone and luteinizing hormone D. Luteinizing hormone and oxytocin. E. Oxytocin, prolactin and luteinizing hormone. Which of the following have nontropic effects only? A. FSH B. LH C. MSH D. ACTH E. TSH All of the following are steroid hormones except A. Androgen. B. Cortisol. c. Estrogen. D. Testosterone. E. Insulin Which of the following...
7. Gonadot ropin-releasing hormone (GnRH) causes the release of what hormone A. Leuteinizing hormone (LH) B. Thyroid-stimulating hormone (TSH) C. Somatostatin D. Growth hormone (GH) emzyme converts an inactive hormone called Anglotensinogen to A. ACE; Renin B. Renin; ACE 、C. Angiotensin I; ACE D. Renin; Angiotensin I 9. Which of the following is not a function of semen: A. Increases pH of reproductive tracts B. Causes secretion of testosterone C. Provides energy for sperm D. Activation and capacitation of sperm...
e) Progesterone Question 93 (1 point) Which hormones does the posterior pituitary produce? a) Follicle stimulating hormone and Thyroid stimulating hormone b) Oxytocin and Antidiruetic hormone Oc) Prolactin and Human Growth hormons d) Prolactin and ACTH e) Melatonin stimulating hormone and Oxytocin Question 94 (1 point) Saved Which of the following plasma proteins plays a role in blood clotting?
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 56 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago