Homework Answers
![K Plung of Rate = k [A] (c)² the values trial 1 to get 1.67x10-4 ms K (0.0im) (0.10m)2 k = 1.67x10 ms 6- Aus 10.dl) 10.1032m](http://img.homeworklib.com/questions/3c7240e0-5232-11eb-af09-a3a7cca1c921.png?x-oss-process=image/resize,w_560)
Add Answer to:
1. Shown below are the results of four separate experiments measuring reaction rate for the following...
Four experiments were conducted to discover how the initial rate of consumption of BrO3- ions in...
Four experiments were conducted to discover how the initial rate of consumption of BrO3- ions in the reaction BrO3-(aq) + 5Br-(aq) + 6H+(aq) à 3Br2(aq) + 3H2O(l) varies as the concentration of the reactants are changed. Use the data given below to determine the average rate constant and write the rate law for this reaction. Experiment [BrO3-] (M) [Br-] (M) [H+] (M) Initial rate (M/s) 1 0.10 0.10 0.10 0.0012 2 0.20 0.10 0.10 0.0024 3 0.10 0.30 0.10 0.0035...
The table below shows the initial rate of reaction (by measuring the rate of loss of...
The table below shows the initial rate of reaction (by measuring the rate of loss of Br2) for the following reaction at several different initial concentrations of reactants at 25oC: CH3COCH3 + Br2 H+(above arrow) → CH3COCH2Br + HBr Experiment [CH3COCH3] / M [Br2] /M [H+] /M Rate of loss of Br2 (M/s) 1 0.25 0.050 0.050 6.3 x 10-5 2 0.25 0.100 0.050 6.3 x 10-5 3 0.25 0.050 0.100 1.3 x 10-4 4 0.40 0.050 0.200 4.0 x...
solve. also which experiments do you use and why? + Y Z 5) Consider the following...
solve. also which experiments do you use and why?
+ Y Z 5) Consider the following reaction and data: X Experiment [X]. (M) [Y](M) 0.10 0.50 0.20 0.30 0.40 0.60 0.20 0.60 0.40 0.30 Initial Rate (M/s) 5.3 x 102 1.27 x 10' 1.02 x 10[21-[2]'=8 2.54 x 10-4 5.09 x 10 a) What is significant about an initial rate? You know the initial concentrations, know there is no quilibrium inppening, r it is the fastest, (73) b) Determine the...
1. For the reaction A + B + C D + E the following four experiments...
1. For the reaction A + B + C D + E the following four experiments
were performed. Determine the law of reaction.
1. Para la reacción A + B + C D + E se realizaron los siguientes cuatro experimentos. Determine la ley de reacción. (7 pts.) Experimento (AJM 0.12 0.36 0.12 0.12 [B] M 0.20 0.40 [C] M 0.50 0.25 0.25 0.25 TM/s 1.53 x 104 3.09 x 102 3.81 x 10-5 1.91 x 10 0.40 4 0.20...
Consider the equation: 2A + B → C The initial rate of reaction is measured at...
Consider the equation: 2A + B → C The initial rate of reaction is measured at several different concentrations of the reactants with the following results: [A] (M) [B] (M) Initial Rate (M/s) 0.40 0.10 0.026 0.10 0.10 0.026 0.40 0.20 0.103 (blank 1) What is the order with respect to reactant A? (write a number) (blank 2) What is the order with respect to B? (write a number) (blank 3) What is the value of the rate constant. Include...
need help with #3 please QUESTION 3 Determine the rate-law expression for the reaction below at...
need help with #3 please
QUESTION 3 Determine the rate-law expression for the reaction below at the temperature at which the tabulated initial rate data were obtained, rate- A + 2B + 3C - Products Experiment Initial [A] 0.10 M Initial [B] 0.20 M Initial [C] 0.10 M 0.40 M 0.20 M 0.10 M Initial Rate of Loss of A 4.0 x 10-2 Mmin 4.0 x 10-2 M/min 1.0 x 10- M'min 16x 10- Mmin 0.20 M 0.25 M 0.40...
For the reaction A+B+C→D+EA+B+C→D+E, the initial reaction rate was measured for various initial concentrations of reactants....
For the reaction A+B+C→D+EA+B+C→D+E, the initial reaction rate was measured for various initial concentrations of reactants. The following data were collected: Trials [A] (M) [B] (M) [C] (M) Initial rate (M/s) 1 0.20 0.20 0.20 6.0x10-5 2 0.20 0.20 0.60 1.8×10−4 3 0.40 0.20 0.20 2.4×10−4 4 0.40 0.40 0.20 2.4×10−4 Given the data calculated in Parts A, B, C, and D, determine the initial rate for a reaction that starts with 0.45 M of reagent A and 0.90 M...
21. Calculate the equilibrium concentration of the reactants and products if K·5.0 x 08 and initial, ulate the equi...
21. Calculate the equilibrium concentration of the reactants and products if K·5.0 x 08 and initial, ulate the equilibrium concentration of the reactants and products if K 5.0 x 10and ini the [A] = 2.0 M (7 pts) C(g) B(g) + A(g) ←→ pts) 22. Use the following kinetic data to determine the rate law for the reaction. (7 Initial Rate (mol/L s 3.3 Experiment Initial [NO2l(M) Initial [O21(M 0.40 0.10 1.7 0.20 0.10 1.7 0.20 0.20 23. Calculate the...
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) →...
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) → 2NOCIG) Initial rates of reaction are determined for various combinations of initial concentrations of reactants and recorded below; Trial Initial [NO] (mol/L) 0.10 0.10 0.20 Initial (C12] (mol/L) 0.10 0.20 0.20 Rate of production of NOCI (mol/L.s) 1.8 x 107 3.6 x 102 1.43 x 10" a) What is the rate law equation for the reaction? (1 mark) b) What is the rate-determining step?...
Bromate ions react with bromide ions and protons to form bromine and water. Broj + Br...
Bromate ions react with bromide ions and protons to form bromine and water. Broj + Br + _ H → _ Br2 + H2O a. Balance the reaction (Hint: it is a redox reaction) b. The initial rate is 5.4 x 10 mol/Ls when the initial concentrations of the reactants are: (Bro, J. = 0.20 M, (Br), = 0.10 M and [H]. = 0.15 M. When the [Br03 ). is changed to 0.10 M, the observed rate is 2.7 x...
solve. also which experiments do you use and why?
+ Y Z 5) Consider the following reaction and data: X Experiment [X]. (M) [Y](M) 0.10 0.50 0.20 0.30 0.40 0.60 0.20 0.60 0.40 0.30 Initial Rate (M/s) 5.3 x 102 1.27 x 10' 1.02 x 10[21-[2]'=8 2.54 x 10-4 5.09 x 10 a) What is significant about an initial rate? You know the initial concentrations, know there is no quilibrium inppening, r it is the fastest, (73) b) Determine the...
1. For the reaction A + B + C D + E the following four experiments
were performed. Determine the law of reaction.
1. Para la reacción A + B + C D + E se realizaron los siguientes cuatro experimentos. Determine la ley de reacción. (7 pts.) Experimento (AJM 0.12 0.36 0.12 0.12 [B] M 0.20 0.40 [C] M 0.50 0.25 0.25 0.25 TM/s 1.53 x 104 3.09 x 102 3.81 x 10-5 1.91 x 10 0.40 4 0.20...
need help with #3 please
QUESTION 3 Determine the rate-law expression for the reaction below at the temperature at which the tabulated initial rate data were obtained, rate- A + 2B + 3C - Products Experiment Initial [A] 0.10 M Initial [B] 0.20 M Initial [C] 0.10 M 0.40 M 0.20 M 0.10 M Initial Rate of Loss of A 4.0 x 10-2 Mmin 4.0 x 10-2 M/min 1.0 x 10- M'min 16x 10- Mmin 0.20 M 0.25 M 0.40...
21. Calculate the equilibrium concentration of the reactants and products if K·5.0 x 08 and initial, ulate the equilibrium concentration of the reactants and products if K 5.0 x 10and ini the [A] = 2.0 M (7 pts) C(g) B(g) + A(g) ←→ pts) 22. Use the following kinetic data to determine the rate law for the reaction. (7 Initial Rate (mol/L s 3.3 Experiment Initial [NO2l(M) Initial [O21(M 0.40 0.10 1.7 0.20 0.10 1.7 0.20 0.20 23. Calculate the...
3. Nitric oxide, NO(g) reacts with chlorine gas, Cl2(g), in the reaction 2NO(g) + Cl2(g) → 2NOCIG) Initial rates of reaction are determined for various combinations of initial concentrations of reactants and recorded below; Trial Initial [NO] (mol/L) 0.10 0.10 0.20 Initial (C12] (mol/L) 0.10 0.20 0.20 Rate of production of NOCI (mol/L.s) 1.8 x 107 3.6 x 102 1.43 x 10" a) What is the rate law equation for the reaction? (1 mark) b) What is the rate-determining step?...
Bromate ions react with bromide ions and protons to form bromine and water. Broj + Br + _ H → _ Br2 + H2O a. Balance the reaction (Hint: it is a redox reaction) b. The initial rate is 5.4 x 10 mol/Ls when the initial concentrations of the reactants are: (Bro, J. = 0.20 M, (Br), = 0.10 M and [H]. = 0.15 M. When the [Br03 ). is changed to 0.10 M, the observed rate is 2.7 x...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 11 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 42 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago