Which of the following the correct expression of Q for the following reaction
2 CH3OH(g) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l)
a. [CH3OH]2[O2]3/[CO2]2[H2O]4
b. [CH3OH]2[O2]3/[CO2]2
c. [CO2]2/[CH3OH]2[O2]3
d. [CO2]2[H2O]4/[CH3OH]2[O2]3
e. (2[CH3OH])(3[O2])/(2[CO2])(4[H2O])
Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) +...
For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) How much energy in kilojoules will be released when 250 g of CH3OH undergo combustion? (M.M. (CH3OH) = 32.04) a)11337 kJ b)5669 kJ c)2834 kJ d)726.5 kJ e)1453 kJ
Methanol, CH3OH (l), combusts according to the following equation: 2 CH3OH (l) + 3 O2 (g) → 2 CO2 (g) + 4 H2O (l) ∆rHo (298 K) = −1452 kJ Here is a list of Entropies of formation: S (J K-1 mol-1) at 298 K CH3OH (l) =126.8 O2 (g) = 205.14 CO2 (g) = 213.74 H2O = (l) 69.91 (a) If the above reaction was used in a fuel cell, say, to perform work, what will be the maximum...
1) What is the correct mathematical expression for the reaction quotient, Qc, for the following reaction: CH(E) + 2O2(g) = CO2(g) + 2H20 (1) [CH][02] [CO2][H2012 [CH][02] [CO2] L = LIQUID (CO2) [CH][0212 (d) 1C02) P2012 [CH][02] e) None of the above. 2) A change of pressure has no effect on which of the following reactions at equilibrium? 1) 2502(g) + O2(g) = 2503(8) 2) 4NH3(g) +502(g) = 4NO(g) + 6H2O(g) 3) CH2(g) + Cl2(g) = CH2Cl(g) + HCl(g) 4)...
What is the correct equilibrium constant expression for the following reaction? C4H10(g) + 132132 O2(g) ↽−−⇀↽−−⇀ 4 CO2(g) + 5 H2O(g)
Which is the correct equilibrium constant expression for the following reaction? 2 NaHCO3(s) Na2CO3(s) + CO2(g) + H2O(g) O A. Kc=[Na2CO3] / [NaHCO3)2 O B. Kc = [NaHCO3] 2 / [Na2CO3][ CO2][ H20] O C. Kc = [ CO2][ H20] OD. Kc = [Na2CO3][ CO2][ H20] / [NaHCO3)2
Calculate G° for each reaction at 298K using G°f values. 2 CH3OH(g) + 3 O2(g) 2 CO2(g) + 4 H2O(g) kJ
Write the expression for the reaction quotient, Qc, for each of the following reactions: 4 NH3(g) + 5 O2(g) ⇌ 4 NO(g) + 6 H2O(g) CH4(g) + 2 O2(g) ⇌ CO2(g) + 2 H2O(l)
10. Given the themochemical equation for the combustion of methanol. 2 CH3OH(g) + 3 O2(g) ® 2 CO2(g) + 4 H2O(l) DrH = −1453 kJ/mol reaction d. Review the units “kJ/mol reaction”. What does “mole reaction” mean? e. If you produce 857 kJ of heat, how many “mole reactions” occurred? f. Relate the energy of the “mole reaction” to moles of methanol and determine the mass (in grams) of methanol needed.
Which is the correct equilibrium constant expression for the following reaction? 2 NaHCO3(s) +- Na2CO3(s) + CO2(g) + H2O(g) O A. Kc = [Na2CO3]/[NaHCO3)2 O B. Kc = [NaHCO3]2/[Na2CO3][ CO2][ H20] OC. Kc = [CO2][ H20]
AH = -727 kJ Given that CH3OH (1) + 3/2 O2 (g) → CO2 (g) + 2 H2O(1) CO(g) + 1/2O2 (g) → CO2 (9) CH3OH(1) → CH3OH(g) AH = -284 kJ AH = 38 kJ H20 (1)→ H20 (9) AH = 44 kJ what is AH, in kJ, for the reaction CH3OH (g) + O2(g) →CO (g) + 2 H2O (9)