What is the correct equilibrium constant expression for the following reaction?
C4H10(g) + 132132 O2(g) ↽−−⇀↽−−⇀ 4 CO2(g) + 5 H2O(g)
What is the correct equilibrium constant expression for the following reaction? C4H10(g) + 132132 O2(g) ↽−−⇀↽−−⇀...
Which of the following is the equilibrium constant expression for the reaction: 2NO(g) + O2(g) - 2NO2(8) [NO] A. Kod [NO] [02] [no] [NO] [02] [NO] [NOJ +[02] 2[NO] D. K. INO]+[02] E. None of the choices are correct. Option A Option B
qUESTION 4 Which of the following expressions is the correct equilibrium-constant expression for the reaction below? P4O10(s) ⇌ P4(s) + 5 O2(g) [O2]-5 [O2]5
Which is the correct equilibrium constant expression for the following reaction? 2 NaHCO3(s) Na2CO3(s) + CO2(g) + H2O(g) O A. Kc=[Na2CO3] / [NaHCO3)2 O B. Kc = [NaHCO3] 2 / [Na2CO3][ CO2][ H20] O C. Kc = [ CO2][ H20] OD. Kc = [Na2CO3][ CO2][ H20] / [NaHCO3)2
Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) a. [CH3OH]2[O2]3/[CO2]2[H2O]4 b. [CH3OH]2[O2]3/[CO2]2 c. [CO2]2/[CH3OH]2[O2]3 d. [CO2]2[H2O]4/[CH3OH]2[O2]3 e. (2[CH3OH])(3[O2])/(2[CO2])(4[H2O])
Which is the correct equilibrium constant expression for the following reaction? 2 NaHCO3(s) +- Na2CO3(s) + CO2(g) + H2O(g) O A. Kc = [Na2CO3]/[NaHCO3)2 O B. Kc = [NaHCO3]2/[Na2CO3][ CO2][ H20] OC. Kc = [CO2][ H20]
Consider the following unbalanced equation: O2(g) + C4H10(g) → CO2(g) + H2O(l) If 3.56×102 moles of O2(g) and 47.3 moles of C4H10(g) are allowed to react to produce 1.10×102 moles of CO2(g), what is the percent yield of the reaction? 29.2% 58.1% 89.5% 89.9% 65.7%
1. Write the equilibrium expression for KP for this reaction: CH3CH2OH (l) + 3 O2 (g) ⇌ 2 CO2 (g) + 3 H2O (g)
The balanced equation for the combustion of butane, C4H10, is 2 C4H10(g) + 13 O2(g) → 8 CO2(g) + 10 H2O(g) Calculate the moles of CO2 produced when 3.48 moles of C4H10 are allowed to react with 13.46 moles of O2
What is the equilibrium constant expression for the following reaction? 2 N 2O 5( g) 4 NO 2( g) + O 2( g) Keq = [NO2]4 [O2]2 / [N2O5]2 Keq = [N2O5]2 / [NO2]4 [O2]2 Keq = [N2O5]2 / [NO2]4 [O2] Keq = [NO2]4 [O2] / [N2O5]2 none of the above
a. 14. What is the correct equilibrium constant expression for the following reaction? CO2(g) + 2H2O(8) CH4(g) + 2O2(g) Poo, PH₂O PcH, X PO, Рcн, хро, K= b. Pool x Pн,о c. K= Pch, *(Po,) Pco, x (Ph,0) Pco, (P2,0) Pch, *(Po,) d. 1 K- e, none of the above