Homework Answers
Add Answer to:
1. Which of the following real gases has the largest isobaric heat capacity, Cp: a) He...
46) All of the following have free energy of formation values of zero except a) Li...
46) All of the following have free energy of formation values of zero except a) Li (s) b) He (8) c) N (6) d) F2 (g) HF (B) If a process is both endothermic and spontaneous, then a) AU is less than 0 b) AH is less than 0 c) AG is greater than 0 d) AS is greater than 0 e) AH is equal to 0 48) The combination that always gives a spontaneous process is_ a) b) c)...
Chemistry midterm help please! <3 7. What is the difference between the AU and AH of...
Chemistry midterm help please! <3
7. What is the difference between the AU and AH of a reaction? A) AU is a state function, while AH is not a state function B) AH is a state function, while AU is not a state function. C) AU = heat of reaction at constant volume conditions; AH = heat of reaction at constant-pressure conditions D) AU is the heat of reaction, AH is the work done by the reaction E) AU =...
1. Out of the following, which system is decreasing in entropy? a. CH,OH,) → CH2OH() C....
1. Out of the following, which system is decreasing in entropy? a. CH,OH,) → CH2OH() C. N2(g) + O2(g) → 2 NOG) b. NaClg) → Nataq) + Clian) d. 2 NO26) ► N20419 2. Which of the following is always spontaneous? a. C2H01) + 302(g) → 2CO2(g) + 3H2O(g) AH<0 b. Sublimation of solid CO2 C. Water freezing d. The formation of water from gaseous hydrogen and oxygen e. None of the above 3. Will liquid water evaporate at room...
1) Which of the following processes would be expected to have the largest increase in ?Srxn...
1) Which of the following processes would be expected to have the largest increase in ?Srxn per mole of benzene? a) C6H6(l) + Cl2(g) ? C6H5Cl(l) + HCl(g) b) C6H6(l) + 15/2 O2(g) ? 6CO2(g) + 3H2O(g) c) C6H6(s) ? C6H6(g) d) 6H6(s) ? C6H6(l) e) C6H6(l) + 9/2 O2(g) ? 6CO(g) + 3H2O(g) 2) The heat of fusion of acetic acid is 11.5 kJ/mol. Its melting point is 16.6 oC. The change in entropy for the melting of acetic acid in...
NEED HELP ASAP 1-4 and has a question. 1) A chemical reaction that releases heat to the surroundings is said to be _...
NEED HELP ASAP 1-4
and has a question. 1) A chemical reaction that releases heat to the surroundings is said to be _AH at constant pressure. A) endothermic, positive B) endothermic, negative C) exothermic, positive D) exothermic, neutral E) exothermic, negative kJ of heat are transferred when 161.8 2) The value of AHº for the reaction below is -72 kJ. g of HBr is formed in this reaction. H2(g) + Br2 (g) → 2HBr (g) A) 54 B) 36 C)...
I need help with question 22? 16 the lab and turn two identical heating U heat...
I need help with question 22?
16 the lab and turn two identical heating U heat 100 of pure water and 100 of me 5 are at room temperature, Aer couple of minutes of we temperature of methanol is higher than that of water. What is observation? a Liquid water has a higher boiling point than liquid methano b. Liquid methanol has a higher boiling point than liquid C. Liquid waterS our cheal capacithan d. Liquid methanol has a higher...
Answer the following questions A. Multiple Choices (16 point each) 1. Which of the following is...
Answer the following questions
A. Multiple Choices (16 point each) 1. Which of the following is stro (A) , AS (B) 4. 0, AS (C) , AS (D) 4. 0, AS 2. Consider the following reaction NH.NO, OS) HOD) NIN Which of the following is (ar) true about this reaction GUNAH (A) the reaction is endothermis c hungsbe (B) This reaction must use the entry of the universet (C) This reaction is spontaneously low temperature (D) This reaction will reaction...
Multiple Choice - Circle the correct answer below each question (3 points cach) 1. Which of...
Multiple Choice - Circle the correct answer below each question (3 points cach) 1. Which of the following would you expect to have the highest boiling point? a F b. CI: CBE c. All of the above have the same boiling point 2. For which one of the following reactions is AH run equal to the heat of formation of the product? a. N2(g) + 3H2(g) - 2NH; (g) b. %N () + O2(g) - NO: () c. 6C(s) +...
Thermodynamics Practice Problems 1. Predict the sign of AS.(positive or negative) for the following reactions a...
Thermodynamics Practice Problems 1. Predict the sign of AS.(positive or negative) for the following reactions a 2 Mg(s) +,(@) 2 Mgo (s) AS b. CH206(s) → 2C,H,OH(I) + 2003(g) AS c. 2 NH3(g) + CO2(g) → H2O(l) + NH CONH3(aq) AS d. Cu(s) (at 100°C) → Cu(s) (at 25°C) AS 2. Which two variables can indicate if a reaction is spontaneous or not? 3. The second law of thermodynamics tells us that: a Energy is conserved. b. The entropy of...
8. For the following reaction, CC2(s) + 2H2O(l) + Ca(OH)2(s) + C2H2(g) which is spontaneous at all temperatures, on...
8. For the following reaction, CC2(s) + 2H2O(l) + Ca(OH)2(s) + C2H2(g) which is spontaneous at all temperatures, one would predict that a. AG is positive for all temperatures. d. AH is - and AS is for the reaction. b. AH is + and AS is for the reaction. e. AH is + and AS' is- for the reaction. c. AH is - and AS is for the reaction. 9. Calculate the standard absolute entropy, in J/mol K. of Mg:...
46) All of the following have free energy of formation values of zero except a) Li (s) b) He (8) c) N (6) d) F2 (g) HF (B) If a process is both endothermic and spontaneous, then a) AU is less than 0 b) AH is less than 0 c) AG is greater than 0 d) AS is greater than 0 e) AH is equal to 0 48) The combination that always gives a spontaneous process is_ a) b) c)...
Chemistry midterm help please! <3
7. What is the difference between the AU and AH of a reaction? A) AU is a state function, while AH is not a state function B) AH is a state function, while AU is not a state function. C) AU = heat of reaction at constant volume conditions; AH = heat of reaction at constant-pressure conditions D) AU is the heat of reaction, AH is the work done by the reaction E) AU =...
1. Out of the following, which system is decreasing in entropy? a. CH,OH,) → CH2OH() C. N2(g) + O2(g) → 2 NOG) b. NaClg) → Nataq) + Clian) d. 2 NO26) ► N20419 2. Which of the following is always spontaneous? a. C2H01) + 302(g) → 2CO2(g) + 3H2O(g) AH<0 b. Sublimation of solid CO2 C. Water freezing d. The formation of water from gaseous hydrogen and oxygen e. None of the above 3. Will liquid water evaporate at room...
NEED HELP ASAP 1-4
and has a question. 1) A chemical reaction that releases heat to the surroundings is said to be _AH at constant pressure. A) endothermic, positive B) endothermic, negative C) exothermic, positive D) exothermic, neutral E) exothermic, negative kJ of heat are transferred when 161.8 2) The value of AHº for the reaction below is -72 kJ. g of HBr is formed in this reaction. H2(g) + Br2 (g) → 2HBr (g) A) 54 B) 36 C)...
I need help with question 22?
16 the lab and turn two identical heating U heat 100 of pure water and 100 of me 5 are at room temperature, Aer couple of minutes of we temperature of methanol is higher than that of water. What is observation? a Liquid water has a higher boiling point than liquid methano b. Liquid methanol has a higher boiling point than liquid C. Liquid waterS our cheal capacithan d. Liquid methanol has a higher...
Answer the following questions
A. Multiple Choices (16 point each) 1. Which of the following is stro (A) , AS (B) 4. 0, AS (C) , AS (D) 4. 0, AS 2. Consider the following reaction NH.NO, OS) HOD) NIN Which of the following is (ar) true about this reaction GUNAH (A) the reaction is endothermis c hungsbe (B) This reaction must use the entry of the universet (C) This reaction is spontaneously low temperature (D) This reaction will reaction...
Multiple Choice - Circle the correct answer below each question (3 points cach) 1. Which of the following would you expect to have the highest boiling point? a F b. CI: CBE c. All of the above have the same boiling point 2. For which one of the following reactions is AH run equal to the heat of formation of the product? a. N2(g) + 3H2(g) - 2NH; (g) b. %N () + O2(g) - NO: () c. 6C(s) +...
Thermodynamics Practice Problems 1. Predict the sign of AS.(positive or negative) for the following reactions a 2 Mg(s) +,(@) 2 Mgo (s) AS b. CH206(s) → 2C,H,OH(I) + 2003(g) AS c. 2 NH3(g) + CO2(g) → H2O(l) + NH CONH3(aq) AS d. Cu(s) (at 100°C) → Cu(s) (at 25°C) AS 2. Which two variables can indicate if a reaction is spontaneous or not? 3. The second law of thermodynamics tells us that: a Energy is conserved. b. The entropy of...
8. For the following reaction, CC2(s) + 2H2O(l) + Ca(OH)2(s) + C2H2(g) which is spontaneous at all temperatures, one would predict that a. AG is positive for all temperatures. d. AH is - and AS is for the reaction. b. AH is + and AS is for the reaction. e. AH is + and AS' is- for the reaction. c. AH is - and AS is for the reaction. 9. Calculate the standard absolute entropy, in J/mol K. of Mg:...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 22 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago