Homework Answers
Add Answer to:
OH EtOH, H* OH Br 1, NaOH 2. HCI compound compound b poud c SOCh compound...
NaCN HCI, H20, heat SOCI compound b compound c compound a 1. LIATH 2. H2O compoundc...
NaCN HCI, H20, heat SOCI compound b compound c compound a 1. LIATH 2. H2O compoundc compound d compound e Work out the complete synthesis on a separate sheet of paper, and then draw the structure of compound a.
NaOH MyCro SOC compound a compound a compound b compound C compound e Mg, ether excess...
NaOH MyCro SOC compound a compound a compound b compound C compound e Mg, ether excess ca compoundf compound d k out the complete synthesis on a separate sheet of paper, and then draw the structure of compound e.
1. CO2 2. H20 Br Mg, ether SOCI2 compound a compound b compound c LI Cul...
1. CO2 2. H20 Br Mg, ether SOCI2 compound a compound b compound c LI Cul compound compound d compounde compoundf Work out the complete synthesis on a separate sheet of paper, and then draw the structure of compound 6. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. . Do not include lone pairs in your answer. They will not be considered in the grading. • Draw organometallic compounds as...
H2N OH Y. H2, Pd Br NaOH NaOH OBn Work through the above synthesis and draw...
H2N OH Y. H2, Pd Br NaOH NaOH OBn Work through the above synthesis and draw the structure of compound d. • You do not have to consider stereochemistry. Draw organometallic compounds as covalent molecules.
CH OH HO 100% Me CO-Et HB 2 H-O EtOH AcOH 68% Br T8 Me 77%...
CH OH HO 100% Me CO-Et HB 2 H-O EtOH AcOH 68% Br T8 Me 77% CH 0H 2 10% HCI in MeCN 1) TsCllpy 2) Nal LDA H (cat.) Me Me 75% CH-OH CH2 Me (8 6 Draw wedge/dash drawing of the following Fischer projection scheme 1-8 and assign the stereocenter(s) R or S absolute configuration
1. Og 2. (CH3), 3. H2C104 4. Excess EtOH, catalytic H2SO4 5. 0.5 equiv. NaOEVEOH 6....
1. Og 2. (CH3), 3. H2C104 4. Excess EtOH, catalytic H2SO4 5. 0.5 equiv. NaOEVEOH 6. Mild H30 ? an alkene Work out the synthesis on a separate sheet of paper, and then draw the structure of the final organic product of this series of reactions. You do not have to consider stereochemistry, • You do not have to explicitly draw H atoms. . Do not include lone pairs in your answer. They will not be considered in the grading....
6x. Fill in the missing items. 1.) CH3 Na BHз 2. HCI 1.)OH, H20 2.) H30®, heat * B. . .. 1.) NaOH, H20 2. NaOH, heat Na...
6x. Fill in the missing items. 1.) CH3 Na BHз 2. HCI 1.)OH, H20 2.) H30®, heat * B. . .. 1.) NaOH, H20 2. NaOH, heat NaCN CH3OH R но он Н,00 1.)LIAIH 4 , THE S 2. H,00
1. (sia)2BH 2. H2O2, NaOH 3. H2Cr04 4. SOCI2 5. H2C=CHCH2OH CECH Work out the above...
1. (sia)2BH 2. H2O2, NaOH 3. H2Cr04 4. SOCI2 5. H2C=CHCH2OH CECH Work out the above synthesis on a separate sheet of paper, and then draw the organic product of reaction 3. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. • Do not include lone pairs in your answer. They will not be considered in the grading. • Do not draw organic or inorganic by-products.
please help! will give rating. thank you! L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0....
please help! will give rating. thank you!
L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0. Brz P. Hz, Pd N. 1. KCN 2. LIAIHA 3. H2O ОН Q. NaOH, Bra B. 1, KCN 2. HCI 3. cat NaOH H2O S. NHA mild H+ I. NH3 NaBH3CN U. 1. CHgMgBr 2. H2O, H Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You...
1. HBr, H2O2 2. NaCN 3. HCI, H2O, heat 4. SOCI 5. NH3 6. LIAIH4 7....
1. HBr, H2O2 2. NaCN 3. HCI, H2O, heat 4. SOCI 5. NH3 6. LIAIH4 7. H20 Work out the synthesis on a separate sheet of paper, and then draw the structure of the final organic product. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. • Do not include lone pairs in your answer. They will not be considered in the grading. • Do not draw organic or inorganic by-products.
NaCN HCI, H20, heat SOCI compound b compound c compound a 1. LIATH 2. H2O compoundc compound d compound e Work out the complete synthesis on a separate sheet of paper, and then draw the structure of compound a.
NaOH MyCro SOC compound a compound a compound b compound C compound e Mg, ether excess ca compoundf compound d k out the complete synthesis on a separate sheet of paper, and then draw the structure of compound e.
1. CO2 2. H20 Br Mg, ether SOCI2 compound a compound b compound c LI Cul compound compound d compounde compoundf Work out the complete synthesis on a separate sheet of paper, and then draw the structure of compound 6. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. . Do not include lone pairs in your answer. They will not be considered in the grading. • Draw organometallic compounds as...
H2N OH Y. H2, Pd Br NaOH NaOH OBn Work through the above synthesis and draw the structure of compound d. • You do not have to consider stereochemistry. Draw organometallic compounds as covalent molecules.
CH OH HO 100% Me CO-Et HB 2 H-O EtOH AcOH 68% Br T8 Me 77% CH 0H 2 10% HCI in MeCN 1) TsCllpy 2) Nal LDA H (cat.) Me Me 75% CH-OH CH2 Me (8 6 Draw wedge/dash drawing of the following Fischer projection scheme 1-8 and assign the stereocenter(s) R or S absolute configuration
1. Og 2. (CH3), 3. H2C104 4. Excess EtOH, catalytic H2SO4 5. 0.5 equiv. NaOEVEOH 6. Mild H30 ? an alkene Work out the synthesis on a separate sheet of paper, and then draw the structure of the final organic product of this series of reactions. You do not have to consider stereochemistry, • You do not have to explicitly draw H atoms. . Do not include lone pairs in your answer. They will not be considered in the grading....
6x. Fill in the missing items. 1.) CH3 Na BHз 2. HCI 1.)OH, H20 2.) H30®, heat * B. . .. 1.) NaOH, H20 2. NaOH, heat NaCN CH3OH R но он Н,00 1.)LIAIH 4 , THE S 2. H,00
1. (sia)2BH 2. H2O2, NaOH 3. H2Cr04 4. SOCI2 5. H2C=CHCH2OH CECH Work out the above synthesis on a separate sheet of paper, and then draw the organic product of reaction 3. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. • Do not include lone pairs in your answer. They will not be considered in the grading. • Do not draw organic or inorganic by-products.
please help! will give rating. thank you!
L. 1.CH,Br 2. H,0 M. NaBH CH, OH 0. Brz P. Hz, Pd N. 1. KCN 2. LIAIHA 3. H2O ОН Q. NaOH, Bra B. 1, KCN 2. HCI 3. cat NaOH H2O S. NHA mild H+ I. NH3 NaBH3CN U. 1. CHgMgBr 2. H2O, H Determine the reagents necessary to carry out each of the following transformations. The reagent choices are listed in the text box above this question (reagents L-U). You...
1. HBr, H2O2 2. NaCN 3. HCI, H2O, heat 4. SOCI 5. NH3 6. LIAIH4 7. H20 Work out the synthesis on a separate sheet of paper, and then draw the structure of the final organic product. • You do not have to consider stereochemistry. • You do not have to explicitly draw H atoms. • Do not include lone pairs in your answer. They will not be considered in the grading. • Do not draw organic or inorganic by-products.
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 38 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 1 hour ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago