Homework Answers
Add Answer to:
Match the muscle with its description. A. Flexor of the wrist located on the side of...
Really need help! Thanks. 8-12. Complete the following table with at least one answer in each...
Really need help! Thanks. 8-12. Complete the following table with at least one answer in each box. Muscle Action Synergist Antagonist Extensor carpi radialis longus Abductor pollicis brevis none Flexor carpi ulnaris, flexor digitorum profundus and superficialis Laterally rotates and adducts humerus, stabilizes shoulder joint Abducts thumb none Teres major, supraspinatus Supinator Extensor carpi radialis longus and brevis Flexes phalanges, flexes wrist Triceps brachii Infraspinatus Flexes and abducts wrist Extensor carpi radialis longus and extensor carpi ulnaris Flexor pollicis brevis...
Date 1 What spinal nerve roots provide fibers to the brachial plexus? 2 Name the five...
Date 1 What spinal nerve roots provide fibers to the brachial plexus? 2 Name the five major peripheral nerves that originate from the brachial plexus. 3 For each of the muscles listed, indicate one major action that results when this muscle contracts. Use your textbook as a resource. Biceps brachii Brachialis Deltoid Extensor carpi flexion at the elbow radialis /ulnaris) Extensor digitorum Flexor carpi radialis (radialis/ ulnaris) Flexor digitorum (superficialis/ profundus) Infraspinatus Levator scapulae Rhomboideus Triceps brachii Serratus anterior Supraspinatus
12. Identify each lettered muscle in this illustration of the human posterior superficial musculature by matching...
12. Identify each lettered muscle in this illustration of the human posterior superficial musculature by matching its letter with one of the following muscle names: 1. adductor magnus 2. biceps femoris 3. brachialis 4. brachioradialis 5. deltoid 6. extensor carpi radualis longus 7. extensor carpi ulnaris 8. extensor digitorum 9. external oblique 10. flexor carpi ulnaris 11. gastrocnemius 12. gluteus maximus 13. gluteus medius 14. gracilis 15. iliotibial tract (tendon) 16. infraspinatus 17 latissimus dorsi 18. occipital belly of epicranius...
General Review! Muste Recym 11. Identify each lettered muscle in the illustration of the human anterior...
General Review! Muste Recym 11. Identify each lettered muscle in the illustration of the human anterior superficial musculature by matching its letter with one of the following muscle names 1. adductor longus 2. biceps brachii 3. brachioradialis 4. deltoid 34. tibialis anterior 35. transversus abdominis 36. trapezius 37. triceps brachi 38. vastus lateralis 39. vastus medialis 5. extensor digitorum longus 6. external oblique 7. fibularis longus 8. flexor carpi radialis 40. zygomaticus 9. flexor carpi ulnaris 10. frontal belly of...
atching Match each term listed on the left with its correct description on the right. 1....
atching Match each term listed on the left with its correct description on the right. 1. subclavian 2. superior mesenteric 3. popliteal 4. cephalic 5. common carotid 6. gonadal 7. valves 8. axillary 9. great saphenous 10. median cubital A. artery in armpit B. artery with three branches C. vein frequently used for obtai D. artery on right side only E. long vein of leg F. vein that carries deoxygenate G. artery to large intestine H. cerebral anastomosis I. long...
Date 1 What spinal nerve roots provide fibers to the brachial plexus? 2 Name the five major peripheral nerves that originate from the brachial plexus. 3 For each of the muscles listed, indicate one major action that results when this muscle contracts. Use your textbook as a resource. Biceps brachii Brachialis Deltoid Extensor carpi flexion at the elbow radialis /ulnaris) Extensor digitorum Flexor carpi radialis (radialis/ ulnaris) Flexor digitorum (superficialis/ profundus) Infraspinatus Levator scapulae Rhomboideus Triceps brachii Serratus anterior Supraspinatus
12. Identify each lettered muscle in this illustration of the human posterior superficial musculature by matching its letter with one of the following muscle names: 1. adductor magnus 2. biceps femoris 3. brachialis 4. brachioradialis 5. deltoid 6. extensor carpi radualis longus 7. extensor carpi ulnaris 8. extensor digitorum 9. external oblique 10. flexor carpi ulnaris 11. gastrocnemius 12. gluteus maximus 13. gluteus medius 14. gracilis 15. iliotibial tract (tendon) 16. infraspinatus 17 latissimus dorsi 18. occipital belly of epicranius...
General Review! Muste Recym 11. Identify each lettered muscle in the illustration of the human anterior superficial musculature by matching its letter with one of the following muscle names 1. adductor longus 2. biceps brachii 3. brachioradialis 4. deltoid 34. tibialis anterior 35. transversus abdominis 36. trapezius 37. triceps brachi 38. vastus lateralis 39. vastus medialis 5. extensor digitorum longus 6. external oblique 7. fibularis longus 8. flexor carpi radialis 40. zygomaticus 9. flexor carpi ulnaris 10. frontal belly of...
atching Match each term listed on the left with its correct description on the right. 1. subclavian 2. superior mesenteric 3. popliteal 4. cephalic 5. common carotid 6. gonadal 7. valves 8. axillary 9. great saphenous 10. median cubital A. artery in armpit B. artery with three branches C. vein frequently used for obtai D. artery on right side only E. long vein of leg F. vein that carries deoxygenate G. artery to large intestine H. cerebral anastomosis I. long...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 34 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago