Homework Answers
Add Answer to:
A measured conductance, G, of a sol'n at 25.0 °C is 87999 Consider a cell-constant, K,...
What impact would an increase in leak conductance (K+ LEAK CHANNELS) have on the temporal summati...
What impact would an increase in leak conductance (K+ LEAK CHANNELS) have on the temporal summation of EPSPs? Does this decrease/increase/cause no change in the delta Vm according to a Detla Vm vs. Time plot once the leak conductance is increased? CAPACITANCE IS HELD CONSTANT IN THIS ENTIRE PROBLEM. Hint: (Think of the Tm=RmCm time constant and how this is affected). My thought (PLEASE READ): I think this has something to do with the Rm (big Rm), related to the...
A standard solution of KCl is known to have a conductivity of κ=1.06296 x 10-8 S...
A standard solution of KCl is known to have a conductivity of κ=1.06296 x 10-8 S cm-1 and is used to standardise a conductance cell. A resistance reading, R of 4.2156 Ω is given. Calculate the cell constant, k showing all working. The same cell is then filled with a solution of HCl and a resistance of 1.0326 Ω is measured. Calculate the conductivity of this solution in S cm-1 showing all working.
H CE 0.03496 Na 0.00764 Ac 0.00501 0.00409 Questions 1. A conductivity cell has plane-parallel electrodes,...
H CE 0.03496 Na 0.00764 Ac 0.00501 0.00409 Questions 1. A conductivity cell has plane-parallel electrodes, each 2.2 cm x 2.2 cm in area, spaced 2.2 cm apart. When the cell is filled with an electrolyte, the measured conductance is found to be 2,745HS What is the conductivity of the solution? 2. The molar conductances at infinite dilution, o, of aqueous solutions of the strong electrolyte sodium ethanoate (or sodium acetate as it is more commonly known), hydrochloric acid and...
Consider the chemical equation and equilibrium constant at 25°C: 2COF(g) = CO2(g) + CF4(g), K =...
Consider the chemical equation and equilibrium constant at 25°C: 2COF(g) = CO2(g) + CF4(g), K = 2.2 x 106 Calculate the equilibrium constant for the following reaction at 25°C: 2C02(g) + 2CF (g) = 4C0F2(g) Express the equilibrium constant to two significant figures.
Consider the evaporation of methanol at 25.0 ?C: CH3OH(l)?CH3OH(g). A. Find ?G? at 25.0 ?C. B....
Consider the evaporation of methanol at 25.0 ?C: CH3OH(l)?CH3OH(g). A. Find ?G? at 25.0 ?C. B. Find ?G at 25.0 ?C under the following nonstandard conditions: (i)PCH3OH= 156.0mmHg . C. Find ?G at 25.0 ?C under the following nonstandard conditions: (ii) PCH3OH= 106.0mmHg . D. Find ?G at 25.0 ?C under the following nonstandard conditions: (iii) PCH3OH= 13.0mmHg .
Please explain, thank you! (4) Consider a cell at 298 K in which the reaction is Pb (s)+2H (aa-Pb2+ (ag) +H2 (g) (a) Cr ions are added to the Pb|Pb2+ half-cell to precipitate PbCh. The cell voltage is...
Please explain, thank you!
(4) Consider a cell at 298 K in which the reaction is Pb (s)+2H (aa-Pb2+ (ag) +H2 (g) (a) Cr ions are added to the Pb|Pb2+ half-cell to precipitate PbCh. The cell voltage is then measured to be +0.210 V. If [H]-1.0 M and the partial pressure of hydrogen is 1.0 atm, what is [Pb2*]? (answer: 1.57 x 103 M) (b) Calculate the Kp of PbCh if [Cl]-0.10 M in the PblPb2 half-cell. (answer: 1.57 x...
For the reaction A(l) <--->A(g), the equilibrium constant is 0.111 at 25.0◦C and 0.333 at 50.0◦C....
For the reaction A(l) <--->A(g), the equilibrium constant is 0.111 at 25.0◦C and 0.333 at 50.0◦C. Making the approximation that the variations in enthalpy and entropy do not change with the temperature, at what temperature will the equilibrium constant be equal to 2.00? (answer = 374 K)
A piece of iron (mass - 25.0 g) at 398 K is placed in a styrofoam...
A piece of iron (mass - 25.0 g) at 398 K is placed in a styrofoam coffee cup containing 25,0 mL of water at 298 K. Assuming that no heat is lost to the cup or the surroundings. what will the final temperature of the water be? The specific heat capacity of iron -0.449 JOC and water 4.18 Jig C O 308 K O 325K 348 K Loooo x x lowing reacu Hydrogen peroxide decomposes to water and oxygen at...
1. Consider the following kinetic data, collected at 25.0°C, for the reaction 2 NO(g+ Cl2 →...
1. Consider the following kinetic data, collected at 25.0°C, for the reaction 2 NO(g+ Cl2 → 2NOCI Experiment INOJ (M) 0.0300 0.0150 0.0150 ICI (M) 0.0100 0.0100 0.0400 Rate (M/s) 3.4 x 10 8.5 x 10 3.4 x 10 a. What is the reaction order with respect to NO? b. What is the reaction order with respect to CIZ? c. What is the overall reaction order? d. Determine the value of the rate constant, k (round to 2 sig figs).
The rate constant k for a certain reaction is measured at two different temperatures: temperature 397.0°C...
The rate constant k for a certain reaction is measured at two different temperatures: temperature 397.0°C 280.0°C k 1.1 x 1010 1.3 x 10° Assuming the rate constant obeys the Arrhenius equation, calculate the activation energy for this reaction. Round your answer to 2 significant digits. 0.
H CE 0.03496 Na 0.00764 Ac 0.00501 0.00409 Questions 1. A conductivity cell has plane-parallel electrodes, each 2.2 cm x 2.2 cm in area, spaced 2.2 cm apart. When the cell is filled with an electrolyte, the measured conductance is found to be 2,745HS What is the conductivity of the solution? 2. The molar conductances at infinite dilution, o, of aqueous solutions of the strong electrolyte sodium ethanoate (or sodium acetate as it is more commonly known), hydrochloric acid and...
Consider the chemical equation and equilibrium constant at 25°C: 2COF(g) = CO2(g) + CF4(g), K = 2.2 x 106 Calculate the equilibrium constant for the following reaction at 25°C: 2C02(g) + 2CF (g) = 4C0F2(g) Express the equilibrium constant to two significant figures.
Please explain, thank you!
(4) Consider a cell at 298 K in which the reaction is Pb (s)+2H (aa-Pb2+ (ag) +H2 (g) (a) Cr ions are added to the Pb|Pb2+ half-cell to precipitate PbCh. The cell voltage is then measured to be +0.210 V. If [H]-1.0 M and the partial pressure of hydrogen is 1.0 atm, what is [Pb2*]? (answer: 1.57 x 103 M) (b) Calculate the Kp of PbCh if [Cl]-0.10 M in the PblPb2 half-cell. (answer: 1.57 x...
A piece of iron (mass - 25.0 g) at 398 K is placed in a styrofoam coffee cup containing 25,0 mL of water at 298 K. Assuming that no heat is lost to the cup or the surroundings. what will the final temperature of the water be? The specific heat capacity of iron -0.449 JOC and water 4.18 Jig C O 308 K O 325K 348 K Loooo x x lowing reacu Hydrogen peroxide decomposes to water and oxygen at...
1. Consider the following kinetic data, collected at 25.0°C, for the reaction 2 NO(g+ Cl2 → 2NOCI Experiment INOJ (M) 0.0300 0.0150 0.0150 ICI (M) 0.0100 0.0100 0.0400 Rate (M/s) 3.4 x 10 8.5 x 10 3.4 x 10 a. What is the reaction order with respect to NO? b. What is the reaction order with respect to CIZ? c. What is the overall reaction order? d. Determine the value of the rate constant, k (round to 2 sig figs).
The rate constant k for a certain reaction is measured at two different temperatures: temperature 397.0°C 280.0°C k 1.1 x 1010 1.3 x 10° Assuming the rate constant obeys the Arrhenius equation, calculate the activation energy for this reaction. Round your answer to 2 significant digits. 0.
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago