Homework Answers
![3. N2 (g) +3H2 (g)>2NH, (g) K- Products INH,P reactants [N21[H2] 4. K 3.7x108 IN211.05x10M [H21 5.42x10-5 M [N2lH2l NH,P (1.0](http://img.homeworklib.com/questions/492956c0-6646-11eb-8817-75ee79f28ee6.png?x-oss-process=image/resize,w_560)
Add Answer to:
Write the equilibrium constant expression (K) for the following reaction: N_2(g) + 3H_2(g) doubleheadarrow 2NH_3(g) For...
For the reaction N_2 + 3h_2(g) <===> 2NH_3 (g) at 90 degree C, K_c = 1.27...
For the reaction N_2 + 3h_2(g) <===> 2NH_3 (g) at 90 degree C, K_c = 1.27 times 10^-3 Determine K_p for this system. R = 0.08206 L -atm/(mol-K)
Ammonia can be synthesized from nitrogen and hydrogen gases. N_2(g) + 3H_2(g) Rightarrow 2NH_3(g) If Delta...
Ammonia can be synthesized from nitrogen and hydrogen gases. N_2(g) + 3H_2(g) Rightarrow 2NH_3(g) If Delta H degree = -92.2 kJ and Delta S degree = - 0.1987 kJ/K, what is the value of Delta G degree in kJ for the reaction at 575 degree C. Your answer should be reported to 3 significant figures. Include a - sign if required, but do not include the unit.
PCl_5 decomposes according to the equation PCl_5(g) doubleheadarrow PCl_3(g) + Cl_2(g) At 700 K, a 2...
PCl_5 decomposes according to the equation PCl_5(g) doubleheadarrow PCl_3(g) + Cl_2(g) At 700 K, a 2 liter flask initially contained only 0.4600 mol PCl_3(g) and 0.6875 mol PCl_5(g). After reaching equilibrium, 0.00800 mol Cl_2(g) was measured in the flask. Calculate the equilibrium concentrations of the three gases and K_c for the reaction. For the reaction, 2 H_2S(g) 2 H_2(g) + S_2 (g), K_0 = 1.7 times 10^-7 at 800.0 degree C If the initial concentration of H_2S in a closed...
K_c for the reaction of hydrogen and iodine to produce hydrogen iodide, H_2(g)+I_2(g) doubleheadarrow 2HI(g) is...
K_c for the reaction of hydrogen and iodine to produce hydrogen iodide, H_2(g)+I_2(g) doubleheadarrow 2HI(g) is 54.3 at 430 degree C. Determine the initial and equilibrium concentration of H_2and I_2 are both 0.11 M and their equilibrium concentrations are both 0.048 M at 430 degree
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction...
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction the equilibrium will shift if: N_2 is added? H_2 is removed? NH_3 is added? NH_3 is removed? the volume of the container is decreased? the pressure is increased by adding Argon gas? the reaction is cooled? equal number of moles of H_2 and NH_3 are added? a catalyst is added The equilibrium constant for the following reaction is 5.0 at 400 degree C. CO_(g)...
help with questions please TA'[B Write the expression for the equilibrium constant for the following reactions:...
help with questions please
TA'[B Write the expression for the equilibrium constant for the following reactions: N204 (g) 2NO2 (g) N2 (9) + 3H2 (g) = 2NH3 (9) Solids are not included in the expression since the concentrations do not change. After you write the expression, explain why the solid concentrations do not change. MgCO3(s) = MgO(s) + CO2(g) Solvents are not included in the expression since the concentrations do not change. After you write the expression, explain why the...
Write the equilibrium constant expression, K, for the following reaction: Please enter the compounds in the...
Write the equilibrium constant expression, K, for the following reaction: Please enter the compounds in the order given in the reaction. If either the numerator or denominator is 1, please enter 1 NH,I(s)NH (g) + HI(g)
(a) Write the expression for the equilibrium constant (Kc) (b) Find Kc, when the equilibrium concentrations...
(a)
Write the expression for the equilibrium constant (Kc)
(b)
Find Kc, when the equilibrium concentrations for NOBr, NO and Br2
are 0.46 M, 0.1 M and 0.3 M respectively. Report to 3 Significant
figures.
(c)
Find Kp for the abovementioned reaction at 25°C. (R=0.082 L.
atm/mole.K)
(d)
Find Kc, for this reaction: NO(g) + 1/2 Br2 (g) <-> NOBr
(g)
1. Consider this reaction to answer the following questions touteiluna ada se in contain yo. 2NOBr (g) 2NO(g) +...
At 850. K, the value of the equilibrium constant K_p for the hydrazine synthesis reaction below...
At 850. K, the value of the equilibrium constant K_p for the hydrazine synthesis reaction below is 0.1900. N_2(g) + H_2(g) rightwardsharpoonoverleftwardsharpoon N_2H_2(g) If a vessel contains an initial reaction mixture in which [N_2] = 0.01000 M, [H_2] = 0.02500 M, and [N_2H_2] = 1.000 times 10^-4 M, what will the [N_2H_2] be when equilibrium is reached? M
5-3 Write the equilibrium constant expression of this reaction and calculate the concentration of all the...
5-3 Write the equilibrium constant expression of this reaction and calculate the concentration of all the gases at equilibrium for the reaction: CO(g) + H20 (g) = CO2(g) + H2 (g) Given that the initial concentrations of all the gases are 0.05 M and that Kc = 5.1 at 700 K.
For the reaction N_2 + 3h_2(g) <===> 2NH_3 (g) at 90 degree C, K_c = 1.27 times 10^-3 Determine K_p for this system. R = 0.08206 L -atm/(mol-K)
Ammonia can be synthesized from nitrogen and hydrogen gases. N_2(g) + 3H_2(g) Rightarrow 2NH_3(g) If Delta H degree = -92.2 kJ and Delta S degree = - 0.1987 kJ/K, what is the value of Delta G degree in kJ for the reaction at 575 degree C. Your answer should be reported to 3 significant figures. Include a - sign if required, but do not include the unit.
PCl_5 decomposes according to the equation PCl_5(g) doubleheadarrow PCl_3(g) + Cl_2(g) At 700 K, a 2 liter flask initially contained only 0.4600 mol PCl_3(g) and 0.6875 mol PCl_5(g). After reaching equilibrium, 0.00800 mol Cl_2(g) was measured in the flask. Calculate the equilibrium concentrations of the three gases and K_c for the reaction. For the reaction, 2 H_2S(g) 2 H_2(g) + S_2 (g), K_0 = 1.7 times 10^-7 at 800.0 degree C If the initial concentration of H_2S in a closed...
K_c for the reaction of hydrogen and iodine to produce hydrogen iodide, H_2(g)+I_2(g) doubleheadarrow 2HI(g) is 54.3 at 430 degree C. Determine the initial and equilibrium concentration of H_2and I_2 are both 0.11 M and their equilibrium concentrations are both 0.048 M at 430 degree
For the following equilibrium: N_2(g) + H_2(g) rightarrow NH_3(g) delta H= -386 kJ/mole Predict the direction the equilibrium will shift if: N_2 is added? H_2 is removed? NH_3 is added? NH_3 is removed? the volume of the container is decreased? the pressure is increased by adding Argon gas? the reaction is cooled? equal number of moles of H_2 and NH_3 are added? a catalyst is added The equilibrium constant for the following reaction is 5.0 at 400 degree C. CO_(g)...
help with questions please
TA'[B Write the expression for the equilibrium constant for the following reactions: N204 (g) 2NO2 (g) N2 (9) + 3H2 (g) = 2NH3 (9) Solids are not included in the expression since the concentrations do not change. After you write the expression, explain why the solid concentrations do not change. MgCO3(s) = MgO(s) + CO2(g) Solvents are not included in the expression since the concentrations do not change. After you write the expression, explain why the...
Write the equilibrium constant expression, K, for the following reaction: Please enter the compounds in the order given in the reaction. If either the numerator or denominator is 1, please enter 1 NH,I(s)NH (g) + HI(g)
(a)
Write the expression for the equilibrium constant (Kc)
(b)
Find Kc, when the equilibrium concentrations for NOBr, NO and Br2
are 0.46 M, 0.1 M and 0.3 M respectively. Report to 3 Significant
figures.
(c)
Find Kp for the abovementioned reaction at 25°C. (R=0.082 L.
atm/mole.K)
(d)
Find Kc, for this reaction: NO(g) + 1/2 Br2 (g) <-> NOBr
(g)
1. Consider this reaction to answer the following questions touteiluna ada se in contain yo. 2NOBr (g) 2NO(g) +...
At 850. K, the value of the equilibrium constant K_p for the hydrazine synthesis reaction below is 0.1900. N_2(g) + H_2(g) rightwardsharpoonoverleftwardsharpoon N_2H_2(g) If a vessel contains an initial reaction mixture in which [N_2] = 0.01000 M, [H_2] = 0.02500 M, and [N_2H_2] = 1.000 times 10^-4 M, what will the [N_2H_2] be when equilibrium is reached? M
5-3 Write the equilibrium constant expression of this reaction and calculate the concentration of all the gases at equilibrium for the reaction: CO(g) + H20 (g) = CO2(g) + H2 (g) Given that the initial concentrations of all the gases are 0.05 M and that Kc = 5.1 at 700 K.
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 14 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 15 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 29 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago