Homework Answers
Fajan's rules for the prediction of bond character can be summarized in two points: Large cation with low positive charge + small anion → ionic. Small cation with high positive charge + large anion → covalent.
1st second is correct
The ionic/covalent character can be determined using the periodic table. The greater the difference in electronegativity between the atoms, the greater the ionic character of the bond.
so CO and BCl is having same electronegative difference thats why they have same ionic character
CO= 3.5-2.5=1.0
BCl=3.0-2.0=1.0
If you like my answer plzzzzzz give positive rating otherwise ask ur doubt in comment
Add Answer to:
For the bonds in these molecules:
LiCl, Br2, NaF, CO2, BCl3
Which has the most ionic...
Be sure to answer all parts. For the bonds in these molecules: KI 02 K20 S02...
Be sure to answer all parts. For the bonds in these molecules: KI 02 K20 S02 BCI; Which has the most ionic character? Which has the most covalent character? Which two bonds have the same ionic character? Which bond has the most ionic character? Which bond has the most covalent character? Which two bonds have the same ionic character? K-I O KI K-I 0-0 0-0 0-0 K-O 0 K-O K-O S-O S-O S-O B-CI B-CI B-CI
Rank these bonds from most ionic to most covalent in character. Ca-F K-F F-F Br-F Cl-F...
Rank these bonds from most ionic to most covalent in character. Ca-F K-F F-F Br-F Cl-F Thanks.
1. Which of the following bonds is the most polar covalent but not ionic? 2. Which...
1. Which of the following bonds is the most polar covalent but
not ionic?
2. Which of the following bonds is the least polar covalent
(but not non-polar covalent bond)?
3. For the following bonds assigned charges to each atom use +
and - for ionic compounds and S+ and S- for covalent bonds where
electrons are not equally shared. If a covalent bond has electrons
equally shared, leave it blank.
Predict which bond has the most covalent character. Group of answer choices C—S Si—N O —...
Predict which bond has the most covalent character. Group of answer choices C—S Si—N O — F Na—Br B—Cl
QUESTION 1 Which of the folowing bonds has the greatest degree of ionic character (polarity Oua...
QUESTION 1 Which of the folowing bonds has the greatest degree of ionic character (polarity Oua QUESTION 2 Which of the following contains nonpolar covalent bonds between atom QUESTION3 The number of valence electrons in the element P оз O s 07 QUESTION 4 Which type of bond invoilves the transfer of electrons between 2 atoms? O ionic polar covalent nonpolar covalent Ocoordinate covalent QUESTION 5 The total number of valence electrons in the sulfite ion SO32is 0 18 O...
all 6. Which combination of atoms is most likely to form an ionic compound if they...
all
6. Which combination of atoms is most likely to form an ionic compound if they are allowed to react with each other? A) metal and metal B) metal and nonmetal C) nonmetal and nonmetal D) metalloid and metalloid E) All combinations are likely to form an ionic compound. 7. A covalent bond involves which of the following? A) sharing of electrons between two atoms B) transfer of electrons between two atoms C) donation of protons from one atom to...
List the following bonds in order of increasing ionic character. (Enter your answer in the format...
List the following bonds in order of increasing ionic character. (Enter your answer in the format H-O for the hydrogen-to-oxygen bond in H2O. Use the appropriate <, =, or > symbol to separate substances in the list.) the sodium-to-fluorine bond in Na-F the magnesium-to-oxygen bond in MgO the lithium-to-lithium bond in Li the chlorine-to-fluorine bond in ClF3 the iron-to-oxygen bond in Fe-O
NAme SAnIRA ID 05100 9 Worksheet-Polarity of Bonds III. Using the table of electronegativities from your...
NAme SAnIRA ID 05100 9 Worksheet-Polarity of Bonds III. Using the table of electronegativities from your Periodic table calculate the EN difference for the atoms that are bonded in the I. Determine the type of bond (ionic, polar covalent, or non-polar covalent) that will form between atoms of the following elements and show the polarity of the bond if it is polar covalent. following molecules. Then tell whether the bond is nonpolar covalent, polar covalent, or ionic. Tell which atom...
6. [4 points] Circle the species in each of the following pairs of atoms that has...
6. [4 points] Circle the species in each of the following pairs of atoms that has the higher first ionization energy (a) Cs or Rb (b) O or Te (c) Cl or Mg (d) Li or Ne 7. [5 points] Write the condensed electron configurations for the following ions (a) Mg Answer: (b) O Answer (c) Fe (d) Mn (e) Ni Answer Answer Answer 8. [4 points] Circle the solid in each of the following sets of ionic compounds that...
3. For each of the following sets of elements, identify the element expected to be the...
3. For each of the following sets of elements, identify the element expected to be the most electronegative and that expected to be the least. a. Li, F, C b. I, CI, F c. Li, Rb, Cs 4. On the basis of electronegativity values given in Figure 11.3, indicate if the following bonds are polar covalent, nonpolar covalent or ionic a. K-N b. Cs- c. C-N d. O-F 5. On the basis of the electronegativity values, indicate which is the...
Be sure to answer all parts. For the bonds in these molecules: KI 02 K20 S02 BCI; Which has the most ionic character? Which has the most covalent character? Which two bonds have the same ionic character? Which bond has the most ionic character? Which bond has the most covalent character? Which two bonds have the same ionic character? K-I O KI K-I 0-0 0-0 0-0 K-O 0 K-O K-O S-O S-O S-O B-CI B-CI B-CI
1. Which of the following bonds is the most polar covalent but
not ionic?
2. Which of the following bonds is the least polar covalent
(but not non-polar covalent bond)?
3. For the following bonds assigned charges to each atom use +
and - for ionic compounds and S+ and S- for covalent bonds where
electrons are not equally shared. If a covalent bond has electrons
equally shared, leave it blank.
QUESTION 1 Which of the folowing bonds has the greatest degree of ionic character (polarity Oua QUESTION 2 Which of the following contains nonpolar covalent bonds between atom QUESTION3 The number of valence electrons in the element P оз O s 07 QUESTION 4 Which type of bond invoilves the transfer of electrons between 2 atoms? O ionic polar covalent nonpolar covalent Ocoordinate covalent QUESTION 5 The total number of valence electrons in the sulfite ion SO32is 0 18 O...
all
6. Which combination of atoms is most likely to form an ionic compound if they are allowed to react with each other? A) metal and metal B) metal and nonmetal C) nonmetal and nonmetal D) metalloid and metalloid E) All combinations are likely to form an ionic compound. 7. A covalent bond involves which of the following? A) sharing of electrons between two atoms B) transfer of electrons between two atoms C) donation of protons from one atom to...
NAme SAnIRA ID 05100 9 Worksheet-Polarity of Bonds III. Using the table of electronegativities from your Periodic table calculate the EN difference for the atoms that are bonded in the I. Determine the type of bond (ionic, polar covalent, or non-polar covalent) that will form between atoms of the following elements and show the polarity of the bond if it is polar covalent. following molecules. Then tell whether the bond is nonpolar covalent, polar covalent, or ionic. Tell which atom...
6. [4 points] Circle the species in each of the following pairs of atoms that has the higher first ionization energy (a) Cs or Rb (b) O or Te (c) Cl or Mg (d) Li or Ne 7. [5 points] Write the condensed electron configurations for the following ions (a) Mg Answer: (b) O Answer (c) Fe (d) Mn (e) Ni Answer Answer Answer 8. [4 points] Circle the solid in each of the following sets of ionic compounds that...
3. For each of the following sets of elements, identify the element expected to be the most electronegative and that expected to be the least. a. Li, F, C b. I, CI, F c. Li, Rb, Cs 4. On the basis of electronegativity values given in Figure 11.3, indicate if the following bonds are polar covalent, nonpolar covalent or ionic a. K-N b. Cs- c. C-N d. O-F 5. On the basis of the electronegativity values, indicate which is the...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 19 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago