A) write the balanced equation for the reaction of vanillin with h2o2 to give divanillin. B)...
A) write the balanced equation for the reaction of vanillin with h2o2 to give divanillin.
B) The first step in the mechanism of this reaction involving vanillin is the formation of phenoxy radical by the abstraction of phenolic H atom. Draw all the neutral resonance structures of this vanillin phenoxy radical. Draw atleast 5. Which resonance structure leads to the divanillin?
Homework Answers
Add Answer to:
A) write the balanced equation for the reaction of vanillin with
h2o2 to give divanillin.
B)...
Mechanisms Question 1 (22 marks) (a) Consider the radical chain reactions of the alkane shown below with Br, in the...
Mechanisms Question 1 (22 marks) (a) Consider the radical chain reactions of the alkane shown below with Br, in the presence of light. H3C HH H C-CCHS CH3 Br2 hv 2 Different mono- bromo products 25 °C + (you will need to look up the bond dissociation energy (BDE) for the types of bonds formed and broken in this reactions) (i) Give the structures of the products from the reaction and using standard arrow conventions show the series of mechanistic...
Please answer all two questions and please explain! I'm completely lost at the moment and I'm...
Please answer all two
questions and please explain! I'm completely lost at the moment and
I'm not sure how to solve it. Please do it step by step if
possible.
10. (10 points) Account for the relative product distribution for the radical bromination reaction shown below. (a) Write the hydrogen abstraction step reaction (radical formation), including the transition state, that leads to each product. (b) Match each reaction to the correct reaction coordinate diagram. Draw the reactants on the energy...
Write balanced reaction equations separately for each of the four steps of your reaction (just give...
Write balanced reaction equations separately for each of the four steps of your reaction (just give the balanced overall equation, not mechanisms). Include all counterions and side products as well as the major reactants and products. a. formation of the n-butyl bromide Grignard reagent b. Magnesium-halogen exchange reaction to make the 4-bromo-N,N-dimethylaniline into a Grignard reagent c. reaction of the Grignard reagent with methyl benzoate. Do not include the addition of HCl step yet. d. reaction of the product in...
CНз NBS, CCI4, hv lintermediate product(s) Hас Give all resonance structures of the allylic radical intermediate tha...
CНз NBS, CCI4, hv lintermediate product(s) Hас Give all resonance structures of the allylic radical intermediate that arise from reaction above. 2. All allylic C-H on the molecule are equivalent so only show the two resonance structures arising from one C-H bond reacting. 3. Are the resonance structures above equivalent or non-equivalent? Think about the degree of the atom where the radical (the dot) is. Give all the products expected from the reaction above. 4.
Write a chemical equation to show (a) the main reaction in this experiment, (b) why Vanillin...
Write a chemical equation to show (a) the main reaction in this experiment, (b) why Vanillin is more soluble in aq. NaOH than plain water, (c) why adding aq. HCI precipitates the product. (d) What would happen if we tried to carry out the reduction in aq. HCl instead of aq. NaOH? 1. 2. How many moles of hydride can be transferred from each mole of NaBHa? 3. Of the reagents used today, which one is both corrosive and flammable?...
Draw the curved arrow mechanism to show the formation of the reaction product on the right....
Draw the curved arrow mechanism to show the formation of the reaction product on the right. Complete all structures to include the electrons and charges necessary for each step. Do not draw any electrons or charges on NO2 or draw any inorganic spectator ions or byproducts. Reagents needed for each step are provided in the boxes. If given a choice, draw the resonance structure with a complete octet.
a. Provide the major product(s) of its reaction with BH3-THF followed by H2O2 in basic aqueous solution. Include stereo...
a. Provide the major product(s) of its reaction with BH3-THF followed by H2O2 in basic aqueous solution. Include stereochemistry. In addition, draw the arrow(s) that leads to the initial interaction between alkene and BH3. Draw the structure of that intermediate and label atoms with d+ and d- to show partial charges, Give a BRIEF explanation for the regioselectivity of the step that follows. b. Provide the curved arrow mechanism and the major product(s) of its reaction with Hg(OAc)2 in 1-propanol...
m. A. Write a chemical equation for the formation of 1,2-dimethoxy--nitrobenzene from the reaction of 3,4-dichloronitrobenzene...
m. A. Write a chemical equation for the formation of 1,2-dimethoxy--nitrobenzene from the reaction of 3,4-dichloronitrobenzene with two equivalents of sodium methoxide. IT. B. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 3-position of 3,4-dichloronitrobenzene. II. C. Draw resonance structures for the anionie intermediate that would be produced by the reaction of methoxide ion at the position of 3,6-dichloronitrobenzene. 4
IT). A. Write a chemical equation for the formation of 1,2-dimethoxy-4-nitrobenzene from the reaction of 3,4-dichloronitrobenzene...
IT). A. Write a chemical equation for the formation of 1,2-dimethoxy-4-nitrobenzene from the reaction of 3,4-dichloronitrobenzene with two equivalents of sodium methoxide. m. B. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 3-position of 3,4-dichloronitrobenzene. I). C. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 4-position of 3,4-dichloronitrobenzene.
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show...
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show all steps, including the loss of water. 1. 2. Write the mechanism for the formation of Crystal violet from diethyl carbonate. 3. Methyl benzoate is an ester, but is technically a carboxylate ester. Diethyl carbonate is a 4. Why is the green dye in this experiment called "Malachite Green"? Hint: Try looking in a 5. Write the balanced equation for the reaction of hydrochloric...
Mechanisms Question 1 (22 marks) (a) Consider the radical chain reactions of the alkane shown below with Br, in the presence of light. H3C HH H C-CCHS CH3 Br2 hv 2 Different mono- bromo products 25 °C + (you will need to look up the bond dissociation energy (BDE) for the types of bonds formed and broken in this reactions) (i) Give the structures of the products from the reaction and using standard arrow conventions show the series of mechanistic...
Please answer all two
questions and please explain! I'm completely lost at the moment and
I'm not sure how to solve it. Please do it step by step if
possible.
10. (10 points) Account for the relative product distribution for the radical bromination reaction shown below. (a) Write the hydrogen abstraction step reaction (radical formation), including the transition state, that leads to each product. (b) Match each reaction to the correct reaction coordinate diagram. Draw the reactants on the energy...
CНз NBS, CCI4, hv lintermediate product(s) Hас Give all resonance structures of the allylic radical intermediate that arise from reaction above. 2. All allylic C-H on the molecule are equivalent so only show the two resonance structures arising from one C-H bond reacting. 3. Are the resonance structures above equivalent or non-equivalent? Think about the degree of the atom where the radical (the dot) is. Give all the products expected from the reaction above. 4.
Write a chemical equation to show (a) the main reaction in this experiment, (b) why Vanillin is more soluble in aq. NaOH than plain water, (c) why adding aq. HCI precipitates the product. (d) What would happen if we tried to carry out the reduction in aq. HCl instead of aq. NaOH? 1. 2. How many moles of hydride can be transferred from each mole of NaBHa? 3. Of the reagents used today, which one is both corrosive and flammable?...
Draw the curved arrow mechanism to show the formation of the reaction product on the right. Complete all structures to include the electrons and charges necessary for each step. Do not draw any electrons or charges on NO2 or draw any inorganic spectator ions or byproducts. Reagents needed for each step are provided in the boxes. If given a choice, draw the resonance structure with a complete octet.
a. Provide the major product(s) of its reaction with BH3-THF followed by H2O2 in basic aqueous solution. Include stereochemistry. In addition, draw the arrow(s) that leads to the initial interaction between alkene and BH3. Draw the structure of that intermediate and label atoms with d+ and d- to show partial charges, Give a BRIEF explanation for the regioselectivity of the step that follows. b. Provide the curved arrow mechanism and the major product(s) of its reaction with Hg(OAc)2 in 1-propanol...
m. A. Write a chemical equation for the formation of 1,2-dimethoxy--nitrobenzene from the reaction of 3,4-dichloronitrobenzene with two equivalents of sodium methoxide. IT. B. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 3-position of 3,4-dichloronitrobenzene. II. C. Draw resonance structures for the anionie intermediate that would be produced by the reaction of methoxide ion at the position of 3,6-dichloronitrobenzene. 4
IT). A. Write a chemical equation for the formation of 1,2-dimethoxy-4-nitrobenzene from the reaction of 3,4-dichloronitrobenzene with two equivalents of sodium methoxide. m. B. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 3-position of 3,4-dichloronitrobenzene. I). C. Draw resonance structures for the anionic intermediate that would be produced by the reaction of methoxide ion at the 4-position of 3,4-dichloronitrobenzene.
Write the mechanism for the formation of Malachite Green from methyl benzoate. Be sure to show all steps, including the loss of water. 1. 2. Write the mechanism for the formation of Crystal violet from diethyl carbonate. 3. Methyl benzoate is an ester, but is technically a carboxylate ester. Diethyl carbonate is a 4. Why is the green dye in this experiment called "Malachite Green"? Hint: Try looking in a 5. Write the balanced equation for the reaction of hydrochloric...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago